Answer:
pipe
Explanation:
You receiving
the photo has the question; please help asap ! i’m giving brainliest—i also have more chemistry, honestly i’m about to post a whole bunch of questions
Answer:
The process is to divide the molecules by Avogadro's number (6.02 x 10^23) to get the moles. And since it's specified at STP (standard temperature and pressure) we know that the molar volume would be 22.4L. So we can just multiply the moles by the molar volume in order to get the volume of H2S.
(2.18 x 10^24) / (6.02 x 10^23) = 3.62 moles (rounded)
Now just multiply the moles by the molar volume of STP, 22.4.
3.62 x 22.4 = 81 Liters (rounded) of H2S
Which of the following has mass?
A. Space
B. Light
C. Matter
Ο Ο
D. Force
Answer:
matter should be the answer
Explanation:
Hope this helps!
Answer:
matter because matter makes up everything in the world EVERYTHING like this computer ri am typing on? matter. what ever device you are using to view this? matter. everything is made of matter. matter is starting to sound weird now so I'm gonna stop saying it and this is the end of the answer remember THAT ANSWER IS MATTERR!!!!!
Why is it important to be careful when walking on an icy sidewalk?
Ice moves faster than you do.
There is less friction on an icy surface.
Ice is heavier than you, so it is a greater force.
none of the above
Answer:
The is less friction on an icy surface
Explanation:
This is because when u walk on plain ground there is steady friction on the surface but when u walk on an icy floor these is barely any friction which is why it's hard to walk on.
Answer:
There is less friction on an icy surface.
Hope that helps.
Explanation:
50 points for anyone who answeres properly. How does a structure of a triglyceride differ from the reaction of fructose?
Triglycerides and fructose are both monomers, but they differ in how they bond to other monomers.
Fructose forms large polymers by the process of hydrolysis, while a triglyceride forms monomers by the process of dehydration.
Fructose is a form of carbohydrate, while a triglyceride is a lipid.
A triglyceride is a polymer, while fructose is a monomer.
Answer:
Fatty Acids
A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.
Saturated Fatty Acids
In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.
Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.
Unsaturated Fatty Acids
In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.
Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.
Lipids and Diet
Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.
Fructose is a simple carbohydrate sugar, while triglycerides are the lipids or the fats of the body. Thus, option C is accurate.
What are triglycerides and fructose?Triglycerides are lipids of the body that are formed of fatty acids and glycerols. It makes the body fat of the animals and of the plants. They are stored in cells for future use and provide energy when needed.
Fructose is a monomer that is the simplest carbohydrate sugar and is generally found in sugarcane, honey, watermelon, grapes, apples, etc.
Therefore, option C. fructose is sugar and triglyceride is fat is correct.
Learn more about triglycerides and fats here:
https://brainly.com/question/17576593
#SPJ2
Students in Mr. Garcia's class were having a race! No, not running. Instead they rolled tennis balls down a wooden track. The tennis balls have the same mass and diameter. Using the data table, decide which ball had the MOST kinetic energy.
Answer:
it's entertaining. Energy though is the answer
If 48.3g of iron is completely rusted in oxygen to produce 62.5g of iron (III) oxide, how many grams of oxygen are involved in the reaction?
The amount of oxygen involved in the reaction would be 20.7 g
The equation of rusting of iron is as follows:
[tex]4Fe + 3O_2 ---> 2Fe_2O_3[/tex]
The mole ratio of Fe to O2 is 4:3.
Mole of 48.3 g Fe = mass/molar mass
= 48.3/56
= 0.8625 moles
Equivalent mole of O2 = 0.8625 x 3/4
= 0.6469 moles
Mass of 0.6469 moles O2 = mole x molar mass
= 0.6469 x 32
= 20.7 g
More on stoichiometric calculations can be found here: https://brainly.com/question/8062886?referrer=searchResults
Which of these substances are greenhouse gases? Check all that apply. Oxygen carbon dioxide helium methane nitrous oxide.
The greenhouse gases are carbon dioxide, methane, and nitrous oxide.
The greenhouse effect has been defined as the entrapment of the sun's energy by the gases that result in the earth becoming warmer and a better place to live.
The gases present in the atmosphere that has been able to entrap the heat energy has been termed the greenhouse gases.
The greenhouse gases have been carbon dioxide, methane, and nitrous oxide.
