Help please!
Matthew launches a ball is at 34 meters per sec from a 28 meter tall platform. The function of the ball's height (h) at time (*) seconds after launch is
h(t) = -12t^2 + 34t + 28.

Help Please!Matthew Launches A Ball Is At 34 Meters Per Sec From A 28 Meter Tall Platform. The Function

Answers

Answer 1

Answer:

17 seconds

Step-by-step explanation:

h(t) represents height, we want to know when the ball will return to a height of 28 feet. So our equation is..

28 = -2t² + 34t + 28

Now solve for t...

0 = -2t² + 34t (subtract 28 from both sides)

0 = t² - 17t (divide both sides by -2)

0 = t(t - 17) (factor out a t)

So

t = 0

or

t - 17 = 0

t = 17

0 seconds is the initial height. At 17 seconds, the ball will return to that height

i hope this work for you


Related Questions

Function f is defined by f(x)=3/2x+c. If f(6)=1, what is the value of f(c)?

Please don't just give me an answer, explain it so I understand. Thanks.

Answers

Answer:

C = - 8

Step-by-step explanation:

[tex]f(x) = \frac{3}{2} x + c \\ \\ plug \: x = 6 \\ \\ f(6) = \frac{3}{2} \times 6 + c \\ \\ f(6) = 3 \times 3 + c \\ \\ f(6) = 9+ c \\ \\ \therefore \: 1 = 9 + c \: \{ \because \: f(6) = 1 \} \\ \\ 1 - 9 = c \\ \\ \huge \red{ \boxed{ c = - 8}}\\\\

f(c) =\frac{3}{2} c +(-8)\\\\

\huge \orange { \boxed{ f(c) =\frac{3}{2} c -8}} \\\\ [/tex]

Is it a function? Or not

Answers

Answer:

Nah

Step-by-step explanation:

Nah tbh I don't think so if I'm being honest

A two-way frequency table shows grades for students in college and students in high school: high school college total gpa above 3.0 14 26 40 gpa below 3.0 46 14 60 60 40 100 based on this data, are "being in high school" and "gpa above 3.0" independent events? yes, p(high school ∩ gpa above 3.0) = p(high school) ⋅ p(gpa above 3.0) no, p(high school ∩ gpa above 3.0) = p(high school) ⋅ p(gpa above 3.0) yes, p(high school ∩ gpa above 3.0) ≠ p(high school) ⋅ p(gpa above 3.0) no, p(high school ∩ gpa above 3.0) ≠ p(high school) ⋅ p(gpa above 3.0)

Answers

Based on the data in two-way frequency table, "being in high school" and "gpa above 3.0" are not independent events.

What is conditional probability?

The conditional probability is the happening of an event, when the probability of occurring of other event is given.

A two-way frequency table shows grades for students in college and students in high school.

Let H represent being in high school and G represent the GPA above 3.0. To be an independent event, they must be,

[tex]P(H|G)=P(H)[/tex]

The conditional probability of event H, given that the G is occurred, can be calculated as,

[tex]P(H|G)=\dfrac{14}{40}\\P(H|G)=0.35[/tex]

Total students below 3.0 GPA are 60 and the total number of student are 100. Thus, the probability of being in high school is

[tex]P(H)=\dfrac{60}{100}\\P(H)=0.6[/tex]

Here, conditional probability [tex]P(H|G)[/tex] is not equal to the probability of being in high school.

Hence, based on the data in two-way frequency table, "being in high school" and "gpa above 3.0" are not independent events.

Learn more about the probability here;

https://brainly.com/question/24756209

5c+16.5=13.5+10c
solve for c

Answers

Answer:

c = 3/5

Step-by-step explanation:

5c+16.5=13.5+10c

Subtract 5c from both sides:

13.5+5c=16.5

5c=3

c = 3/5

5c-10c=13.5-16.5
-5c=-3
c=3/5

Lucy is going to walk in a fundraising event to raise money for her school band her mother has agreed to donate 7.50$ to the school for each mile Lucy walks plus an additional 25$ write an equation that represents y, the total amount of money Lucys mother will donate if she walks x miles during the event

Answers

25=7.50x              Lucy walked 3.333 miles

If one root of the equation x^2 + 5x + k = 0 is -2, what is the value of k?

