If 8 Superscript y Baseline = 16 Superscript y + 2, what is the value of y?

Answers

Answer 1

Answer:

10. Where was the medical mission held? A. At Barangay Tatalon Marikina B. At Barangay Almanza Las Piñas City C. At Barangay Pamplona Las Piñas City D. At Barangay CAA BF INT'L Las Piñas City


Related Questions

The amounts of nicotine in a certain brand of cigarette are normally distributed with a mean of 0.974 g and a standard deviation of 0.325 g. The company that produces these cigarettes claims that it has now reduced the amount of nicotine. The supporting evidence consists of a sample of 48 cigarettes with a mean nicotine amount of 0.918 g. Assuming that the given mean and standard deviation have NOT changed, find the probability of randomly seleting 32 cigarettes with a mean of 0.917 g or less.

P(M < 0.917 g) = __________

Answers

Answer:

P(M < 0.917 g) = 0.1611.

Step-by-step explanation:

To solve this question, we need to understand the normal probability distribution and the central limit theorem.

Normal Probability Distribution:

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

Central Limit Theorem

The Central Limit Theorem establishes that, for a normally distributed random variable X, with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the sampling distribution of the sample means with size n can be approximated to a normal distribution with mean [tex]\mu[/tex] and standard deviation [tex]s = \frac{\sigma}{\sqrt{n}}[/tex].

For a skewed variable, the Central Limit Theorem can also be applied, as long as n is at least 30.

Mean of 0.974 g and a standard deviation of 0.325 g.

This means that [tex]\mu = 0.974, \sigma = 0.325[/tex]

Sample of 32:

This means that [tex]n = 32, s = \frac{0.325}{\sqrt{32}}[/tex]

Fnd the probability of randomly selecting 32 cigarettes with a mean of 0.917 g or less.

This is the p-value of Z when X = 0.917. So

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

By the Central Limit Theorem

[tex]Z = \frac{X - \mu}{s}[/tex]

[tex]Z = \frac{0.917 - 0.974}{\frac{0.325}{\sqrt{32}}}[/tex]

[tex]Z = -0.99[/tex]

[tex]Z = -0.99[/tex] has a p-value of 0.1611.

So

P(M < 0.917 g) = 0.1611.

what is the area of the rectangle?
answers: 120 m
120 m2
120m3
120 cubic meters
top of the rectangle: 12 m
bottom of the rectangle:12 m
side of the rectangle: 10 m
side of the rectangle:10 m

Answers

Answer:

B

Step-by-step explanation:

Area = L * W

L = 12 m

W = 10 m

Area = 12 m * 10 m

Area = 120 m^2

Answer;

A. 120m²

Step-by-step explanation:

Given That :-

Length of rectangle = 12mWidth of rectangle = 10m

To find :-

Area of rectangle.

Solution :-

[tex]\begin{gathered}\begin{gathered}\begin{gathered}\begin{gathered} \sf Length = 12m\: \: \: \: \: \: \: \: \: \: \: \\ \begin{gathered}\begin{gathered}\boxed{\begin{array}{}\bf { \red{}}\\{\qquad \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: }{}\\ { \sf{ }}\\ { \sf{ }} \\ \\ { \sf{ }}\end{array}}\end{gathered}\end{gathered} \sf \: Width = 10m \end{gathered}\end{gathered} \end{gathered} \end{gathered}[/tex]

The area of a rectangle is equal to the length times the width.

Length × Width

Substitute the values of the length l =12 and width w = 10 into the formula for the area of a rectangle.

12m × 10m

Multiply 12m by 10m

12m × 10m= 120m²

Hence, Area of rectangle is 120m² which means option A. is correct answer.

What is the 100th term of 1, 6, 11, 16

Answers

Answer:

496

Step-by-step explanation:

a+99d

1+ 99 (5)

1+ 495

Write the indicated event in set notation.When four coins are tossed, the first three tosses come up the same.[Hint: when four coins are tossed, the following 16 outcomes are possible:HHHH HHHT HHTH HHTTHTHH HTHT HTTH HTTTTHHH THHT THTH THTTTTHH TTHT TTTH TTTT ]a. (HHH, TTT) b. (HHHT, TTTH) c. (HHHT, TTTH, HTTT, THHH) d. (HHHH, HHHT, TTTH, TTTT)

Answers

Answer:

[tex]Outcomes = \{HHHH, HHHT,TTTH, TTTT\}[/tex]

Step-by-step explanation:

Given

[tex]S = \{HHHH, HHHT, HHTH, HHTT,HTHH, HTHT, HTTH, HTTT, THHH, THHT,[/tex]

[tex]THTH, THTT,TTHH, TTHT, TTTH, TTTT\}[/tex]

Required

The outcomes where the first three tosses are the same

To do this, we list out the outcomes that the first three are HHH or TTT.