For more information about greenhouse gases, refer to the link:
https://brainly.com/question/11595872
Answer:
carbon dioxide, nitrous oxide, methane
Explanation:
What are some examples of a physical change? (list more than 2 examples)
Answer:
Examples of physical change include changes in the size or shape of matter. Changes of state, for example, from solid to liquid or from liquid to gas, are also physical changes. Some of the processes that cause physical changes include cutting, bending, dissolving, freezing, boiling, and melting.
Explanation:
I hope this helps
Would you expect the shielding effect to be greater in bromine than in chlorine?
A. Yes, because there are more filled orbitals in bromine.
B. Yes, because bromine has a higher atomic number.
C. No, because they are both in the same family.
D. No, because chlorine has a higher electronegativity than bromine.
The shielding effect of bromine is greater than chlorine because there are more filled orbitals than in chlorine.
Shielding EffectThis is the process where by electrons are protected by the pull attraction of the nucleus with the use of electron shells. The shielding effect increases down the group of the periodic table and increases across the period. This is because when you move down the group, there's an increase in the number of shell by 1 and it helps to reduce the effect of nuclear attraction on the electrons. However when you move across the period, there's an increase in the numbers of electron with the same shielding electrons from group 1(a) across the period to group 7(a).
Factor that affect the shielding effect of an electronThe numbers of electrons on the inner shells.Type of orbital which the electron is located.Shielding effect is primarily dependent on the numbers of electrons in the inner shells as well as the type orbitals.
Learn more about shielding effect here;
https://brainly.com/question/14040040
https://brainly.com/question/2984106
State two properties of a base
Answer:
Bases are bitter to taste a bitter taste is characteristic of all bases. Bases may or may not be soluble in water Bases that can dissolve in water are called alkalis.Explanation:
Which statement describes one feature of Rutherford model of the atom
[tex] \huge{ \color{magenta}{ \fcolorbox{magenta}{black}{ \huge{ \color{white}{ \fcolorbox{aqua}{black}{♡Answer♡ }}}}}}[/tex]
The Rutherford model shows that an atom is mostly empty space, with electrons orbiting a fixed, positively charged nucleus in set, predictable paths.
What is meant by collision theory?
Answer:
The collision theory states that a chemical reaction can only occur between particles when they collide (hit each other).
hope it helps~
The work you do on a machine is called the_________________
Answer:
THE WORK YOU DO ON A MACHINE IS CALLED WORK INPUT
Explain the reason that maps must change over time
Explanation:
Because the place on the map can be changed to another shape by natural effects like faulting,folding , volcanism
Answer:
Maps must change over time as the geographical structures change from time o time. The roads and highways also change often due to the development activities .
Like the success of animals, the success of plants is limited based on the resources available to each individual. In the tropical
rainforest, plants are especially limited by the spate they have available to grow and reproduce. Which of these statements
describes a way that limited space will impact
the success of a plant in the rainforest? (SC.7.L.17.3)
A plant without enough space will face increased predation from herbivores
a
O A plant without enough space will not have as many parasites and diseases.
3
A plant without enough space will be more likely to be impacted by air quality
A plant without enough space will not be able to capture enough light to grow.
A plant without enough space to grow may be impacted by inadequate air as well as light for proper growth.
The competition for space in the tropical rainforest has impacts on two processes:
Light for photosynthesisAir for growthLight is very important for photosynthesis and the overall well-being of plants. In a tight space, light and air become limited. This means that plants growing in such a space will not be able to photosynthesize optimally.
Plant roots need air to function properly and when becomes inadequate, the entire plant becomes negatively impacted.
More on competition for space can be found here: https://brainly.com/question/9385889?referrer=searchResults
I know the answer is A/1 but I’m not sure how to explain it, I would like some help on the explanation part
3. The accompanying diagram represents a cell in water. Formulas of molecules that can move freely across the cell membrane are shown. Some molecules are located inside the cell and others are in the water outside the cell.
(Picture) diagram
Based on the distribution of these molecules, what would most likely happen after a period of time?
A. The concentration of O₂ will increase inside the cell.
B. The concentration of CO₂ will remain the same inside the cell.
C. The concentration of O₂ will remain the same outside the cell.
D. The concentration of CO₂ will decrease outside the cell.
Answer:
number one is the correct option
What is the formula of sulfur diphosphide
[tex] \huge \rm \ \blue \:{ \overbrace{ \underbrace{ \tt{ \color{red}{ \: \: \: \: \: \: answer \: \: \: \: \: \: }}}}}[/tex]
[tex] \huge \color{darkblue}P₂S_{5}[/tex]
hope it helpsAnswer:
P2S5
Explanation:
What is Nuclear fusion
Answer:
Nuclear fusion is a reaction in which two or more atomic nuclei are combined to form one or more different atomic nuclei and subatomic particles (neutrons or protons).
what are two possible ways to show the structure of ch4?