Answers

Answer:

k = 6

Step-by-step explanation:

given x = - 2 is a root then substitute x = 2 into the equation

(- 2)² + 5(- 2) + k = 0

4 - 10 + k = 0

- 6 + k = 0 ( add 6 to both sides )

k = 6

Answer:

k = 6

Step-by-step explanation:

since x = - 2 put x = 2 into the equation

(- 2)² + 5(- 2) + k = 0

4 - 10 + k = 0

-6 + k = 0

+6        +6

k = 6

Which of the following statements about parallelograms are true?
Select all that apply.

options:

All parallelograms have 4 right angles.


All parallelograms have rotational symmetry of 90°.


All parallelograms have rotational symmetry of 180°.


A rectangle is a parallelogram.


All parallelograms have exactly 4 lines of symmetry.

Answers

Answer:

All parallelograms have 4 right angles.

All parallelograms have rotational  symmetry of  180°.

A rectangle is a parallelogram.

Step-by-stepStep-by-step explanation:

let me know if im wrong......have a good day!!!!  :)

What is the standard form of y+4=2x-5

Answers

2x-y=9 hope this helps :)

Y is the midpoint of XZ and W is the midpoint of VX.
If VZ=s+52 and WY=7s, what is the value of s?

Answers

Answer:

4

Step-by-step explanation:

By the triangle midsegment theorem, 2(YW)=VZ.

This means 2(7s)=s+52, meaning s=4.

A jar contains 550 beans. Of all the beans, 2/5 are white beans and the rest are navy beans. What is the ratio of white beans to navy beans? How many white and navy beans are in the jar?

Answers

White beans: 220
Navy beans:330

A, B & C form the vertices of a triangle.
∠ CAB = 90°,
∠ ABC = 46° and AB = 9.2.
Calculate the length of AC rounded to 3 SF.

Answers

Answer is: AC= 9.52

-4x^2+2x-5(1+x) what is the answer

Answers

Answer:

4x^2−3x−5

Step-by-step explanation:

Kodiak is riding her skateboard
down a hill.
What is the slope?


Please help asap

Answers

Answer:

Slope = 1/20

Step-by-step explanation:

Because every 1 second, she goes down 20 feet.

Answer:the answer is the pic

Step-by-step explanation:

hope this helps bye

2. A Cylindrical hot water tank is closed at both ends. The radius of the tank is 0.5m and the height is 0.75.calculate i. The volume of the Cylinder it. The total surface area of the tank (take π =22 out of 7​

Answers

Answer:

Volume = 0.59 m³

Surface Area = 3.93 m²

Step-by-step explanation:

Given :-

- Radius = 0.5 cm

- Height = 0.75 cm

To Find :-

- Volume

- Surface Area

Solving :-

Volume = πr²h

= 22/7 x (0.5)² x 0.75

= 22/7 x 1/4 x 3/4

= 66/112

= 33/56 m³

= 0.59 m³

Surface Area = 2πr (r + h)

= 2 x 22/7 x 0.5 (0.5 + 0.75)

= 22/7 x 5/4

= 110/28

= 55/14 m²

= 3.93 m²

Solution :-

Volume = 0.59 m³

Surface Area = 3.93 m²

Answer:

1. Formula for volume of a cylinder;

V = πr^2h

where pi is 3.14 or 22/7, r is the radius(0.5) which is squared, and h is the height

plug in the actual values;

V = πr^2h

V = 3.14 * 0.5^2 * 0.75

V = 3.14 * 0.25 * 0.75

V = 0.785 x 0.75

V = 0.58875^3 meters or 0.59^3 meters, is the volume. (round to whatever place they covet)

2. Formula for surface area of a cylinder;

SA = 2πr(r + h)

Plug in the actual values:

SA = 2πr(r + h)

SA = 2 x 3.14 x 0.5(0.5 + 0.75)

SA = 2 x 3.14 x 0.5(1.25)

SA = 2 x 3.14 x 0.625

SA = 3.925 meters or 3.93 meters is the surface area.