So, we have:

[tex]Outcomes = \{HHHH, HHHT,TTTH, TTTT\}[/tex]

What is f(-2) for f(x)=(1/2)x^2

Answers

Answer:

[tex]{ \bf{f(x) = \frac{1}{2} {x}^{2} }} \\ \\ { \tt{f( - 2) = \frac{1}{2} {( - 2)}^{2} }} \\ = 2[/tex]

solve for x in the equation 9- x/4=2

Answers

Answer:

9-x/4=2

[tex] \frac{36 - x}{4} = 2[/tex]

[tex]36 - x = 2 \times 4[/tex]

[tex]36 - x = 8[/tex]

[tex] 36 - 8 = x[/tex]

[tex]28 = x[/tex]

[tex]x = 28[/tex]

9 - x/4 = 2

(36 - x)/4 = 2

36 - x = 8

36 - 8 = x

x = 28

I hope you understand...

Mark me as brainliest...

Insert a digit to make numbers that are divisible by 24 if it is possible: 83...8

plz i need help fast

Answers

Answer:

2

Step-by-step explanation:

8328÷24=347

hope this is helpful

the sum of two consecutive numbers is 2x+3. What are the numbers

Answers

Answer: 2 and 3

Step-by-step explanation:

its numbers

An angle measures. What is the measure of its complement? (b) An angle measures 48 . What is measure 26 of its supplement?

Answers

90 - 48 = 42 complement

180 - 26 = 154 supplement

Hoping that is what you were looking for from you question.

A line contains the points (2,4) and (−6,−2).

Which equation represents the line?






a. y+2=4/3(x+6)

b. y−2=3/4(x−6)

c. y−2=4/3(x−4)

d. y−4=3/4(x−2)

Answers

Answer:

D) y-4=3/4(x-2)

Step-by-step explanation:

m=(y2-y1)/(x2-x1)

m=(-2-4)/(-6-2)

m=-6/-8

simplify

m=3/4

y-y1=m(x-x1)

y-4=3/4(x-2)

Find Trig Ratios (with Radicals)

Answers

Answer:

the answer is 45 + 5-75 is equals to 30 +5

Any help 13 points

If the price of tacos is $1.75, how many will consumers buy?

Answers

Answer:

B-100 If the price of tacos is $1.75, th consumers will buy 100 tacos

The triangle has area of 72cm^2 and base of 18cm find the perpendicular height of the triangle​

Answers

Answer:

The height is 8 cm

Step-by-step explanation:

The area of a triangle is

A = 1/2 bh

72 = 1/2 (18)h

72 = 9h

Divide each side by 9

72/9 = 9h/9

8 = h

The height is 8 cm

Answer:

8cm

Step-by-step explanation:

let y represent height

Area of a triangle=½base×height=72cm²

72cm²=½×18cm×y

72cm²=9cmy

72cm²/9cm=9cmy/9cm

8cm=y

Noel and Casey both start at the same place. Noel walks due south and Casey walks due east. After some time has passed, Noel is 6 miles south and Casey is 8 miles east. At this time, Noel is walking at a rate of 2 mph and Casey is walking at a rate of 1 mph. How fast is the distance between them increasing at this time

Answers

Answer:

2.04 miles per hour

Step-by-step explanation:

Given

Noel

[tex]n_1 =6miles[/tex]

[tex]r_1 = 2mph[/tex]

Casey

[tex]c_1 = 8miles[/tex]

[tex]r_2 =1mph[/tex]

Required

The rate at which the distance increases

Their movement forms a right triangle and the distance between them is the hypotenuse.

