Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant 4. Using the identity:

cos(A-B)=cosACosB+sinAsinB


find cos(A-B)

Let Sin A = 1/3 Where A Terminates In Quadrant 1, And Let Cos B = 2/3, Where B Terminates In Quadrant

Answers

Answer 1

Using trigonometric identity, cos(A-B) is:

[tex]cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}[/tex]

How to find cos(A-B) using the trigonometric identity?

Trigonometry deals with the relationship between the ratios of the sides of a right-angled triangle with its angles.

If sin A = 1/3 and A terminates in Quadrant 1. All trigonometric functions in Quadrant 1  are positive

sin A = 1/3 (sine = opposite/hypotenuse)

adjacent = √(3² - 1²)

               = √8 units

cosine = adjacent/hypotenuse. Thus,

[tex]cos A = \frac{\sqrt{8} }{3}[/tex]

If cos B = 2/3 and B terminates in Quadrant 4.

opposite = √(3² - 2²)

                = √5

In  Quadrant 4, sine is negative. Thus:

[tex]sin B = \frac{\sqrt{5} }{3}[/tex]

We have:

cos(A-B) = cosA CosB + sinA sinB

[tex]cos (A-B) = \frac{\sqrt{8} }{3} * \frac{2}{3} + \left \frac{1}{3} * \frac{\sqrt{5} }{3}[/tex]

[tex]cos (A-B) = \frac{2\sqrt{8} }{9} + \left\frac{\sqrt{5} }{9}[/tex]

[tex]cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}[/tex]

Learn more about Trigonometry on:

brainly.com/question/11967894

#SPJ1


Related Questions

Select the option for "?" that continues the pattern in each question.


7, 11, 2, 18, -7, ?


99


0 25


-35


-43


29

Answers

The missing number in the sequence is 29.

To identify the pattern and determine the missing number, let's analyze the given sequence: 7, 11, 2, 18, -7, ?

Looking at the sequence, it appears that there is no consistent arithmetic or geometric progression. However, we can observe an alternating pattern:

7 + 4 = 11

11 - 9 = 2

2 + 16 = 18

18 - 25 = -7

Following this pattern, we can continue:

-7 + 36 = 29

Among the given options, the correct answer is option E: 29, as it fits the established pattern.

for more such questions on sequence

https://brainly.com/question/30394385

#SPJ8

Leroy draws a rectangel that has a length of 11. 9 centimeters and width of 7. 6 centimeters how much longer the length

Answers

Leroy's rectangle has a length of 11.9 centimeters and a width of 7.6 centimeters.

The length is 4.3 centimeters longer than the width.

To find out how much longer the length is compared to the width, we need to calculate the difference between the length and the width. In other words, we need to subtract the width from the length of the rectangle.

Length of the rectangle: 11.9 centimeters

Width of the rectangle: 7.6 centimeters

To find the difference, we can use the following mathematical expression:

Length - Width = Difference

Substituting the values we have:

11.9 cm - 7.6 cm = Difference

To calculate this, we subtract the width from the length:

11.9 cm - 7.6 cm = 4.3 cm

Therefore, the difference between the length and the width of the rectangle is 4.3 centimeters. This means that the length is 4.3 centimeters longer than the width.

To know more about rectangle here

https://brainly.com/question/8663941

#SPJ4

There are currently 4 people signed up to play on a baseball team. The team must have at least 9 players. Which of the following graphs includes the possible values for the number of people who still need to sign up for the team? a Number line with closed circle on 5 and shading to the left b Number line with closed circle on 5 and shading to the right. c Number line with open circle on 5 and shading to the left. d Number line with open circle on 5 and shading to the right.

Answers

Number line with an open circle on 5 and shading to the left.

We have,

We have a baseball team that currently has 4 players and needs at least 9 players.

We want to determine the possible values for the number of additional players needed.

To represent this on a number line, we choose a specific point to start from, which in this case is 5

(since 5 additional players are needed to reach the minimum requirement).

And,

An open circle is used when a value is not included, while a closed circle is used when a value is included.

Now,

The team currently has 4 players, and it needs to have at least 9 players. This means that there need to be at least 5 additional players to meet the minimum requirement.

To represent this on a number line, we can place an open circle on 5 to indicate that it is not included as a possible value.

The shading should be to the right of 5, indicating all values greater than 5.

Therefore,

Number line with an open circle on 5 and shading to the left.

Learn more about number line here:

https://brainly.com/question/13425491

#SPJ1

Convert (xy)^9 = 7| to an equation in polar coordinates =r^18 |

Answers

To convert (xy)^9 = 7 to an equation in polar coordinates, we first need to substitute x = r cos θ and y = r sin θ. So, we get (r cos θ × r sin θ)^9 = 7. Simplifying this expression, we get r^18 (sin θ cos θ)^9 = 7. Now, using the double angle formula for sine, sin 2θ = 2 sin θ cos θ, we get (r^18 sin^9 θ cos^9 θ) (sin 2θ/2)^9 = 7. Finally, substituting sin 2θ/2 = √((1-cos θ)/2), we get the equation in polar coordinates r^18 = (7/sin^9 θ cos^9 θ) √((1-cos θ)/2)^9.

