Given a room is 14 feet by 16 feet and we have a circular rug with a radius of 4.5
feet, calculate the amount of floor left uncovered by the circular area rug in a
rectangular living room. Show all work.

Answers

Answer 1

The amount of floor left uncovered by the circular area rug is 160.36 ft².

What is the amount of floor left uncovered by the circular area rug?

The first step is to determine the area of the rectangular room.

Area of the rectangular room = length x width

14 x 16 = 224 ft²

The second step is to determine the area of the circular rug.

area of the circular rug = πr²

= 22/7 x 4.5² = 63.64

Now, subtract the area of the rug from the area of the room:

Area left uncovered =  224 ft² -  63.64 = 160.36 ft²

To learn more about the area of a circle, please check: https://brainly.com/question/14351152


Related Questions

Thomas rents a car for his vaccation the milliage included with the 54 miles forer every mile he drives over 54 miles he needs to pay 5 integer 4 by 5 dollar if he drives 69 miles how much extra does he needed to pay

Answers

Answer:

$27

Step-by-step explanation:

Thomas rents a car for his vacation. The mileage include with the rental is 54 miles. For every mile he drives over 54 miles, he needs to pay $1 4/5. If he drives 69 miles, how much extra does he need to pay?

Total mileage included with the rental = 54 miles

Additional cost per mile after 54 miles = $1 4/5

Total miles Thomas drives = 69 miles

Extra miles Thomas drives = 69 miles - 54 miles

= 15 miles

how much extra does he need to pay?

Extra cost Thomas needs to pay = Additional cost per mile after 54 miles * Extra miles Thomas drives

= $1 4/5 * 15 miles

= 9/5 * 15

= (9 * 15) / 5

= 135/5

= 27

Extra cost Thomas needs to pay = $27

Use a substitution strategy to solve the following problem.
Two isosceles triangles have the same base length. The equal sides of one of the triangles
are 3 times as long as the equal sides of the other. Find the lengths of the sides of the triangles when
their perimeters are 34 cm and 82 cm.

Answers

Answer:

The length of the equal sides of the isosceles triangle with a perimeter of 34 cm perimeter is 12 cm

The length of the equal sides of the isosceles triangle with a perimeter of 82 cm perimeter is 36 cm

The base length of both triangles is 10 cm

Step-by-step explanation:

The given parameters are;

The base length of the triangles are equal

The base length of one of the triangle = The base length of the other triangle

The equal sides of one of the triangles = 3 × The length of the equal sides of the other

The perimeter of the triangles are; 34 cm and 82 cm

Let 'b' represent the base length of each triangle, let 'a' represent the length of an equal side of the smaller triangle with a perimeter of 34 cm and let 'c' represent the length of an equal side of the larger triangle with a perimeter of 82 cm

For the smaller triangle, we have;

b + 2·a = 34..(1)

For the other triangle;

b + 2·c = 82...(2)

Given that the side length of the larger triangle are larger than those of the smaller triangle, and that the side length of the larger triangle is 3 times the side length of the smaller triangle, we get;

c = 3·a

By the substitution method, from equation (2) we get;

b + 2·c = b + 2 × 3·a = b + 6·a = 82

∴ b + 6·a = 82...(3)

Subtracting equation (1) from equation (3) gives;

b + 6·a - (b + 2·a) = 82 - 34 = 48

b - b + 6·a - 2·a = 48

4·a = 48

a = 48/4 = 12

The length of the equal sides of the 34 cm perimeter (smaller) isosceles triangle, a = 12 cm

From c = 3·a, and a = 12, we get;

c = 3 × 12 = 36

The length of the equal sides of the 82 cm perimeter (larger) isosceles triangle, c = 36 cm

From equation (1), we get;

b + 2·a = 34

∴ b + 2 × 12 = 34

b = 34 - 2 × 12 = 10

The base length of both triangles, b = 10 cm

2 Kenedi has a piece of ribbon that measures
24 inches long. She cuts the ribbon into
15 equal pieces to attach to her dance
costume. Kenedi uses the expression shown to
calculate the length of each piece of ribbon she
uses on her costume.
241 - 15
Which of the following expressions CANNOT be
used to determine the length of each piece of
ribbon?
15
F99=
G (242) (15)
H7+15
J 241-15

Answers

Answer:

The length of each ribbon is 1.6 inches

Step-by-step explanation:

From the question, we are told that:

