Through the woods, hiker Eric comes upon a redwood tree. The sun casts shadows for both hiker Eric and the tree. Eric knows he is 6 feet tall and his shadow is 8 feet long. He is 496 feet away from the tree. How tall is the great redwood?

Answers

Answer 1

The height of the redwood has been calculated as 372 meters.

How to solve for the height

In  order to get the height of this tree, I would have to make use of the similar triangles method. The proportion is set as

tree height / tree shadow = Eric's height / Eric's shadow

Eric's height is 6 feet, his shadow is 8 feet

The proportion is 6 / 8

= 3 / 4

To get the height of the tree we have to multiply the proportion by the distance with which Eric is away from the tree

= 3 / 4 * 496

= 372 feet

The redwood is 372 feet

Read more on angles of elevation and depression here: https://brainly.com/question/27243378

#SPJ1


Related Questions

I NEED HELP COLLEGE PREP MATH FOR MIDDLE SCHOOL 8TH GRADE​

Answers

Answer: the answer should be D 13 m

Step-by-step explanation: hope this helps :)

Answer:

[tex]13[/tex]m is the hypotenuse of the right triangle

Step-by-step explanation:

Using the Pythagorean Theorem,

[tex]a^{2} + b^{2} = c^{2} \\7^{2}+11^{2} = c^{2} \\49 + 121 = c^{2} \\170 = c^{2} \\\sqrt{170 } = 13.04[/tex]

When we round to the nearest tenth,

[tex]13.04 = 13[/tex]

Hence , the hypotenuse of a right triangle is 13m

Please help I’m stuck on this question.

Answers

The requried simplified value of the given expression is given as -a³/4b². Option B is correct.

What is simplification?

The process in mathematics to operate and interpret the function to make the function or expression simple or more understandable is called simplifying and the process is called simplification.

Here,
Given expression,
= [-b³]⁰/[2ba⁻⁷ × -2ba⁴]
= -1 / 4b²a⁻³
= -a³/4b²

Thus, the requried simplified value of the given expression is given as -a³/4b². Option B is correct.

Learn more about simplification here:

https://brainly.com/question/12501526

#SPJ1

Ayman is saving money to buy a game. The game costs $30 , and so far he has saved five-sixths of this cost. How much money has Ayman saved?

Answers

Answer: Ayman has saved $25

Step-by-step explanation: It's basically just 5/6th's of 30, which is 25.

What is the answer to this question?

Answers

Answer:

the one on the left

Step-by-step explanation:

This shows a direct relationship between X and Y

2.

In algebra, two quantities are said to be in direct variation if the ratio of their values is always constant. The mathematical notation for direct variation is y = kx, where k is a non-zero constant, also called the constant of variation, and x and y are the two quantities in question.

Given the equation xy = 94, we can see that the product of x and y is always equal to 94. That is an indication of direct variation.
If we divide both side by x, we get y = 94/x which is the equation of direct variation, y is directly proportional to x, where k = 94/x.

So, the equation xy = 94 is an example of direct variation.

A.Direct
B.Inverse
C.neither

Answers

The given graph is of inverse function.

What is inverse function?

A function that can change into another function in the opposite direction is known as an inverse function or anti function. In other words, the inverse of a function "f" will take y to x if any function "f" takes x to y. If a function is written as "f" or "F," the inverse function is written as "f-1" or "F-1."

What is the inverse formula?

The original value for which a function produced its output is returned by the inverse function. Consider the inverse relationship between the functions f and g: f(g(x)) = g(f(x)) = x. The initial value is fetched by a function that is its inverse. Therefore, the inverse of f is g(y) = (y-5)/2 = x. (x).

To know more about inverse visit:-

brainly.com/question/13715269

#SPJ1

can someone please help I can't figure this out

Answers

Step-by-step explanation:

For the first equation to make a line plot a point at negitive 5 then go up three then go one to the right

For the second equation to make a like plot a point at positive 4 then go down three then go one to the left

∆ABC i divided into three maller triangle and one quadrilateral. Area of ∆AFE i 4, Area of ∆AFC i 9, area of ∆DFC i 7. Find the area of quadrilateral BEFD

Answers

The area of quadrilateral BEFD, by using Heron’s Formula, is 16.

To calculate the area of quadrilateral BEFD, we first need to calculate the area of the entire triangle ΔABC. This can be done by using Heron’s Formula, which states that the area of a triangle is equal to the square root of the semi-perimeter multiplied by the product of the sides of the triangle, minus the sum of the squares of the sides.

In this case, the semi-perimeter is (a + b + c)/2, where a, b, and c are the sides of the triangle. The sides of triangle ΔABC are 9, 10 and 11, respectively. Applying Heron’s Formula, we have:

Area of ΔABC = √(9 + 10 + 11)/2 * (9 * 10 * 11) - (9^2 + 10^2 + 11^2)

= √27 * 990 – 1230

= √990

= 31.6

Now, since we know the areas of the three triangles within ΔABC (4, 9, and 7), we can subtract the sum of those three from the total area of ΔABC to calculate the area of quadrilateral BEFD.