To convert an equation from rectangular coordinates to polar coordinates, we need to substitute x = r cos θ and y = r sin θ. Using this substitution, we can convert the equation into an expression in terms of r and θ. In this case, we are given (xy)^9 = 7, which becomes (r cos θ × r sin θ)^9 = 7 after substitution. Simplifying this expression, we get r^18 (sin θ cos θ)^9 = 7.

Next, we use the double angle formula for sine to simplify the expression. The double angle formula for sine is sin 2θ = 2 sin θ cos θ. Using this formula, we can write sin θ cos θ as sin 2θ/2, which simplifies the expression further.

Finally, we substitute sin 2θ/2 = √((1-cos θ)/2) to get the equation in polar coordinates.

To convert an equation from rectangular coordinates to polar coordinates, we need to substitute x = r cos θ and y = r sin θ. After substitution, we simplify the expression using trigonometric identities. In this case, we used the double angle formula for sine to simplify the expression (r cos θ × r sin θ)^9 = 7. We ended up with the equation in polar coordinates r^18 = (7/sin^9 θ cos^9 θ) √((1-cos θ)/2)^9, which can be used to graph the equation in polar coordinates.

To know more about polar coordinates visit:

https://brainly.com/question/31422978

#SPJ11

PLS HELP ASAP I WILL GIVE 50 POINTS AND BRAINIEST IM DESPERATE !!!!
A regular pentagon and a regular hexagon are both inscribed in the circle below, Which shape has a bigger area? explain your reasoning.

Answers

The shape that has a bigger area is the regular hexagon.

Which shape has a bigger area?

The shape that has a bigger area is the regular hexagon. A hexagon is a polygon with six sides while a pentagon is a polygon with five sides. The area of a polygon measures the surface of the shape.

The polygon with six sides has a greater surface so it is expected that its area will be bigger than that of the pentagon with fewer sides.

Learn more about regular pentagons here:

https://brainly.com/question/858867

#SPJ1

what is this question?!?!? I need help!!!!!!!!!


Find 1 4/9 (−2 4/7) . Write your answer as a mixed number in simplest form.

Answers

Answer: -3 5/7

Step-by-step explanation: Alrighty!! First thing we need to do is convert all mixed numbers to fractions.

1 4/9 becomes 13/9

-2 4/7 becomes  -18/7

So our equation looks like this now: [tex]\frac{13}{9} * -\frac{18}{7}[/tex]

Multiply the numerators together, and the denominator together!! We get

[tex]-\frac{234}{63}[/tex]

We notice that both the numerator and the denominator are divisible by 9. So now we simplify.

[tex]-\frac{26}{7}[/tex]

Make into a mixed number:

[tex]-3\frac{5}{7}[/tex]

given that csc(θ)=10√3 and θ is in quadrant i, what is tan(θ)?

Answers

tan(θ) = √2697/899.

We know that csc(θ) = 1/sin(θ), so we can find sin(θ) by taking the reciprocal of csc(θ):

sin(θ) = 1/csc(θ) = 1/(10√3) = √3/30

Since θ is in quadrant I, both sin(θ) and cos(θ) are positive. We can use the Pythagorean identity to find cos(θ):

cos^2(θ) = 1 - sin^2(θ) = 1 - 3/900 = 899/900

cos(θ) = √(899/900)

Now we can find tan(θ) as:

tan(θ) = sin(θ)/cos(θ) = (√3/30)/(√(899/900)) = (√3/30)*(√900/√899) = √3/√899

We can rationalize the denominator by multiplying the numerator and denominator by √899:

tan(θ) = (√3/√899)*(√899/√899) = √2697/899

Therefore, tan(θ) = √2697/899.

Learn more about tan here:

https://brainly.com/question/30594361

#SPJ11

T/F cast iron exhibits a yield plateau similar to mild steel when tested under tension.

Answers

False. Cast iron typically does not exhibit a yield plateau like mild steel when tested under tension.

Cast iron is more brittle and less ductile than mild steel, and its stress-strain curve has a sharp peak followed by a rapid drop in stress at failure.

To know more about Cast iron refer here:

https://brainly.com/question/29763119

#SPJ11

find a power series representation for the function. f(x) = x3 (x − 6)2

Answers

The power series representation for the function f(x) = x^3(x - 6)^2 is as follows: f(x) = x^5 - 12x^4 + 36x^3 - 216x^2 + 216x.

To obtain the power series representation, we expand the function using the binomial theorem and collect like terms.

First, we expand (x - 6)^2 using the binomial theorem: (x - 6)^2 = x^2 - 12x + 36.

Next, we multiply the result by x^3 to get the power series representation of the function: f(x) = x^3(x - 6)^2 = x^5 - 12x^4 + 36x^3.

We can further simplify the expression by expanding x^5 = x^3 * x^2 and collecting like terms: f(x) = x^5 - 12x^4 + 36x^3 - 216x^2 + 216x.

This power series representation expresses the function f(x) as an infinite sum of terms involving powers of x, starting from the fifth power. Each term represents a coefficient multiplied by x raised to a certain power.

It's important to note that the power series representation is valid within a certain interval of convergence, which depends on the properties of the function and its derivatives.

Learn more about power series here:

https://brainly.com/question/29896893

#SPJ11

A(n) __________ should be used when you are communicating unexpected negative news, when you anticipate that you audience will be resistant to your message, or when you need to provide an explanation before your main point makes sense.