Kenedi has a piece of ribbon that measures 24 inches long. She cuts the ribbon into 15 equal pieces to attach to her dance costume

Hence, the expression that can be used to show how to calculate the length of each piece of ribbon is given as:

24 inches ÷ 15 pieces

= 24 ÷ 15

= 1.6 inches

Therefore, the length of each ribbon is 1.6 inches

If U={1,2,3,.............,10} A={2,4,6,8,10} and B= {1,3,5,7,9); then
find(A-B)?​

Answers

Answer:

{2, 4, 6, 8,10}

Step-by-step explanation:

GIven U={1,2,3,.............,10} A={2,4,6,8,10} and B= {1,3,5,7,9);

Required

A-B = AnB'

B' = {2, 4, 6, 8,10}

AnB' are elements common to both A and B'.Hence;

AnB' = A- B = {2, 4, 6, 8,10}

Sally plots (−4,π)on the polar plane.


How does she proceed?


Drag a phrase to each box to correctly complete the statements.

Answers

Solution :

As Sally determines the angle of rotation, since it is π, she lies on the negative x-axis. The first block then should be negative x-axis if r is positive and in the positive x-axis if r is negative.

My other reason for changing the dragged phase would be as they used the word, therefore, in the last sentence, which would mean an interference from the above statements, from the drag phase you have given the interference would be positive x-axis.

A 6) Set both given equations equal to zero, then combine them into one standard form
equation. Simplify if possible.
7x + 3 = 5 and y-1 = 6

Answers

Answer:

The standard equation is 7x + y = 9

Step-by-step explanation:

Equations given are:  

7x + 3 = 5 and y - 1 = 6

Set both given equations equal to zero, then combine them into one standard form equation

Set the equations to zero by moving the constant from R.H.S to L.H.S

7x + 3 - 5 = 0

7x - 2 = 0 ---- eq 1

y - 1 = 6

y - 1 - 6 = 0

y - 7 = 0 ----- eq 2

We have to combine eq 1 and eq 2

7x - 2 + y - 7 = 0

7x + y - 9 = 0

The standard form of an equation is Ax + By = C

In this kind of equation, x and y are variables and A, B, and C are integers

Thus the standard equation is:

7x + y - 9 = 0

7x + y = 9

Thus the standard equation is 7x + y = 9

ReeeeeeeeeeeereEeeeeereeeee

Answers

Answer:

22

Step-by-step explanation:

B racket

I ndices

D division

M multiplication

A addition

Subtraction

Work out answer using the BIDMAS order

12/2+(6-2)^2

6+(4)^2

6+16=22

Best of luck!!

Find the area of this prism.

Answers

Do you mean volume? Its a 3d figure:
240 cubic centimeters.

Just use the formula length x width x height
And divide the figure into two figures so u can find the area much easier

Comm.ent me if u have any questions,
-SpaceMarsh
Brainliest pls?

Find f(x+2) of the function f(x)= 4x^2+2x-4 HELP ASAP PLEASE WORTH 40 POINTS

Answers

Answer:

Given

f(x)= 4x²+2x-4

To find f(x + 2) substitute x with x + 2 in the given function:

f(x+2)= 4(x + 2)² + 2(x + 2) - 4

         = 4(x² + 4x + 4) + 2x + 4 - 4

         = 4x² + 16x + 16 + 2x

         = 4x² + 18x + 16

f(x+2)

4(x+2)²+2(x+2)-44(x²+4x+4)+2x-4-44x²+16x+16+2x4x²+18x+16

Irene faced north. She turned 270 ° to the left and then 90 ° more to the left.
In what direction is Irene now facing?

Answers

North again. 270 + 90 = 360, hence the full rotation

Find the set of the possible values of p for which the equation 3x² + px + 3 = 0 has no real roots.

*Using graphical method or comparing the signs.