At [tex]n_1 =6miles[/tex] and [tex]c_1 = 8miles[/tex]

The distance between them is:

[tex]d_1 = \sqrt{n_1^2 + c_1^2}[/tex]

[tex]d_1 = \sqrt{6^2 + 8^2}[/tex]

[tex]d_1 = \sqrt{100}[/tex]

[tex]d_1 = 10miles[/tex]

After 1 hour, their new position is:

New = Old + Rate * Time

[tex]n_2 = n_1 + r_1 * 1[/tex]

[tex]n_2 = 6 + 2 * 1 = 8[/tex]

And:

[tex]c_2 = c_1 + r_2 * 1[/tex]

[tex]c_2 = 8 + 1 * 1 = 9[/tex]

So, the distance between them is now:

[tex]d_2 = \sqrt{n_2^2 + c_2^2}[/tex]

[tex]d_2 = \sqrt{8^2 + 9^2}[/tex]

[tex]d_2 = \sqrt{145}[/tex]

[tex]d_2 = 12.04[/tex]

The rate of change is:

[tex]\triangle d = d_2 -d_1[/tex]

[tex]\triangle d = 12.04 -10[/tex]

[tex]\triangle d = 2.04[/tex]

Which step in the solution contains the first error ?? Please helpp

Answers

Answer:

step 4 I believe

Step-by-step explanation:

the step in the solution that contains the first error is step 4

12. Mr. Ellis bought several rose bushes
for $65 each. He was charged a $15
delivery fee. If r represents the number
of rose bushes, which expression
can be used to find the total cost of
Mr. Ellis' purchase?
A 150 - 65
B 65r + 15
c 15(r + 65)
D 651 - 15

Answers

Answer:

B

Step-by-step explanation:

Because every rose bush costs $65 and it's charged with a $15 delivery fee.

Help Me Pls i need it now
Nonsense = Report​

Answers

Answer:

8,6,3, v= 144

4,8,6, v=192

15,10,6, v=900

Step-by-step explanation:

Answer:

This geometric questions are very very simple let's start to solve all steps

Step-by-step explanation:

L means long of Prism and look at 8 and 6 for first prism. Which one is longest of course 8

w means wide =6

h means high=3 and

V means Volume: You must multiply by 3, 6,8 to find volume, so we can say Volume 3*6*8=144 easily

z =x^2-y^2 for find the domain​

Answers

Answer:

R^2

Step-by-step explanation:

The domain for z =x^2-y^2 is R^2 ,where is the set of all real numbers.

Write the equation of the line passing through the point ​(​6,-9​) with slope -5/6.

Answers

Answer:

The equation is y = -5/6 x-4

Step-by-step explanation:

The equation of a line in slope intercept form is

y = mx+b where m is the slope and b is the y intercept

y = -5/6 x+b

Substitute in the point

-9 = -5/6(6) +b

-9 = -5+b

Add  5 to each side

-4 = b

The equation is y = -5/6 x-4

Find f(5) for f(x)-1/9(3)*
O A. 27
O B. 81
O C. 9
O D. 3

Answers

D 3

If not I apologize

Complete the point-slope equation of the line through (-5,7) and (-4,0)

y-7=?

Answers

Slope rule = y2-y1/x2-x1

Slope = 0-7/-4+5= -7/1= -7

Slope = -7

Best of wishes and good luck!!

1. Leo ran around the track three times. The track was 400 meters. How many kilometers did he run altogether?​

Answers

1.2k kilometers because 3(4)=12 it works the same in the 100’s. 3(400)=1200.

The resting heart rate for an adult horse should average about µ = 47 beats per minute with a (95% of data) range from 19 to 75 beats per minute. Let x be a random variable that represents the resting heart rate for an adult horse. Assume that x has a distribution that is approximately normal.

Required:
a. What is the probability that the heart rate is less than 25 beats per minute?
b. What is the probability that the heart rate is greater than 60 beats per minute?
c. What is the probability that the heart rate is between 25 and 60 beats per minute?

Answers

Answer:

a. 0.0582 = 5.82% probability that the heart rate is less than 25 beats per minute.

b. 0.1762 = 17.62% probability that the heart rate is greater than 60 beats per minute.

c. 0.7656 = 76.56% probability that the heart rate is between 25 and 60 beats per minute

Step-by-step explanation:

Empirical Rule:

The Empirical Rule states that, for a normally distributed random variable:

Approximately 68% of the measures are within 1 standard deviation of the mean.

Approximately 95% of the measures are within 2 standard deviations of the mean.