Answers

A buffer should be used when you are communicating unexpected negative news, when you anticipate that your audience will be resistant to your message, or when you need to provide an explanation before your main point makes sense.

Understanding Buffer

A buffer is a communication technique used to soften the impact of negative or difficult information and make it more manageable for the recipient. It involves introducing the main message gradually by providing context, background information, or explanations that help the audience understand and accept the message more easily. By using a buffer, you can reduce resistance, prepare the audience for the upcoming information, and increase the likelihood that your message will be received more positively.

Learn more about buffer here:

https://brainly.com/question/16993951

#SPJ4

the titration curve for a spectrometric titration: a (analyte) b (titrant) = c d both a (100 ml of 0.001 m) and b (0.001 m) display a similar color at 520 nm (EA =100, EB, = 200 M-1 cm-1, b = 1.0 cm) and both C and D are colorless. Measure the absorbance at 520 nm at different %T. Sketch the titration curve and label 0%T, 50%T, 100%T, and 200%T. At end point, you have:- a) Volume of B added is 50 mL, and the absorbance measured is 0.24 b) Volume of B added is 100 mL, and the absorbance measured is 0.4 4 c) Volume of B added is 100 mL, and the absorbance measured is 04 d) Volume of B added is 100 mL, and the absorbance measured is 0.24 ? ? ? Į 소

Answers

The titration curve for a spectrometric titration of A(analyte) by adding B (titrant), the volume of B at end point is 100 ml and absobance at this point is equals to zero. So, option(c) is right one.

We have a spectrometric titration with A (analyte) B (titrant) = C + D ( products)

where A (100 ml of 0.001 m) and B (0.001 m) display a similar color at 520 nm both C and D are colorless.

In the spectrophotometric titration of the colored substrat and colored titrant to produce colorless products, the absorbance is maximum intially because both the analyte and the titrant are colored. The absorbance of the solution decreases with the addition if the titrant due to the formation of the colorless products. The abosrbance becomes zero at the end point where the reaction undergoes completion and all substrate is converted into products. Then, the absorbance of the solution again increases due to the addition of the colored titrant solution. The titration curve is present in attached figure. At end point volume of B can be determined by following equation, [tex]M_A V_A = M_B V_B [/tex]

where M --> represents molarity

V --> volume

here [tex] M_A =0.001 M , M_B = 0.001 M[/tex] and [tex]V_A = 100 ml [/tex].

So, [tex]0.001 (100) = (0.001 ) V_B[/tex]

=> [tex]V_B = 100 ml[/tex]

As the products C and D are colourless, so at that point absorbance is equals to the zero. Hence, Volume 100 ml, of B is added and absorbance is zero.

For more information about volume, visit:

https://brainly.com/question/4936894

#SPJ4

The mean age of bus drivers in Chicago is greater than 51.2 years. If a hypothesis test is performed, how should you interpret a decision that fails to reject the null hypothesis?
A) There is not sufficient evidence to reject the claim μ > 51.2.
B) There is sufficient evidence to support the claim μ > 51.2.
C) There is sufficient evidence to reject the claim μ > 51.2.
D) There is not sufficient evidence to support the claim μ > 51.2.

Answers

Therefore, the correct interpretation of a decision that fails to reject the null hypothesis is option A) "There is not sufficient evidence to reject the claim μ ≤ 51.2."

What does the hypothesis mean?

This means that the null hypothesis cannot be rejected at the chosen level of significance (e.g. α = 0.05), and that the data do not provide enough evidence to support the claim that the mean age of bus drivers in Chicago is greater than 51.2 years.

It does not mean that there is sufficient evidence to support the null hypothesis, as this is not something that can be proven conclusively through hypothesis testing.

Read more on Hypothesis here:https://brainly.com/question/606806

#SPJ1

y'' 4y' 4y = 25cos(t) 25sin(t); initial values y(0) = 1, y’(0) =1. plot y vs t and y’ vs t on the same plot.

Answers

The solution to the differential equation y'' + 4y' + 4y = 25cos(t) + 25sin(t), with initial values y(0) = 1 and y'(0) = 1, is [tex]y(t) = e^(^-^2^t^) * (1 + 2t) + 25/10 * sin(t) + 15/10 * cos(t).[/tex]

How we get the solution of differential equation?

To solve the given second-order linear homogeneous differential equation, we first find the complementary solution by solving the characteristic equation. The characteristic equation for the given differential equation is r² + 4r + 4 = 0. Solving this equation gives us a repeated root of -2.

The complementary solution is then obtained as [tex]y_c(t) = (c1 + c2t) * e^(^-^2^t^)[/tex], where c1 and c2 are arbitrary constants.

To find a particular solution, we assume a solution of the form y_p(t) = A * sin(t) + B * cos(t), where A and B are constants to be determined. We substitute this assumed solution into the differential equation and solve for A and B.

By substituting the given initial conditions y(0) = 1 and y'(0) = 1 into the general solution, we can solve for the arbitrary constants c1 and c2. This yields c1 = 1 and c2 = 1.

Finally, the complete solution is obtained by adding the complementary and particular solutions, resulting in[tex]y(t) = y_c(t) + y_p(t) = (1 + t) * e^(-2t) + 25/10 * sin(t) + 15/10 * cos(t).[/tex]

This solution satisfies the given differential equation and the initial conditions.