Area of BEFD = 31.6 – (4 + 9 + 7)

= 31.6 – 20

= 11.6

For more questions like Area of triangle click the link below:

https://brainly.com/question/1566395

#SPJ4

To indirectly measure the distance across a river, Arun stands on one side of the river and uses sight-lines to a landmark on the opposite bank. Arun draws the diagram below to show the lengths and angles that he measured. Find PRPR, the distance across the river. Round your answer to the nearest foot.

Answers

The distance PR, representing the distance across the river, is given as follows:

PR = 294 ft.

What are similar triangles?

Similar triangles are triangles that share these two features given as follows:

Congruent angle measures.Proportional side lengths.

The two similar triangles for this problem are given as follows:

POC and PRE.

Hence the distance PR is symbolized as follows:

PR = x.

The equivalent side lengths form a proportional relationship, given as follows:

x/(x + 160) = 230/355.

Hence, applying cross multiplication, the distance PR is obtained as follows:

355x = 230(x + 160)

355x = 230x + 36800

125x = 36800

x = 36800/125

x = 294 ft.

Missing Information

The diagram is given by the image presented at the end of the answer.

More can be learned about similar triangles at brainly.com/question/14285697

#SPJ1

Answer: The distance across the river is 181 ft.

Step-by-step explanation:

in photo

(Multi-Step Linear Equations MC)

Solve negative 5 times y plus seven thirds times y equals negative 5 minus eight thirds times y minus 4 for y.

Infinite solutions
No solution
y = −14
y = 0

Answers

The equation -5y + (7/3)y = -5 - (8/3)y - 4 gives no solution

What is an equation?

An equation is an expression that shows the relationship between variables and numbers.

A linear equation is in the form:

y = mx + b

m is the rate of change and b is the initial y value

Given the equation: negative 5 times y plus seven thirds times y equals negative 5 minus eight thirds times y minus 4. This equates to:

-5y + (7/3)y = -5 - (8/3)y - 4

multiply through by 3:

-15y + 7y = -15 - 8y - 12

-8y = -27 - 8y

0 = -27

no solution

Find out more on equation at: https://brainly.com/question/2972832

#SPJ1

Problem Walkthrough: Find the area of this figure.
Use 3.14 to approximate pi.
6
6
9
To solve for the area, split the figure into simple figures as
shown below. Solve for the area of each and combine.
Triangle
[?]
Rectangle
6
+
+
D
Half-circle
=
Enter the value
that belongs in
the green box.
Total Area
Enter

Answers

The total area of the figure when divided in rectangle, triangle and half circle is 86.13 square units.

What is area?

Area is the room contained by a specific shape or location. It speaks of how much room is consumed. The area and perimeter of the shape will increase in size as it gets bigger.

Given figure comprises of a rectangle, triangle, and a half circle.

The area of the figure is thus calculated by adding the value of all the figures as follows:

A = Area of triangle + Area of rectangle + Area of semi-circle

[tex]A = \frac{1}{2} (b) (h) + (l)(b) + \frac{1}{2} (\pi r^{2} )\\[/tex]

Substitute the value of length, width, height and radius:

[tex]A = \frac{1}{2} (6) (6) + (9)(6) + \frac{1}{2} (3.14 (3^{2}) )\\\\\\A = 18 + 54 + 14.13\\\\A = 86.13[/tex]

Hence, the area of the figure is 86.13 square units.

Learn more about area here:

https://brainly.com/question/26736195

#SPJ1

Help pls
Directions: Identify the binomial factors of the following trinomials.
1. x2 + 9x + 20


2. x2 + 7x + 12


3. x2 + 8x + 15


4. x2 + 7x + 12


5. x2 + 11x + 10


6. x2 + 7x + 6

7. x2 + 5x + 4

8. x2 + 10x + 21

9. x2 + 10x + 16

10. x2 + 10x + 9

11. x2 + 12x + 20

12. x2 + 15x + 14

13. x2 + 13x + 42

14. x2 + 9x + 18

15. x2 + 16x + 60

Answers

The factor form of quadratic equations are listed below:

(x + 4) · (x + 5) (x + 3) · (x + 4) (x + 3) · (x + 5) (x + 3) · (x + 4) (x + 10) · (x + 1) (x + 6) · (x + 1) (x + 5) · (x + 1) (x + 7) · (x + 3) (x + 8) · (x + 2) (x + 10) · (x - 1) (x + 10) · (x + 2) (x + 14) · (x + 1) (x + 6) · (x + 7) (x + 6) · (x + 3) (x + 10) · (x + 6)

How to determine the binomial factors of quadratic equations

In this problem we find fifteen cases of quadratic equations of the form x² + b · x + c, where b, c are real coefficients. This kind of quadratic equation can be modified into factor form by means of the following rule:

x² - (r₁ + r₂) · x + r₁ · r₂ = (x - r₁) · (x - r₂)

- r₁ - r₂ = b

r₁ · r₂ = c

Where r₁, r₂ are roots of the polynomial.