Approximately 99.7% of the measures are within 3 standard deviations of the mean.

Normal Probability Distribution:

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

Mean:

[tex]\mu = 47[/tex]

(95% of data) range from 19 to 75 beats per minute.

This means that between 19 and 75, by the Empirical Rule, there are 4 standard deviations. So

[tex]4\sigma = 75 - 19[/tex]

[tex]4\sigma = 56[/tex]

[tex]\sigma = \frac{56}{4} = 14[/tex]

a. What is the probability that the heart rate is less than 25 beats per minute?

This is the p-value of Z when X = 25. So

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]Z = \frac{25 - 47}{14}[/tex]

[tex]Z = -1.57[/tex]

[tex]Z = -1.57[/tex] has a p-value of 0.0582.

0.0582 = 5.82% probability that the heart rate is less than 25 beats per minute.

b. What is the probability that the heart rate is greater than 60 beats per minute?

This is 1 subtracted by the p-value of Z when X = 60. So

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]Z = \frac{60 - 47}{14}[/tex]

[tex]Z = 0.93[/tex]

[tex]Z = 0.93[/tex] has a p-value of 0.8238.

1 - 0.8238 = 0.1762

0.1762 = 17.62% probability that the heart rate is greater than 60 beats per minute.

c. What is the probability that the heart rate is between 25 and 60 beats per minute?

This is the p-value of Z when X = 60 subtracted by the p-value of Z when X = 25. From the previous two items, we have these two p-values. So

0.8238 - 0.0582 = 0.7656

0.7656 = 76.56% probability that the heart rate is between 25 and 60 beats per minute

A group of campers is going to occupy campsites at a campground. There are 16 campsites from which to choose. In how many ways can the campsites be​ chosen?

Answers

Answer:

The campsites can be chosen in 5,765,760 different ways.

Step-by-step explanation:

Given that a group of campers is going to occupy 6 campsites at a campground, and there are 16 campsites from which to choose, to determine in how many ways the campsites can be chosen, the following calculation must be performed:

16 x 15 x 14 x 13 x 12 x 11 = X

240 x 182 x 132 = X

240 x 24,024 = X

5,765,760 = X

Therefore, the campsites can be chosen in 5,765,760 different ways.

Write an equation and solve for angle G? Show work

Answers

Answer:

50

Step-by-step explanation:

Complementary angles mean that the sum of the angles given is 90°. Therefore, as G and H are complementary, this means that G+H=90

G+H=90

(2x+10) + (x+20) = 90

Add values on left side

3x+30=90

Subtract 30 from both sides

3x=60

Divide both sides by 3

x=20

Since we now know the value of x, we can plug that in to G (2x+10) to get 2(20)+10 = 50 = G

Susan uses the function p(x) = 4x to determine the perimeter of a square when she knows the side length, x. Which statements are true about the function?

The perimeter is the dependent variable.
The length of the side of the square is the dependent variable.
The value of p(x) depends on the value of x.
The length of the side of the square is the independent variable.
The value p(x) can be found by multiplying p by x.
The perimeter is the independent variable.

Answers

Answer:

Step-by-step explanation:

The perimeter is the dependent variable.  TRUE

The length of the side of the square is the dependent variable.  FALSE

The value of p(x) depends on the value of x.  TRUE

The length of the side of the square is the independent variable.  TRUE

The value p(x) can be found by multiplying p by x.  FALSE

The perimeter is the independent variable.  FALSE

your teacher for the discussion-based assessment.
In circle D, LEDH LEDG.
1. Determine the length of JG using
circle D.
Show your work and write out your
justification.
E
57"
9
Be prepared to answer questions
about additional angles, arcs and
segments from circle D.
F
D
J
H
669
G
2.
In OK, mZHKG=x+ 10 and
MZIKI = 3x - 22. Find m F).
74K
F
F
3. Find MLADB
OG with FA and FE tangent at A and E.
4. Find m2ABD
А
F
5. Find mzAFE
82
B
G
6. Find mLACE
E
1489
H Н
VOD

Answers

Answer:

3

Step-by-step explanation:

Please help will mark BRAINLIEST!!!

Answers

Answer:

b, c, a

Step-by-step explanation:

In a triangle, the largest angle is opposite the longest side. The smallest angle is opposite the shortest side.

This triangle has 2 given angles, 50° and 60°.