The radius of a circle is 4 inches. What is the circle's circumference?

Answers

Answer:

8π inches or approximately 25.12 inches

Step-by-step explanation:

What's the circumference of a circle?

 ❖ The circumference of a circle is the distance around a circle.

How do we find the circumference of a circle?

 ❖ The formula to find the circumference of a circle is 2πr, where r =    

      radius. We can solve in terms of pi, or approximate pi to 3.14

Solving

[tex]\pi * 4*2[/tex] [tex]\pi *8[/tex] 8π inches

or

[tex]3.14*4*2[/tex] [tex]3.14*8[/tex] 25.12 inches

Have a lovely rest of your day/night, and good luck with your assignments! ♡

Answer:

See below.

Step-by-step explanation:

Hi there!

We are given a circle, and inside that circle, we know that the radius of that circle is 4 inches

We want to find the circumference of the circle.

The circumference (C) is essentially the perimeter of a circle; the formula for the circumference of a circle is 2πr (r is the radius, π is pi)

Since we know the radius, we can substitute that value into the formula

C=2πr, r=4

C=2π*4

C=8π

If you need the answer in terms of pi, then the answer is 8π inches. However, if you need a number, then substitute an approximation for π, which will usually be 3.14 or 22/7

Using 3.14 for example,

C=8*3.14=25.12 inches

Using 22/7 meanwhile,

C=8*22/7=25.14 inches  (rounded to the nearest hundredth)

So the answer is either 8π inches, 25.12 inches, or 25.14 inches (depending on how you need it approximated)

Either way, hope this helps!

See more on finding the circumference of a circle given the radius here: https://brainly.com/question/15882336

In the following number, which digit is in the ten thousand places?

7,253,917

A.2
B.5
C.3
D.9

Answers

Answer:

B. 5

Step-by-step explanation:

How it is 5 is because well if you look to the side you can easily see that the 3 is in the Thousands place so.. the 5 would most likely be in the Ten Thousands place. Your Welcome!

Answer: B. 5

Explanation:

Refer to the place value chart shown below.

The 5 is in the ten-thousands place value.

There's not much else I can add to that explanation, but feel free to ask any other questions you may have.

Adrianna has a piece of fabric in the shape of a parallelogram.

What is the area of this parallelogram?




32 in²

64 in²

96 in²

128 in²

Answers

96 in² I think

Make the triangles into a rectangle, find the area and add it to the original square

Answer: 96 in²

Step-by-step explanation: The parallelogram is comprised of two triangles and one square. You could solve this one of two ways.

1) Find the area of the total parallelogram. The area is b*h, where b is the base and h is the height. The base will ALWAYS be the sum of whatever is on the bottom. In this model, we have 4" and 8", meaning b=12". Now, the height is 8" as seen by the vertical line connecting the top and bottom of the figure. 12 times 8 is 96 inches squared.

2) Find the area of the square and two triangles. The area of a triangle is 1/2*b*h, where b is the base (4") and h is the height (8"). Seeing as we have two triangles, we can do this twice, getting 0.5*4*8 + 0.5*4*8 (1/2 is the same as 0.5 btw). 32 inches squared is for the two triangles. Finally, you need to find the square. To review, the area of a square is s^2, so 8*8 is 64. 64+32 is 96 inches squared.

Clair grows berries. A flock of birds comes to her field every day and eats berries. Clair plays loud recordings of a different animal each day to scare the birds, but none have helped so far. One day Clair played a recording of loud eagle calls, and the birds never came to her field.
What could be inferred?

