2 WHAT ARE THE THREE THINGS NECESSARY TO MAINTAIN A FIRE?
Answer:
Oxygen, heat, and fuel
Explanation:
Oxygen, heat, and fuel are frequently referred to as the "fire triangle." Add in the fourth element, the chemical reaction, and you actually have a fire "tetrahedron." The important thing to remember is: take any of these four things away, and you will not have a fire or the fire will be extinguished.
Consider the reaction below. H2PO4â€"" H2O Right arrow. H3O HPO42â€"" Which of the following is a baseâ€""conjugate acid pair? H2O and H3O H2O and H2PO4â€"" H2PO4â€"" and HPO42â€"" H2PO4â€"" and H3O.
Taking into account the Brønsted-Lowry acid-base theory, a base/conjugate acid pair is H₂O/H₃O⁺.
The Brønsted-Lowry acid-base theory (or the Brønsted-Lowry theory) identifies acids and bases based on whether the species accepts or donates protons or H⁺.
According to this theory, acids are proton donors while bases are proton acceptors. That is, an acid is a species that donates an H⁺ proton while a base is a chemical species that accepts an H⁺ proton from the acid.
So, reactions between acids and bases are H⁺ proton transfer reactions, causing the acid to form its conjugate base and the base to form its conjugated acid by exchanging a proton.
In other words, a conjugate base is an ion or molecule resulting from the acid that loses the proton, while a conjugate acid is an ion or molecule resulting from the base that gains the proton:
acid + base ⇄ conjugate base + conjugate acid
In this case, you know:
H₂PO₄ + H₂O → H₃O⁺ + HPO₄⁻
H₂PO₄ behaves like acid because donates an H⁺ proton while H₂O behaves like base because accepts an H⁺ proton from the acid.
So, H₃O⁺ is the conjugate acid of the H₂O and HPO₄⁻ is conjugate base of H₂PO₄.
In summary, a base/conjugate acid pair is H₂O/H₃O⁺.
Learn more about the Brønsted-Lowry acid-base theory:
https://brainly.com/question/12916250?referrer=searchResultshttps://brainly.com/question/1191429?referrer=searchResultshttps://brainly.com/question/4000152?referrer=searchResultshttps://brainly.com/question/12808135?referrer=searchResultsHELP ME PZLMSMS
E
D
D
F
F
Answer:
10.C
11.B
15.A
Explanation:
What is the formula of sulfur diphosphide
[tex] \huge \rm \ \blue \:{ \overbrace{ \underbrace{ \tt{ \color{red}{ \: \: \: \: \: \: answer \: \: \: \: \: \: }}}}}[/tex]
[tex] \huge \color{darkblue}P₂S_{5}[/tex]
hope it helpsAnswer:
P2S5
Explanation:
what are two possible ways to show the structure of ch4?
Answer: Two possible ways to show the structure of CH4 are its electron dot diagram or structural formula. CH4 or methane's molecular formula is given as CH4. The structural formula is a graphical representation of a chemical compound.
Answer:
using electron dot diagrams or structional formula
What does the electron configuration for the noble gases tell us about the elements in the
group
Answer:That all noble gases will have 8 valence electrons which makes a atom stable
Explanation:
Students in Mr. Garcia's class were having a race! No, not running. Instead they rolled tennis balls down a wooden track. The tennis balls have the same mass and diameter. Using the data table, decide which ball had the MOST kinetic energy.
Answer:
it's entertaining. Energy though is the answer
what can cats get from eating mice and moles?
Answer:
its called Toxoplasmosis.
Explanation:
Cats become infected by Toxoplasma gondii by ingesting the cysts of this parasite. Most often, this occurs when cats eat mice or rats infected with the parasite. However, they can also ingest it during grooming after coming in contact with infected soil or feces.
hope it helped ;)
What is meant by collision theory?
Answer:
The collision theory states that a chemical reaction can only occur between particles when they collide (hit each other).
hope it helps~
The work you do on a machine is called the_________________
Answer:
THE WORK YOU DO ON A MACHINE IS CALLED WORK INPUT
What halogen can react with sodium chloride solution to produce chlorine?
Answer:
As electro-negativity decreases from Florine to downwards in the group and only Florine is above Chlorine, so Florine should react with sodium chloride solution to produce chlorine.
mark me brinilylist pls
what is the formula of trinitrogen tetrabromide
The formula of trinitrogen tetrabromide is N3Br4
How to determine the molecular formulaTrinitrogen features three molecules of nitrogen, N3
Tetrabromide features four molecules of bromide = Br4
Thus, the formula of trinitrogen tetrabromide is N3Br4
Learn more about molecular formula here:
https://brainly.com/question/17405634
#SPJ1
Which of these substances are greenhouse gases? Check all that apply. Oxygen carbon dioxide helium methane nitrous oxide.
The greenhouse gases are carbon dioxide, methane, and nitrous oxide.
The greenhouse effect has been defined as the entrapment of the sun's energy by the gases that result in the earth becoming warmer and a better place to live.
The gases present in the atmosphere that has been able to entrap the heat energy has been termed the greenhouse gases.