We can find the measure of the third angle, x.

50 + 60 + x = 180

x + 110 = 180

x = 70

The three angles have measures 50°, 60°, and 70°.

The shortest side is opposite the smallest angle. That is side a.

The longest side is opposite the largest angle. That is side b.

The order from longest to shortest is

b, c, a

add negative 4 plus negative 6​

Answers

-10

thats it, thats what i know

What is Start Fraction 5 Over 8 End Fraction divided by One-fourth?

Answers

Answer:

2.5

Step-by-step explanation:

5/8 ÷ 1/4

Division sign changes to multiplication and the reciprocal of the divisior is used to multiply instead :

5/8 * 4/1

= (5*4) / (8*1)

= 20 / 8

= 2.5

Other Questions
carbon dioxide gas evolve during the fermentation of sugar which was collected at 22.5C and 0.945 ATM after perfect strangers in the volume was found to be 25.0 ML how many grams of carbon dioxide were collected who is the father of music Help meIs not an exam is a activity someone sigeeeeeeeeeeeeeeShe turned in _____ keys to the lost and found.someonessomeonessomeonesomeones An infographic displays the relative frequencies of the 100 most common emojis used in text messaging for each of the last 12 months. Which of the following conclusions cannot be drawn from such a representation of emoji usage?a. You can determine the growth or decline in popularity of a particular emoji.b. You can determine what percentage of text messages contains a particular emoji.c. You can determine how long the most popular emoji has held the #1 position.d. You can determine the average age of emoji users based on emoji use. First Amendment civil liberties related to a free press can be limited when apublication's words are:A. critical of the government.B. biased toward one group.C. meant to influence young people.D. a danger to public safety. Mr Li is four times as old as his son. In five years time, the sum of their ages will be 60 years. How old are they now? Which describes a way in which phosphorus may enter into the phosphorus cycle?Earthquakes release phosphorus.Phosphorus is carried in the rain that was evaporated from lakes.Human use of fertilizers release phosphorus into the groundwater.Phosphorus is transpired from the leaves of plants. Help me pls quick with the right answer In tennis, Gabby serves an ace, a ball that can't be returned, 7 out of the 10 times she serves. What is the experimental probability that Gabby will serve an ace in the first match of the next game? The experimental probability that Gabby will serve an ace in the first match of the next game is . Use the / to write your fraction. If a well-diversified portfolio of stocks has an expected return of 15% when the expected return on the market portfolio is 10%, then:__________a) Treasury bills are offering a 7% yield.b) The portfolio beta is greater than 1.0.c) The portfolio beta equals 1.67.d) The investor's portfolio contains many defensive stocks. PLS HELP LAST THING I NEED FOR MATH THIS SCHOOL YEARANSWER WITH STEP BY STEP SOLOUTION/PROCESS = BRAINLIEST ANSWER AND 5* VOTETROLLS = WILL GET ALL THEIR ANSWERS AND QUESTIONS REPORTEDPART 2, PART 1 ALREADY POSTED CHECK PROFILE What form of energy is needed to make photosynthesis happen?A. Proton energyB. Chemical energC. Electron energyD. Solar energy classify the expression: 5x-4 5- Identifica en las oraciones y di que tipo de adverbio es. -Los estudiantes muy dedicados logran sus metas. -Los atletas llegaron rpidamente a la meta. -Quizs tenga que volver a la tienda a buscar el regalo. -No estbamos listos para responder esa pregunta The quotient of 365.085 and 79.8 QUICK PLEASE HELPPPPPPPPPPPP The second reaction in the formation of sulfuric acid occurs slowly.2 upper S upper O subscript 2 (g) plus upper O subscript 2 (g) right arrow 2 upper S upper O subscript 3 (g).NO2 is added to the reaction to speed it up. In which form would this substance be a homogeneous catalyst for this reaction?NO2(g)NO2(l)NO2(s)NO2(aq) Debbie did a survey of how many states the members of her class had visited. The results were: 10, 15, 23, 2, 21, 31, 14, 10,8.17, 11, 19.8.42.15. 22. 6, 34, 19.3, 24,What is the five-number summary for this set of data? Sarah makes 5 ribbons the first day. On the second day she doubles the number ofribbons made in the first day. On the third day she doubles the number what she madeon the second day. How many ribbons has she made on the third day?