A. The flock ate berries from a different fleld.

B. The flock migrated south

C. The flock was scared away by the eagle calls.

D. The flock may have wanted to share the berries with the eagles.

E. The flock Is afraid of all loud animal calls.​

Answers

so for this question you need to look at what changed and what caused the change. the question states that the only real difference between when the flock of birds came and when they didn’t come was the loud eagle call (not any other loud animal), so it can be inferred that the eagle call scared the flock of birds away. so the answer is most likely c. hope this helps!!

Find the sum.

48 + 45 + 42+. +(-81) + (-84)

Answers

Answer:

-810

Step-by-step explanation:

I found the answer but this is correct for khan

Can anyone help me with this?

Answers

Answer:

brrooo me too i hate bell work

Step-by-step explanation:

good luck tho

i’m honestly not sure about the answer but..
anything multiplied by zero would equal zero
so the value of q would be 0.

q=2(0)p
q=(0)p
q=0

Z(y+8)-6(y+8) factor out the gcf

Answers

Answer:

A quadratic inequality is an equation of second degree that uses an inequality sign instead of an equal sign. The solutions to quadratic inequality always give the two roots. The nature of the roots may differ and can be determined by discriminant (b2 – 4ac).

Sarah wants to save for a car. She has $4,250 in a savings account earning 1.49%
compounded quarterly. If Sarah has four years until she gets her driver's license,
will she have enough to buy a car? If not, what do you recommend that she do to
reach her goal?

Answers

Given the amount Sarh has in her account, she would not have enough money to buy a car. I would advise she increases the amount of money in her account.

What is the future value of the money in her account?

The formula for calculating future value:

FV = P (1 + r)^nm

FV = Future value P = Present value R = interest rate m = number of compoundingN = number of years

$4250( 1 + 0.0149/4)^(4 x 4) = $4510.50

To learn more about future value, please check: https://brainly.com/question/18760477

Which trigonometric functions have the same maximum value?

Answers

This is a list of trigonometric functions with the same maximum value:

(A) y = arcsinx and y = cos x

What are trigonometric functions?

The trigonometric functions in mathematics are real functions that connect the right-angled triangle's angle to the ratios of its two side lengths.

They are extensively employed in all fields of geometry-related study, including geodesy, solid mechanics, celestial mechanics, and many others.

There are six popular trigonometric functions for an angle.

Sine (sin), cosine (cos), tangent (tan), cotangent (cot), secant (sec), and cosecant are their respective names and acronyms (csc).

So, the following equations give us the following maximum values:

arcsinx = -1 to 1

arccosx = -1 to 1

arctanx = -pi/2 to pi/2

arcsecx = ∞

Arcsinx and Arccosx are trigonometric functions that have the same maximum value.

Therefore, this is a list of trigonometric functions with the same maximum value:

(A) y = arcsinx and y = cos x

Know more about trigonometric functions here:

https://brainly.com/question/25618616

#SPJ1

Complete question:

Which trigonometric functions have the same maximum value?

A. y = arcsinx and y = arccosx

B. y = arcsinx and y = arctanx

C. y = arctanx and y = arcsecx

D> y = arccosx and y = arcsecx

find the distance between the points (9, 8) and (9, 3)​

Answers

Answer: √

(

x

2

x

1

)

2

+

(

y

2

y

1

)

2

Substitute the actual values of the points into the distance formula.

(

9

9

)

2

+

(

3

8

)

2

Step-by-step explanati i hope you under stand

3: find the missing side length of the similar shapes.