Learn more about Differential equation

brainly.com/question/31492438

#SPJ11

The graph fix) = (x + 2)²-7 is translated 5 units right, resulting in the graph of g(x). Which equation represents the new function, g(x)?
A:g(x)= (x+7)^2-7
B:g(x) = (x-3)^2-7
C:g(x) = (x-2)^2-12
D:g(x) = (x+2)^2-2​

Answers

Answer:

Step-by-step explanation:

D

Answer:

D. g(x) = (x+2)² - 2

Step-by-step explanation:

f(x) = (x + 2)² - 7

translated 5 units right (positive) → f(x) + 5

= (x + 2)² - 7 + 5

= (x + 2)² - 2

Subject : Mathematics

Level : JHS

Chapter : Transformation (Function)

sketch the curve with the given vector equation. indicate with an arrow the direction in which t increases. r(t) = t, 6 − t, 2t

Answers

To sketch the curve with the given vector equation r(t) = t, 6 − t, 2t and indicate with an arrow the direction in which t increases, we need to find the points on the curve and then connect those points.

1. Let's put t = 0 in the given vector equation r(t) = t, 6 − t, 2t to find the first point on the curve.

r(0) = 0, 6, 0

Thus, the point on the curve is (0,6,0).

2. Let's select some values of t and put them in the given vector equation to find some additional points on the curve.

When t = 1,r(1) = 1, 5, 2

When t = 2,

r(2) = 2, 4, 4

When t = 3,

r(3) = 3, 3, 6

When t = 4,

r(4) = 4, 2, 8

When t = 5,

r(5) = 5, 1, 10

When t = 6,

r(6) = 6, 0, 12

Thus, we have found some points on the curve, which are (0,6,0), (1,5,2), (2,4,4), (3,3,6), (4,2,8), (5,1,10), and (6,0,12).

3. Now, we can connect these points to sketch the curve.

4. Finally, we indicate with an arrow the direction in which t increases.

We can see that as t increases, the curve moves in the direction of the arrow, which is along the positive x-axis. Thus, we can conclude that the direction in which t increases is along the positive x-axis.

Answer:

Therefore, the curve and the direction in which t increases are shown below in the image.

Learn more about vector equations:

https://brainly.com/question/8873015

#SPJ11

An experiment consists of 8 independent
trials where the probability of success on
each trial is 3/8. Find the probability of
obtaining the following. Round answers to
the nearest ten-thousandth.
What is the answer for Exactly 5 successes?
a. 0.0304
b. 0.1014
c. 0.6250
d. 0.3819
e. 0.0472
At least 7 successes?
a. 0.0056
b. 0.1313
c. 0.8650
d. 0.2614
e. 0.0311
At most 1 success?
a. 0.8650
b. 0.9944
c. 0.0506
d. 0.7480
e. 0.1350

Answers

The answer for Exactly 5 successes of at most 1 success is 0.8650

We can use the binomial distribution to solve these problems. For a binomial distribution with n trials and probability of success p, the probability of getting exactly k successes is:

P(k) = (n choose k) * [tex]p^k[/tex]* (1-p)(n-k)

where (n choose k) = n! / (k!(n-k)!) is the binomial coefficient.

For the given experiment with n=8 and p=3/8:

a. To find the probability of exactly 5 successes:

P(5) = (8 choose 5) * (3/8)[tex].^5[/tex] * (5/8)[tex].^3[/tex]

= 0.1014 (rounded to four decimal places)

b. To find the probability of at least 7 successes:

P(at least 7) = P(7) + P(8)

= (8 choose 7) * (3/8)[tex].^7[/tex] * (5/8)[tex].^1[/tex] + (8 choose 8) * (3/8)[tex].^8[/tex] * (5/8)[tex].^0[/tex]

= 0.0056 + 0.0000

= 0.0056

c. To find the probability of at most 1 success:

P(at most 1) = P(0) + P(1)

= (8 choose 0) * (3/8)[tex].^0[/tex] * (5/8)[tex].^8[/tex] + (8 choose 1) * (3/8)[tex].^1[/tex] * (5/8)[tex].^7[/tex]

= 0.8650

Therefore, the answers are:

a. 0.1014

b. 0.0056

c. 0.8650

For similar question on successes:

https://brainly.com/question/13015656

#SPJ11

To solve this problem, we will use the binomial probability formula: P(x) = (n choose x) * p^x * (1-p)^(n-x). The answer is e) 0.1350.

where n is the number of trials, x is the number of successes we want to find the probability of, p is the probability of success on each trial, and (n choose x) is the binomial coefficient, which represents the number of ways we can choose x successes out of n trials.

a. To find the probability of exactly 5 successes, we have:

P(5) = (8 choose 5) * (3/8)^5 * (5/8)^3
P(5) = 56 * 0.0105 * 0.2373
P(5) = 0.0304

Therefore, the answer is a) 0.0304.

b. To find the probability of at least 7 successes, we can use the complement rule: P(at least 7) = 1 - P(6 or fewer).