Answers

Answer:

[tex]delta = {b}^{2} - 4ac = {p}^{2} - 4 \times 3 \times 3 = {p}^{2} - 36[/tex]

The equation has no real roots if delta <0

that is -6<p<6

pls pls help ez middle school math

Answers

Step-by-step explanation:

[tex]\sqrt{x^2-6x + 9} = \sqrt{(x - 3)^2}= x - 3[/tex]

Please help me figure out how to solve functions

Answers

Answer:

f(6) = 24

Step-by-step explanation:

To evaluate f(6) substitute x = 6 into f(x) , that is

f(6) = 6² - 2(6) = 36 - 12 = 24

AC = 16, AB = x + 1, and BC = x + 7. What is the measure of the length of AB? HELP

Answers

Answer:

5

Step-by-step explanation:

AC=AB+BC

so 16=x+1+x+7

which simplifies to 16=2x+8

subtract eight from both sides to get 8=2x

then divide by 2 to get that x=4

AB=x+1, which substitutes into 4+1=5

don't mind the purple dot ​

Answers

Answer:

option A

Step-by-step explanation:

22 : 15 + 10hours = 8 : 15

                              8 : 15 + 35 minutes = 8 : 50

Therefore the difference = 10 hours 35 minutes

Find the area of the circle shown Use pi=3.14

Answers

Answer:

50.24 sq cm

Step-by-step explanation:

radius is 4 (half of 8)

A=(3.14)4^2

A=50.24

Answer:

B) 50.24 sq.cm

Step-by-step explanation:

equation for area of circle is [tex]\pi r^{2}[/tex]

radius is half of diameter

radius = 4 cm

[tex]\pi (4)^2[/tex] = 50.24 sq.cm

"which of the numbers below can be classified as an integer" and the options are . 10÷2 , -0.3 ,√20 ,. 0.4​

Answers

Answer:

The number 10/2 = 5 is an integer.

Step-by-step explanation:

An integer is a whole number which cannot be expressed in fractions. For example, 1, 2, 3...

Integer can be positive,  negative of zero.

[tex]\frac{10}{2}=5[/tex]

It is a whole number so it is an integer.

- 0.3

It is not an integer as it has a fractional part.

[tex]\sqrt20[/tex]

It also has a fractional part, so it is not an integer.

0.4

It also has a fractional part, so it is not an integer.

How much is -1/4 is 1 1/3?

Answers

Answer:

4 option

Step-by-step explanation:

Proportions in similar triangles

Answers

Answer:

x = 4

Step-by-step explanation:

Given that DE is parallel to AC then DE divides the sides proportionally, so

[tex]\frac{BD}{DA}[/tex] = [tex]\frac{BE}{EC}[/tex] , substitute values

[tex]\frac{x+2}{x}[/tex] = [tex]\frac{3}{2}[/tex] ( cross- multiply )

3x = 2(x + 2) ← distribute

3x = 2x + 4 ( subtract 2x from both sides )

x = 4

An angle is bisected, forming two new angels. If the original angle had a measure of 14 degree, what is the measure of each new angle

Answers

Answer:

The measure of each angle will be 7 degrees. It is because a bisector divides an angle in two equal halves. 14 / 2 = 7

PLEASE HELP WILL MARK BRAINLIEST

Answers

WHERES THE QUESTION IT WONT SHOW UP ON MY SCREEN POST IT AGAIN

WILL GET BRAINLIEST
Which does NOT represent the interior angle measures of a triangle? A.5°, 75°, 100°B.10°, 80°, 90°C.20°, 60°, 100°D.45°, 45°, 45°E.50°, 50°, 80°

Answers

Answer:

3 * 45 = 135 which is NOT 180

45, 45, 90 would work

Step-by-step explanation:

hope it helps!

Given three points A(-7, 1), B(m, 6) and P(-1, n). If the point P divides AB internally in the ratio of 3: 2, find the values of m and n.​

Answers

Answer:

m = 3 , n = 4

Step-by-step explanation:

Using Section Formula.

[tex]If \ the \ line \ segment \ AB \ where \ A = (x _1, y_1) \ and \ B = (x_2, y_2) \ divided \ by \ P =(x , y) \ in \ the \ ratio \ a : b,\\\\Then \ the \ points \ of \ P \ \\\\x = \frac{ax_2 + bx_1}{a+b} \ and \ y = \frac{ay_2 + by_1}{a+b}[/tex]

   [tex]Here (x_1 , y_ 1 ) = ( -7 , 1 ) \ and \ (x_ 2 , y _ 2 ) = (m , 6)\\\\ratio\ a:b = 3 : 2\\\\Therefore, P (x, y) \\\\x = \frac{3m + (2\times -7)}{5} \ \ \ \ \ \ \ \ \ \ \ [ \ x = -1 \ ] \\\\-1 = \frac{3m - 14}{5}\\\\- 5 = 3m - 14\\\\-5 + 14 = 3m\\\\9 = 3m \\\\m = 3[/tex]

  [tex]y =\frac{3\times 6 + 2 \times 1}{5}\\\\n = \frac{18 + 2}{5} = \frac{20}{5} = 4[/tex]

HELP
Find the circumference of this circle
using 3 for T.
C [?]