Answers

Answer:

21 ft

Step-by-step explanation:

the amount of times 12 goes into 18 is 1.5

this is also true for 18 to 27

so that means

when you multiply 14 to 1.5

you get what the ? is

14 * 1.5 = 21

is is 21 ft

50082740 x 382039849 - 92894330 + 83022098 divided by 380209382- put it into a punnet square table grid with 3823u02938 and find u and find y and find x to equal 2098309823

Answers

I tried but I kinda forgot to make your hair shorter. I got a little carried away.

a map has a scale of 1 inch = 16 miles. What is the actual distance if the distance on the map is 9 3/4 inches

Answers

Answer:

156 miles

Step-by-step explanation:

For every inch, you will have 16 miles

So if you have 9 3/4 inches you can just multiply that with 16

9 3/4*16=156

Our answer is 156 miles

Select either relation (if the set is a relation but not a function), function (if the set is both a relation and a function), or neither (if the set is not a relation).

A = {(1, 2) (2, 2) (3, 2) (4, 2)}

Answers

Answer:

Function

Step-by-step explanation:

Since each x value corresponds to a single y value

A recipe for pasta dough says, “Use 150 grams of flour per large egg.” How much flour is needed if 6 large eggs are used?

Answers

Answer:900g

Step-by-step explanation:

150*6=900

Answer:

900 grams of flour

Since you already know that 150 grams of flour is used for one large egg

Just do 150×6 and that will give you the answer of 900.

I hope that helps :)

please please help me!​

Answers

Answer:

D: -5,-2,1,5

R:10,11,4,

Step-by-step explanation:

The domain is the set of all the values of x.

The range is the set of all the values of y

Other Questions
Kelly really wants to buy a car. She needs a down payment of $6000. Ifshe deposits $4550 now with interest compounding continuously at 5%,how many years will it take her to save enough to buy the car? Laura peino antes de ir a la escueuela Based on your reading of the following, choose the best answer to the question. The KittyKarry Company manufactures carriers for cats as well as cat toys and other products (for example, grooming products) for the discerning feline. The company wishes to expand its line of products and has decided to set up focus groups of feline owners to learn more about what kinds of products they might want or need for their cats. The focus groups are part of which stage in the formal process of product development?A. generate ideasB. screen ideasD. develop the conceptE. market and sell the product Write the equation in standard form for the circle x + y + 6y - 4 = 0 Problems related to alchol include A.Black outs,hangovers and ulcersB.All of these Can someone please help quick! Read the excerpt from Cristina Garcias Dreaming in Cuban.The sunset flares behind a row of brownstones, linking them as if by a flaming ribbon. Lourdes massages her eyes and begins walking with legs that feel held by splints.Im glad to see you, Lourdes. Thank you for everything, hija, the hat, the cigars. You buried me like an Egyptian king, with all my valuables! Jorge del Pino laughs.Lourdes perceives the faint scent of her fathers cigar . . .Where are you, Papi?The street is vacant, as if a force has absorbed all living things. Even the trees seem more shadow than substance.Nearby, her father says, serious now.The author uses magic realism byrevealing Jorges appreciation for his valued burial gifts.describing the support for Lourdess unstable legs as she walks.using words such as flares, faint, vacant, and shadow.comparing the description of the setting sun with a flaming ribbon. ajoute un cd aprs le verbe dans la phrase Les balises de dtresse du voilier envoie ... on another training ride,Jana bikes 15 miles in 50 mins.Explain how you could find the number of miles she bikes in 1 hour who created individual rights 3) Chemically pure water is A) an element B) a compound C) a mixture D) a solution Calculate the concentration of the lactate ion in a solution that is 0.100 mm in lactic acid ( ch3ch(oh)coohch3ch(oh)cooh , pkapka = 3.86) and 0.080 mm in hclhcl . solve the equation using the quadratic formula. 3x^2+7x-20=0 You can't understand our Constitution unless you understand this clause. What is the clause -- can some someone please help ----How far did the object move between 0 and 20 s? m____________ Find the circumference of the object. Use 3.14 or22/7 for . Round to the nearest hundredth if necessary. Determine the gcf of each set of monomials35,30a Please help*I will give brainiest* Solve for x. Round to the nearest tenth, if necessary. Homeowners pay on the land they own. Workers pay on the money they earn in the workplace. Businesses are required to pay on their earnings