P(6 or fewer) = P(0) + P(1) + P(2) + P(3) + P(4) + P(5) + P(6)
P(6 or fewer) = (8 choose 0) * (3/8)^0 * (5/8)^8 + (8 choose 1) * (3/8)^1 * (5/8)^7 + ... + (8 choose 6) * (3/8)^6 * (5/8)^2
P(6 or fewer) = 0.9897

Therefore, P(at least 7) = 1 - 0.9897 = 0.0103

Therefore, the answer is e) 0.0311.

c. To find the probability of at most 1 success, we can add up the probabilities of getting 0 successes and 1 success:

P(0 or 1) = P(0) + P(1)
P(0 or 1) = (8 choose 0) * (3/8)^0 * (5/8)^8 + (8 choose 1) * (3/8)^1 * (5/8)^7
P(0 or 1) = 0.0506 + 0.0844
P(0 or 1) = 0.1350

Therefore, the answer is e) 0.1350.


In an experiment with 8 independent trials and a probability of success of 3/8 on each trial, the probability of obtaining exactly 5 successes is approximately 0.1014 (option b). The probability of obtaining at least 7 successes is approximately 0.0056 (option a), and the probability of obtaining at most 1 success is approximately 0.1350 (option e).

Learn more about binomial at: brainly.com/question/13870395

#SPJ11

Determine the zero-state response, Yzs(s) and yzs(t), for each of the LTIC systems described by the transfer functions below. NOTE: some of the inverse Laplace transforms from problem 1 might be useful. (a) Î11(s) = 1, with input Êi(s) = 45+2 (b) Ĥ2(s) = 45+1 with input £2(s) (C) W3(s) = news with input £3(s) = 542. (d) À4(8) with input Ê4(s) = 1 s+3. s+3 2e-4 4s = s+3 = 4s+1 s+3.

Answers

In a linear time-invariant system, the zero-state response (ZSR) is the output of the system when the input is zero, assuming all initial conditions (such as initial voltage or current) are also zero.

(a) For H1(s) = 1, the zero-state response Yzs(s) is simply the product of the transfer function H1(s) and the input Ei(s):

Yzs(s) = H1(s) * Ei(s) = (45+2)

To find the time-domain zero-state response yzs(t), we need to take the inverse Laplace transform of Yzs(s):

yzs(t) = L^-1{Yzs(s)} = L^-1{(45+2)} = 45δ(t) + 2δ(t)

where δ(t) is the Dirac delta function.

(b) For H2(s) = 45+1, the zero-state response Yzs(s) is again the product of the transfer function H2(s) and the input E2(s):

Yzs(s) = H2(s) * E2(s) = (45+1)E2(s)

To find the time-domain zero-state response yzs(t), we need to take the inverse Laplace transform of Yzs(s):

yzs(t) = L^-1{Yzs(s)} = L^-1{(45+1)E2(s)} = (45+1)e^(t/2)u(t)

where u(t) is the unit step function.

(c) For H3(s) = ns, the zero-state response Yzs(s) is given by:

Yzs(s) = H3(s) * E3(s) = ns * 542

To find the time-domain zero-state response yzs(t), we need to take the inverse Laplace transform of Yzs(s):

yzs(t) = L^-1{Yzs(s)} = L^-1{ns * 542} = 542L^-1{ns}

Using the inverse Laplace transform from problem 1, we have:

yzs(t) = 542 δ'(t) = -542 δ(t)

where δ'(t) is the derivative of the Dirac delta function.

(d) For H4(s) = 2e^(-4s) / (s+3)(4s+1), the zero-state response Yzs(s) is given by:

Yzs(s) = H4(s) * E4(s) = (2e^(-4s) / (s+3)(4s+1)) * (1/(s+3))

Simplifying the expression, we have:

Yzs(s) = (2e^(-4s) / (4s+1))

To find the time-domain zero-state response yzs(t), we need to take the inverse Laplace transform of Yzs(s):

yzs(t) = L^-1{Yzs(s)} = L^-1{(2e^(-4s) / (4s+1))}

Using partial fraction decomposition and the inverse Laplace transform from problem 1, we have:

yzs(t) = L^-1{(2e^(-4s) / (4s+1))} = 0.5e^(-t/4) - 0.5e^(-3t)

Therefore, the zero-state response for each of the four LTIC systems is:

(a) Yzs(s) = (45+2), yzs(t) = 45δ(t) + 2δ(t)

(b) Yzs(s) = (45+1)E2(s), yzs(t) = (45+1)e^(t/2)u(t)

(c) Yzs(s) = ns * 542, yzs(t) = -542 δ(t)

(d) Yzs(s) = (2e^(-4s) /

To learn more about derivative visit:

brainly.com/question/30365299

#SPJ11

find the distance from the point q=(5,−4,−3) to the plane −5x−3y−z=5 .

Answers

The distance between the point q=(5,-4,-3) and the plane −5x−3y−z=5 is 5/√35 units.

To find the distance between a point and a plane, we need to use the formula:

distance =[tex]|ax + by + cz + d| / √(a^2 + b^2 + c^2)[/tex]

where a, b, and c are the coefficients of the variables x, y, and z in the equation of the plane, and d is the constant term.

So, for the given plane −5x−3y−z=5, we have a=-5, b=-3, c=-1, and d=5.

To find the distance from the point q=(5,-4,-3) to this plane, we need to substitute these values into the formula above:

distance =[tex]|(-5)(5) + (-3)(-4) + (-1)(-3) + 5| / √((-5)^2 + (-3)^2 + (-1)^2)[/tex]

distance = |(-25) + 12 + 3 + 5| / √35

distance = 5/√35

Therefore, the distance between the point [tex]q=(5,-4,-3)[/tex] and the plane −5x−3y−z=5 is 5/√35 units.