Answers

Answer:

3

Step-by-step explanation:

3

Hannah lost four points on a test and earned four points on an extra credit question what does the sum of 0 mean in the description of this situation?

Answers

Answer:

Is that it's not about the answers and the questions

Write 100 + 2 + 0.09 in standard form

Answers

102.09

Just add them up

1) The population of Leafy Lake starts at 3,000 and grows by 25% every year. What will the population be in 6 years?

how do I solve it

Answers

X/3,000 = 25/100
100x = 3,000x25
100x = 75,000
100x/100 = 75,000/100
X = 750

750x6 = 4,500
Every year the population goes up by 750, in 6 years the population would be 4,500 people.

Answer:

Step-by-step explanation:

Rate of increase = r = 25%

n = number of years = 6

P = Current population = 3000

Population after n years = [tex]P*(1 + \frac{r}{100})^{n}[/tex]

            [tex]= 3000 * (1 +0.25)^{6}\\\\= 3000 * (1.25)^{6}\\\\= 3000 * 3.8\\\\= 11400=[/tex]

Find the value of the variable that results in congruent triangles. Explain. SAS (Side, Angle, Side) or ASA (Angle, Side, Angle)

Answers

well, let's keep in mind that the SAS postulate, so if one Side and the Angle next to it and the following Side after the angle are equal on both triangles, both triangles are congruent.  Now, we have the angle 30° with sides and 9 and 2x and sides 9 and x + 4, well, the 9's are equal, dohh, you know, if only the 2x  = x + 4, we'd be golden

[tex]2x = x + 4\implies 2x - x = 4\implies \boxed{x = 4}[/tex]

someone help me with this

Answers

Answer:

stars: triangles

3  : 1

Step-by-step explanation:

There are 3 starts and 1 triangle

stars: triangles

3  : 1

Answer:

3:1

Step-by-step explanation:

3 Stars and 1 Triangle

7.5 as an improper fraction in its simplest form

Answers

Answer:

7.5 as an improper fraction in its simplest form would be 15/2

Other Questions
The second reaction in the formation of sulfuric acid occurs slowly.2 upper S upper O subscript 2 (g) plus upper O subscript 2 (g) right arrow 2 upper S upper O subscript 3 (g).NO2 is added to the reaction to speed it up. In which form would this substance be a homogeneous catalyst for this reaction?NO2(g)NO2(l)NO2(s)NO2(aq) Debbie did a survey of how many states the members of her class had visited. The results were: 10, 15, 23, 2, 21, 31, 14, 10,8.17, 11, 19.8.42.15. 22. 6, 34, 19.3, 24,What is the five-number summary for this set of data? Sarah makes 5 ribbons the first day. On the second day she doubles the number ofribbons made in the first day. On the third day she doubles the number what she madeon the second day. How many ribbons has she made on the third day? Anyone know the answer? What common base can be used to rewrite each side of the equation 2^x+3-3-5?A2B3C5D8 Which of the following statements is false?Weight is a vector quantityWeight is measured in newtons. N The weight of an object is the same on the Earth and the moon How long does it take to get more skips x/2-y/3=3,4x-3y=22[tex] > < [/tex] Electronegativity6. Which one of the following bonds is the least polar one?options:C-FC-ClC-BrC-I A crane has a cable with breaking strain 6400 kg it's used to lift crates weighing 90kg what's the greatest number of crates that can safely be lifted at one time without breaking the cable rewrite this sentence using direct and indirect object pronouns. Marta Escribe un libro de historia para sus estudiantes Imagine that you were reading an international marketing text in which you learnedthat the GDP for a nation that was a member of the former Soviet Union was $1.56billion. A few pages later in the same text, the book states that that nation's real GDPwas $800,000. From reading this information, you would know that: 5. List four expenses usually found on a family's budget. batho pele principles According to real business cycle theorists, ______________ consumption resulting from the major production innovations incentivizes businesses to borrow ______________ from banks, causing the money supply to ______________. convert .25 cups to mL? 12=x/5 plsss helpppppp Write an essay expressing your own thoughts as a student now in the midst of a pandemic.It only takes 7-10 sentencesNonsense =report Hello there, I need help with Angles. ayudenme porfa doy corona xd