Answer: Two possible ways to show the structure of CH4 are its electron dot diagram or structural formula. CH4 or methane's molecular formula is given as CH4. The structural formula is a graphical representation of a chemical compound.
Answer:
using electron dot diagrams or structional formula
what is the formula of trinitrogen tetrabromide
The formula of trinitrogen tetrabromide is N3Br4
How to determine the molecular formulaTrinitrogen features three molecules of nitrogen, N3
Tetrabromide features four molecules of bromide = Br4
Thus, the formula of trinitrogen tetrabromide is N3Br4
Learn more about molecular formula here:
https://brainly.com/question/17405634
#SPJ1
how many moles of copper are there in 6.93 g of copper sample
pls be quick
[tex]\\ \sf\longmapsto No\:of\;moles=\dfrac{Given\:mass}{Molar\:mass}[/tex]
[tex]\\ \sf\longmapsto No\:of\:moles=\dfrac{6.93}{63.5}[/tex]
[tex]\\ \sf\longmapsto No\:of\:moles=0.109\approx 1.11moles[/tex]
5 grams of sodium bicarbonate, a white powdery solid, is placed in an empty red balloon. 100 grams of acetic acid, a clear aqueous solution, is placed in the plastic bottle. The balloon is carefully attached to the bottle so that no air can get in or out and the powder does not fall into the bottle. Once attached, the apparatus is placed on a balance and the contents are mixed. Bubbles form, the balloon inflated, and the white powder is no longer visible. Which of the these statements would match your observations? A) A chemical reaction has occurred and the mass will increase. B) A chemical reaction has occurred and the mass will decrease. C) A physical reaction has occurred and the mass will decrease. D) A chemical reaction has occurred and the mass will remain the same.
Answer: im pretty sure its D
Explanation:
what natural resources are used to make plastic bags
Answer:patrolieum
Explanation:
2. The two naturally occurring isotopes of hydrogen are hydrogen-1 ( 1.00783 amu; 99.9885 percent) and hydrogen-2 (2.01410 amu; 0.0115 percent). What is the average atomic mass of hydrogen?
A. 1.0079 amu
b. 1.0097 amu
c. 1.0309 amu
D. 1.5110 amu
Answer:
1.0079 g/mol
Explanation:
99.989% / 100% = 0.99989 hydrigen-1 , 0.0115% / 100% = 0.000115 hydrogen-2
0.99989 x 1.0078 = 1.0077 , 0.000115 x 2.0141= 0.000232
1.0077 + 0.00023
Answer: 1.0079
Please what the element it is
Answer:
Helium
Explanation:
One electron shell is shown in the model of Helium drawn by Bohr, and it has two electrons inside of it. The atomic number of helium is 2, so the number of protons and electrons that can be used to make its Bohr diagram is the same as its number.
HELP ME PZLMSMS
E
D
D
F
F
Answer:
10.C
11.B
15.A
Explanation:
Why do some atoms form chemical bonds while others do not?
Answer:
Atoms of these elements have full outer electron shells. These atoms are stable and very rarely form bonds with other atoms. If the electronegativity values between two atoms are comparable, they may still form chemical bonds to increase the stability of their valence electron shell
Explanation:
what can cats get from eating mice and moles?
Answer:
its called Toxoplasmosis.
Explanation:
Cats become infected by Toxoplasma gondii by ingesting the cysts of this parasite. Most often, this occurs when cats eat mice or rats infected with the parasite. However, they can also ingest it during grooming after coming in contact with infected soil or feces.
hope it helped ;)
What is the mass number (A) of an atom that has an atomic number (Z=26) with 29 neutrons and 26 electrons?
Atom information–
Atomic number (Z) = 26Protons (p⁺) = 26Neutrons (n⁰) = 29Electrons (e⁻) = 26The atomic number (Z) of an atom is the number of protons (p⁺) it hasThe mass number (A) of an atom is characterized by the sum of the amount of protons (p⁺) with its neutrons (n⁰)Substituting values –
[tex]\qquad[/tex] [tex]\twoheadrightarrow\bf A=p^{+}+n^{0}[/tex]
[tex]\qquad[/tex] [tex]\twoheadrightarrow\bf A=26+29[/tex]
[tex]\qquad[/tex] [tex]\twoheadrightarrow\bf A=55[/tex]
____________________________________________
What do you already know about gases?
Answer:
gasese molecules are always in free state