Learn more about coefficient here:

https://brainly.com/question/13431100

#SPJ11

use lagrange multipliers to find the shortest distance from the point (7, 0, −8) to the plane x y z = 1.

Answers

To use Lagrange multipliers to find the shortest distance from the point (7, 0, −8) to the plane x y z = 1, we need to set up the following optimization problem:

Minimize the distance function D(x, y, z) = √((x-7)^2 + y^2 + (z+8)^2) subject to the constraint f(x, y, z) = x y z - 1 = 0.

Using Lagrange multipliers, we set up the following system of equations:

∇D(x, y, z) = λ∇f(x, y, z)
f(x, y, z) = 0

Taking the partial derivatives, we have:

∇D(x, y, z) = (x-7, y, z+8)
∇f(x, y, z) = (y z, x z, x y)

Setting these equal to each other and solving for x, y, z, and λ, we get:

x-7 = λ y z
y = λ x z
z+8 = λ x y
x y z = 1

Multiplying the first three equations together and using the fourth equation, we get:

(x-7)yz = λxzy = (z+8)xy
(x-7)yz = (z+8)xy
xz - 7z = yz + 8xy
xz - yz = 8xy + 7z
z(x-y) = 8xy + 7z
z = (8xy)/(y-x)

Substituting this into the equation x y z = 1, we get:

x y (8xy)/(y-x) = 1
8x^2 y - xy^2 = x^2 y - xy^2
7x^2 y = 0
x = 0 or y = 0

If x = 0, then we have yz = 1, and substituting into the equation z = (8xy)/(y-x), we get z = -8, which is not on the plane x y z = 1.

If y = 0, then we have xz = 1, and substituting into the equation z = (8xy)/(y-x), we get z = -1/8.

Therefore, the point on the plane x y z = 1 closest to the point (7, 0, −8) is (0, 0, -1/8), and the shortest distance is:

D(0, 0, -1/8) = √((0-7)^2 + 0^2 + (-1/8+8)^2) = √(49 + 63/64) ≈ 7.98.

Learn more about  Lagrange multipliers here:

https://brainly.com/question/31827103

#SPJ11

If the perimeter of a rectangular region is 50 units, and the length of one side is 7 units, what is the area of the rectangular region? *

Answers

The area of the rectangular region is 126 square units, with length and width of 7units and 18units respectively.

How to Find the Area of Rectangular Region

Let's denote the length of the rectangular region as L and the width as W.

Given:

Perimeter (P) = 2L + 2W = 50 units

Length of one side (L) = 7 units

Substituting the values into the perimeter equation:

2L + 2W = 50

2(7) + 2W = 50

14 + 2W = 50

2W = 50 - 14

2W = 36

W = 36 / 2

W = 18

Using the given Perimeter, the width of the rectangular region is 18 units.

To calculate the area, we use the formula:

Area = Length × Width

Area = 7 × 18 = 126 square units.

Thus, the area of the rectangular region is 126 square units.

Learn more about rectangular region here:

https://brainly.com/question/29699804

#SPJ4

Assume there are 12 homes in the Quail Creek area and 7 of them have a security system. Three homes are selected at random: a. What is the probability all three of the selected homes have a security system? (Round your answer to 4 decimal places.) Probability b. What is the probability none of the three selected homes has a security system? (Round your answer to 4 decimal places.) Probability c. What is the probability at least one of the selected homes has a security system? (Round your answer to 4 decimal places.) Probability

Answers

We are given that there are 12 homes in the Quail Creek area and 7 of them have a security system. We need to calculate the probability of different scenarios when three homes are selected at random.

a. Probability that all three selected homes have a security system:

We can use the formula for the probability of independent events, which is the product of the probabilities of each event. Since we are selecting three homes at random, the probability of selecting a home with a security system is 7/12. Therefore, the probability that all three homes have a security system is (7/12) * (7/12) * (7/12) = 0.2275 (rounded to 4 decimal places).

b. Probability that none of the three selected homes have a security system:

Again, we can use the formula for the probability of independent events. The probability of selecting a home without a security system is 5/12. Therefore, the probability that none of the three homes have a security system is (5/12) * (5/12) * (5/12) = 0.0772 (rounded to 4 decimal places).

c. Probability that at least one of the selected homes has a security system:

To calculate this probability, we can use the complement rule, which states that the probability of an event happening is equal to 1 minus the probability of the event not happening. So, the probability that at least one of the selected homes has a security system is 1 - the probability that none of the selected homes have a security system. We already calculated the probability of none of the homes having a security system as 0.0772. Therefore, the probability that at least one of the selected homes has a security system is 1 - 0.0772 = 0.9228 (rounded to 4 decimal places).

Learn more about independent event here:

https://brainly.com/question/30905572

#SPJ11

Penelope has $131 in her bank account and deposits $51 per month into her account. Henry has $41 and deposits $56 per month into his account.


Enter the number of months it will take for both Penelope and Henry to have the same amount of money in their accounts

Answers

It will take 18 months for both Penelope and Henry to have the same amount of money in their accounts.

Penelope has $131 in her bank account and deposits $51 per month into her account. Henry has $41 and deposits $56 per month into his account. Let us assume that after t months, they both will have the same amount of money in their accounts.