The greenhouse gases have been carbon dioxide, methane, and nitrous oxide.
For more information about greenhouse gases, refer to the link:
https://brainly.com/question/11595872
Answer:
carbon dioxide, nitrous oxide, methane
Explanation:
Explain the reason that maps must change over time
Explanation:
Because the place on the map can be changed to another shape by natural effects like faulting,folding , volcanism
Answer:
Maps must change over time as the geographical structures change from time o time. The roads and highways also change often due to the development activities .
State two properties of a base
Answer:
Bases are bitter to taste a bitter taste is characteristic of all bases. Bases may or may not be soluble in water Bases that can dissolve in water are called alkalis.Explanation:
Which statement describes one feature of Rutherford model of the atom
[tex] \huge{ \color{magenta}{ \fcolorbox{magenta}{black}{ \huge{ \color{white}{ \fcolorbox{aqua}{black}{♡Answer♡ }}}}}}[/tex]
The Rutherford model shows that an atom is mostly empty space, with electrons orbiting a fixed, positively charged nucleus in set, predictable paths.
What are some examples of a chemical change? (list more than 2 examples)
Cooking any food.
Burning of wood.
Digestion of food.
Acid-base reaction.
If the velocity of a wave is 12 m/s and its frequency is 600 hertz, what would be its wavelength?
Answer:
The wavelength is 0.02 m.
Step-by-step explanation:
Given :
[tex]\green\star[/tex] Velocity = 12 m/s[tex]\green\star[/tex] Frequency = 600 HzTo Find :
[tex]\green\star[/tex] WavelengthUsing Formula :
Apply Wavelength formula :
[tex]\star{\small{\underline{\boxed{\sf{\purple{\lambda = \dfrac{v}{f}}}}}}}[/tex]
[tex]\pink\star[/tex] λ = Wavelength [tex]\pink\star[/tex] v = Velocity [tex]\pink\star[/tex] f = FrequencySolution :
Finding the wavelength by substituting the values in the formula :
[tex]{\longrightarrow{\sf{\lambda = \dfrac{v}{f}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = \dfrac{12}{600}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = \dfrac{\cancel{12}}{\cancel{600}}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = \dfrac{2}{100}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = \cancel{\dfrac{2}{100}}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = 0.02}}}[/tex]
[tex]\star{\underline{\boxed{\tt{\red{\lambda = 0.02 \: m}}}}}[/tex]
Hence, the wavelength is 0.02 m.
Explain why some substances travel further than others.
Larger molecules take longer to move up the chromatography paper or TLC plate, whereas smaller molecules are more mobile. Likewise, the polarity of the molecules can affect how far the spots travel, depending on the type of solvent used.
[tex]\large\sf\red{♡♡}[/tex]
How long is a sunflower seed? Select the best estimate.
15 meters
15 kilometers
15 millilmeters
15 centimeters
Answer:
15 millimeters
Explanation:
the other answer choices are too large.
Answer:
15 millimeters
Explanation:
The other options are too long.
50 points for anyone who answeres properly. How does a structure of a triglyceride differ from the reaction of fructose?
Triglycerides and fructose are both monomers, but they differ in how they bond to other monomers.
Fructose forms large polymers by the process of hydrolysis, while a triglyceride forms monomers by the process of dehydration.
Fructose is a form of carbohydrate, while a triglyceride is a lipid.
A triglyceride is a polymer, while fructose is a monomer.
Answer:
Fatty Acids
A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.
Saturated Fatty Acids
In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.
Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.
Unsaturated Fatty Acids
In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.
Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.
Lipids and Diet
Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.
Fructose is a simple carbohydrate sugar, while triglycerides are the lipids or the fats of the body. Thus, option C is accurate.
What are triglycerides and fructose?Triglycerides are lipids of the body that are formed of fatty acids and glycerols. It makes the body fat of the animals and of the plants. They are stored in cells for future use and provide energy when needed.
Fructose is a monomer that is the simplest carbohydrate sugar and is generally found in sugarcane, honey, watermelon, grapes, apples, etc.
Therefore, option C. fructose is sugar and triglyceride is fat is correct.
Learn more about triglycerides and fats here:
https://brainly.com/question/17576593
#SPJ2
5 grams of sodium bicarbonate, a white powdery solid, is placed in an empty red balloon. 100 grams of acetic acid, a clear aqueous solution, is placed in the plastic bottle. The balloon is carefully attached to the bottle so that no air can get in or out and the powder does not fall into the bottle. Once attached, the apparatus is placed on a balance and the contents are mixed. Bubbles form, the balloon inflated, and the white powder is no longer visible. Which of the these statements would match your observations? A) A chemical reaction has occurred and the mass will increase. B) A chemical reaction has occurred and the mass will decrease. C) A physical reaction has occurred and the mass will decrease. D) A chemical reaction has occurred and the mass will remain the same.
Answer: im pretty sure its D
Explanation:
Michael was sitting at his desk one morning. He noticed a small spot of light on the wall
which moved with his arm. What could be causing this spot of light on the wall?