Let's suppose x is the amount of money that they both will have in their accounts after t months. Using the given information, we can write the following two equations:

For Penelope:$131 + 51t = x-----(1)

For Henry:$41 + 56t = x------(2)

By equating equation (1) and (2), we get:$131 + 51t = $41 + 56t => 5t = 90=> t = 18

It will take 18 months for both Penelope and Henry to have the same amount of money in their accounts.

The explanation of the solution to the given problem has been given above.

Know more about deposits here,

https://brainly.com/question/30186258

#SPJ11

Find the cube root of .
0.008/0.125

Answers

Answer:

Step-by-step explanation:

[tex]\sqrt[3]{\frac{0.008}{0.125} }\\ =\sqrt[3]{\frac{8}{125} }\\ = \frac{2}{5}[/tex]

a) Find the coordinates of the point where y - 4x = 1 crosses the y-axis. b) The diagram shows the graph of y = 2x + c, where c is a constant. Find the value of k. Optional working -3 X (k, 10) X k Ansv +​

Answers

Answer:

a) (0,1)

[tex]\sf b) k = \dfrac{13}{2}[/tex]

Step-by-step explanation:

a) The x co-ordinate where the line (y -4x = 1) crosses the y-axis is zero.

       y - 4*0 = 1

             y = 1

co-ordinates (0,1)

~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~

b) y = 2x + c

Compare with y = mx + c.

⇒ m = 2

Two points from the graph: (k , 10) & (0,-3)

Substitute the value of m and the two points in the below formulae and find the value of k.

        [tex]\sf slope =\dfrac{y_2 -y_1}{x_2-x_1}[/tex]

       [tex]\dfrac{-3-10}{0-k}=2\\\\\dfrac{-13}{-k}=2\\\\\\\dfrac{13}{k}=2\\\\\\Cross \ multiply,\\\\[/tex]

              13 = 2k

              [tex]\sf\boxed{ \bf k =\dfrac{13}{2}}\\\\[/tex]

Find all solutions of the equation in the interval [0, 2r) 2cos 3x cosx + 2 sin 3x sinx =V3 Write your answer in radians in terms of T. If there is more than one solution, separate them with commas.

Answers

The solutions of the equation in the interval [0, 2π) are x = π/6 and x = 11π/6.

What are the values of x that satisfy the equation 2cos 3x cosx + 2 sin 3x sinx = √3 in the interval [0, 2π)?

The equation 2cos 3x cosx + 2 sin 3x sinx = √3 can be rewritten using trigonometric identities as cos(3x - x) = √3/2. Simplifying further, we have cos(2x) = √3/2.

In the interval [0, 2π), the solutions for cos(2x) = √3/2 occur when 2x is equal to π/6 and 11π/6. Dividing both sides by 2 gives x = π/12 and x = 11π/12.

However, we need to find solutions in the interval [0, 2r). Since r represents a number, we cannot provide a specific value for it without further information. Therefore, we express the solutions in terms of T, where T represents a positive number. The solutions in the interval [0, 2r) are x = Tπ/6 and x = (6T - 1)π/6, where T is a positive integer.

Learn more about Equation

brainly.com/question/13763238

#SPJ11

write the algebraic equation that matches the graph y=

Answers

The absolute value function for each graph is given as follows:

c) y = -|x| + 3.

e) y = |x + 15|.

How to define the absolute value function?

An absolute value function of vertex (h,k) is defined as follows:

y = a|x - h| + k.

The leading coefficient for the function is given as follows:

a = 1.

For item c, the vertex has the coordinates at (0,3), and the function is reflected over the x-axis, hence it is defined as follows:

y = -|x| + 3.

For item e, the vertex has the coordinates at (15,0), hence the equation is given as follows:

y = |x + 15|.

More can be learned about absolute value functions at brainly.com/question/3381225

#SPJ1

1/2y=5 1/2 help!!!! i don't get it i have to factor it

Answers

Answer:

Step-by-step explanation:

11

How can performing discrete trials be demonstrated on the initial competency assessment?

Answers

Performing discrete trials is a teaching technique used in behavior analysis to teach new skills or behaviors.

It involves breaking down a complex task or behavior into smaller, more manageable steps and teaching each step through repeated trials. Each trial consists of a discriminative stimulus, a response by the learner, and a consequence (either positive reinforcement or correction) based on the accuracy of the response.

To demonstrate performing discrete trials on an initial competency assessment, the assessor would typically design a task or behavior to be learned and break it down into smaller steps. They would then present the first discriminative stimulus and prompt the learner to respond. Based on the accuracy of the response, the assessor would provide either positive reinforcement or correction.

The assessor would then repeat the process with the next discriminative stimulus and continue until all steps of the task or behavior have been completed. The number of trials required for the learner to achieve competency would depend on the complexity of the task or behavior and the learner's individual learning pace.

By demonstrating performing discrete trials on an initial competency assessment, the assessor can assess the learner's ability to learn new skills or behaviors using this technique and determine if additional training or support is needed. It also provides a standardized and objective way to measure learning outcomes and track progress over time.

To learn more about assessor visit:

brainly.com/question/29286031

#SPJ11

estimate the indicated derivative by any method. (round your answer to three decimal places.) y = 6 − x2; estimate dy dx x = −4

Answers

The estimated derivative of y with respect to x at x = -4 is 8.

To estimate the derivative of y with respect to x at x = -4, we can use the definition of a derivative:

dy/dx = lim(h -> 0) [f(x+h) - f(x)]/h

Plugging in the given function, we get:

dy/dx = lim(h -> 0) [(6 - (x+h)^2) - (6 - x^2)]/h
dy/dx = lim(h -> 0) [(6 - x^2 - 2xh - h^2) - (6 - x^2)]/h
dy/dx = lim(h -> 0) [-2xh - h^2]/h
dy/dx = lim(h -> 0) [-2x - h]

Now we can estimate the derivative at x = -4 by plugging in this value for x:

dy/dx x=-4 = -2(-4) = 8

Therefore, the estimated derivative of y with respect to x at x = -4 is 8.

To know more about derivative visit:

https://brainly.com/question/23819325

#SPJ11

in a correlated t test, if the independent variable has no effect, the sample difference scores are a random sample from a population where the mean difference score (µ d ) equals _________. a. 0 b. 1 c. N d. cannot be determined

Answers

The correct answer is a. 0. the mean difference score (µ d ) equals 0

In a correlated t-test, if the independent variable has no effect, the sample difference scores are expected to be a random sample from a population where the mean difference score (µd) equals 0.

When the independent variable has no effect, it means that there is no systematic difference between the two conditions or time points being compared. In this case, the average difference between the paired observations is expected to be zero, indicating no change or effect. Thus, the mean difference score (µd) is equal to 0.

Therefore, the correct answer is a. 0.

learn more about "Mean":-https://brainly.com/question/1136789

#SPJ11

Other Questions
evaluate the line integral, where c is the given curve. xyeyz dy, c: x = 3t, y = 2t2, z = 3t3, 0 t 1 c it has been argued that the driving force behind every u.s. action in the middle east is based on america getting access to the oil. which of the following action appears to support this action? the way that a limited set of beauty standards has been portrayed in the media has led consumers to multiple choice question. form negative self-evaluations. form positive self-evaluations. admire their self-concept. disown their self-concept. can an object have zero velocity and nonzero acceleration _______ are the sets of rules for what should be included for the needed function and system level.a. Frameworksb. Implementation guidesc. Standardsd. None of the above a yearning for love or recognition that is never fully satisfied is known as You ate a Costco size bag of salty chips called nacho doritos (Yay! I'm not alone!). Which of the following is true? O aldosterone sodium channels on descending loop of Henle Na+ reabsorption O aldosterone sodium channels on collecting duct Na+ reabsorption O aldosterone sodium channels on distal convoluted tubule Na+ reabsorption O aldosterone sodium channels on ascending loop of Henle | Na+ reabsorption Suppose that a simson line goes through the orthocenter of the triangle. show that the pole must be one of the vertices of the triangle. and provide model figure. Show that the symmetric property follows from euclid's common notions 1 and 4.Things which are equal to the same thing are also equal to one another. If equals be added to equals, the wholes are equal. If equals be subtracted from equals, the remainders are equal. Things which coincide with one another are equal to one another. The whole is greater than the part. Find the first five terms of the sequence defined by each of the following recurrence relations and initial conditions (1) an = 6an1, for n 1, a0 = 2 (2) (2) an = 2nan1, for n 1, a0 = 3 (3) (3) an = a^2 n1 , for n 2, a1 = 2 (4) (4) an = an1 + 3an2, for n 3, a0 = 1, a1 = 2 (5) an = nan1 + n 2an2, for n 2, a0 = 1, a1 = 1 (6) an = an1 + an3, for n 3, a0 = 1, a1 = 2, a2 = 0 2. evaluate the line integral over the curve c: x=etcos(t), y=etsin(t), 0t/2 c(x2 y2)ds a file-based representation of the state of a virtual machine at a given point in time is called Consider the function f(x)=x^3+16x^2+60x+40. If there is a remainder of 5 when the function is divided by (xa), what is the value of a? water flows in a 1.5-mm radius circular tube. the flow must stay laminar. create a plot of maximum flowrate versus temperature, from the range of 0-100 degrees c. Recall x B denotes the coordinate vector of x with respect to a basis B for a vector space V. Given two bases B and C for V, P denotes the change of coordinates matrix, which has CAB the property that CER[x]B = [x]c for all x V. It follows that o pe = (2x)? B+C CEB) Also, if we have three bases B, C, and D, then (?) (Pe) = pe Each of the following three sets is a basis for the vector space P3: E = {1, t, , }, B = {1, 1+ 2t, 2-t+3t, 4-t+{}, and C = {1+3t+t?, 2+t, 3t 2 + 4", 3t} . Find and enter the matrices P= Px and Q=LC EB you are given that tan(a)=8/5 and tan(b)=7. find tan(a b). give your answer as a fraction. How many moles of HCl(g) must be added to 1.0 L of 2.0 M NaOH to achieve a pH of 0.00? (Neglect any volume changes.) public networks allow traveling users to obtain a remote network connectionT/F The half-life of Zn-71 is 2.4 minutes. The amount of Zn-71 left from a 100.0-gram sample after 7.2 minutes is 100.0 grams 50.0 grams 12.5 grams 8.5 grams Which function has a greater output value for x = 10? Explain your reasoning.