O a) light from the window being refracted
by his watch band
b) light from the window reflecting off the
face of his watch
O c) light from the window being absorbed
by the wall
d) light from his watch refracting on the
wall
Answer:
Light from the window reflecting off the face of his watch <33
Of the following elements, which one has the smallest first ionization energy?
A. boron
B. carbon
C. aluminum
D. silicon
Answer:
C. Aluminum
Explanation:
Aluminum has 5.9858 ionization energy
Boron has 8.298 ionization energy
Silicon has 8.1517 ionization energy
Carbon has 11.2603 ionization energy
100 POINTS PLEASE HELP
1. What is the molar mass of NaOH?
2.How many atoms are in 3.35 moles of Aluminum?
3.How many moles of CO2 gas are in a 101.25 L container filled with CO2 gas?
4.What is the mass of 13.7 moles of N2 gas?
5.How many moles are in 78.5 molecules of CaCO3?
Answer:
1. 39.997 g/mol
2. 6.022⋅1023 atoms of aluminium
3. 0.026 moles
4. 14 grams is the molar mass of nitrogen meaning that one mole of nitrogen atoms is 14 grams. One mole of any substance has 6.02*10^23 atoms/molecules of that subtance therefore there are 6.02*10^23 atoms of nitrogen in 14g of nitrogen
5. 78.5
Explanation:
Would you expect the shielding effect to be greater in bromine than in chlorine?
A. Yes, because there are more filled orbitals in bromine.
B. Yes, because bromine has a higher atomic number.
C. No, because they are both in the same family.
D. No, because chlorine has a higher electronegativity than bromine.
The shielding effect of bromine is greater than chlorine because there are more filled orbitals than in chlorine.
Shielding EffectThis is the process where by electrons are protected by the pull attraction of the nucleus with the use of electron shells. The shielding effect increases down the group of the periodic table and increases across the period. This is because when you move down the group, there's an increase in the number of shell by 1 and it helps to reduce the effect of nuclear attraction on the electrons. However when you move across the period, there's an increase in the numbers of electron with the same shielding electrons from group 1(a) across the period to group 7(a).
Factor that affect the shielding effect of an electronThe numbers of electrons on the inner shells.Type of orbital which the electron is located.Shielding effect is primarily dependent on the numbers of electrons in the inner shells as well as the type orbitals.
Learn more about shielding effect here;
https://brainly.com/question/14040040
https://brainly.com/question/2984106
the photo has the question; please help asap ! i’m giving brainliest—i also have more chemistry, honestly i’m about to post a whole bunch of questions
Answer:
The process is to divide the molecules by Avogadro's number (6.02 x 10^23) to get the moles. And since it's specified at STP (standard temperature and pressure) we know that the molar volume would be 22.4L. So we can just multiply the moles by the molar volume in order to get the volume of H2S.
(2.18 x 10^24) / (6.02 x 10^23) = 3.62 moles (rounded)
Now just multiply the moles by the molar volume of STP, 22.4.
3.62 x 22.4 = 81 Liters (rounded) of H2S
Why is it important to be careful when walking on an icy sidewalk?
Ice moves faster than you do.
There is less friction on an icy surface.
Ice is heavier than you, so it is a greater force.
none of the above
Answer:
The is less friction on an icy surface
Explanation:
This is because when u walk on plain ground there is steady friction on the surface but when u walk on an icy floor these is barely any friction which is why it's hard to walk on.
Answer:
There is less friction on an icy surface.
Hope that helps.
Explanation:
how does ionization energy increase on the periodic table
[tex]\huge \bf༆ Answer ༄[/tex]
The trends showing increase in ionization energy on the periodic table ~
Ionization energy increases as we move from left to right in a period.[ due to increase in effective nuclear charge ]
Ionization energy increases as we move from bottom to top in a group.[ Due to decrease in number of shells ]
Ionization energy increases across a period from left to right in the periodic table.
Ionization energyIonization energy is the energy needed for the complete removal of valence electrons in its ground state from an isolated atom in its gaseous phase at a specified temperature to form an ion.
Ionization energy shows periodicity in that it shows a regular variation across a period and down a group in the periodic table.
Ionization energy increases across a period from left to right in the periodic table.
Learn more about ionization energy at: https://brainly.com/question/1445179
What is the mass number (A) of an atom that has an atomic number (Z=26) with 29 neutrons and 26 electrons?
Atom information–
Atomic number (Z) = 26Protons (p⁺) = 26Neutrons (n⁰) = 29Electrons (e⁻) = 26The atomic number (Z) of an atom is the number of protons (p⁺) it hasThe mass number (A) of an atom is characterized by the sum of the amount of protons (p⁺) with its neutrons (n⁰)Substituting values –
[tex]\qquad[/tex] [tex]\twoheadrightarrow\bf A=p^{+}+n^{0}[/tex]
[tex]\qquad[/tex] [tex]\twoheadrightarrow\bf A=26+29[/tex]
[tex]\qquad[/tex] [tex]\twoheadrightarrow\bf A=55[/tex]
____________________________________________