Now we proceed to find the binomial factors:

Case 1

x² + 9 · x + 20 = (x + 4) · (x + 5)

Case 2

x² + 7 · x + 12 = (x + 3) · (x + 4)

Case 3

x² + 8 · x + 15 = (x + 3) · (x + 5)

Case 4

x² + 7 · x + 12 = (x + 3) · (x + 4)

Case 5

x² + 11 · x + 10 = (x + 10) · (x + 1)

Case 6

x² + 7 · x + 6 = (x + 6) · (x + 1)

Case 7

x² + 5 · x + 4 = (x + 5) · (x + 1)

Case 8

x² + 10 · x + 21 = (x + 7) · (x + 3)

Case 9

x² + 10 · x + 16 = (x + 8) · (x + 2)

Case 10

x² + 10 · x + 9 = (x + 10) · (x - 1)

Case 11

x² + 12 · x + 20 = (x + 10) · (x + 2)

Case 12

x² + 15 · x + 14 = (x + 14) · (x + 1)

Case 13

x² + 13 · x + 42 = (x + 6) · (x + 7)

Case 14

x² + 9 · x + 18 = (x + 6) · (x + 3)

Case 15

x² + 16 · x + 60 = (x + 10) · (x + 6)

To learn more on quadratic equations: https://brainly.com/question/17177510

#SPJ1

What is obtuse triangle Class 7?

Answers

A obtuse triangle is a triangle in which one of the angles is greater than 90°.

An obtuse triangle can be mathematically defined as a triangle with one angle greater than 90°. The formula for calculating the angles of a triangle is known as the Law of Sines. The formula states that the ratio of the length of a side of the triangle to the sine of its opposite angle is the same for all sides. To calculate the angles of an obtuse triangle, we must first find the ratio of the sides to the opposite angle. For example, if we have a triangle with sides of length a, b and c, then the ratios of the sides to their opposite angles are a/sinA, b/sinB and c/sinC. Once we have found the ratios, we can use the Law of Sines to calculate the angles of the triangle. We can then determine if any of the angles are greater than 90°, which would indicate that the triangle is obtuse.

Learn more about obtuse triangle here:

https://brainly.com/question/1581660

#SPJ4

A redfish can swing at a rate of 50 miles per hour how many feet per hour is this

Answers

Answer:

264000 feet/hour

Step-by-step explanation:

1 mile = 5280 feet

5280 * 50 = 264000

50 miles/hour = 264000 feet/hour

Look at the image down below for question.

Answers

Using proportions and ratios, the answer is m / 160(2/5) = 37(7/10) / 100 which is option A

What is Proportions

Proportions are relationships between two or more related numerical values, usually expressed as fractions or ratios. They are used to compare the relative sizes of different quantities, or to assess the relationship between two different sets of data. Proportions can also be used to make predictions about future events, or to compare different sets of data.

In this problem, we can approach this as

100 pounds on Earth = 37(7/10) pounds on Mars

160(2/5) pounds on Earth = m pounds on Mars

Cross multiply both sides and solve

This will become;

m = [160(2/5) * 37(7/10)] / 100

This can be written in ratio as;

m / 160(2/5) = 37(7/10) / 100

This is option A

Learn more on proportions here;

https://brainly.com/question/2328454

#SPJ1

Kevin runs a legal services company. He charges a registration fee of $150 when a new client is registered. He will then meet with the client to discuss their legal needs and bills they $200 per hour. Write an linear equation that models this relationship.

Answers

200x + 150 where x equals the amount of hours and y equals total money owed.

How do you know if a function is exponential or not?

Answers

An exponential function is a function of the form f(x) = a^x, where a is a positive constant (a > 0). An exponential equation is an equation that involves an exponential function.

What exactly makes a function exponential?

A mathematical function with the formula f (x) = an x is an exponential function. where an is a constant known as the function's base and x is a variable. The transcendental number e, or roughly 2.71828, is the exponential-function base that is most frequently encountered.

For example, the function f(x) = 2^x is an exponential function, because it is of the form f(x) = a^x, where a = 2. The equation y = 2^x is an exponential equation, because it involves the exponential function f(x) = 2^x.

To determine whether an equation is an exponential equation, you can look for the presence of an exponential function. If the equation is of the form f(x) = a^x, where a is a positive constant, then it is an exponential equation.

If the equation is not in this form, but it involves an exponential function, it is still an exponential equation. For example, the equation y = 2^x + 1 is an exponential equation, because it involves the exponential function f(x) = 2^x.

Note that an exponential equation does not have to involve an exponent that is a positive integer. For example, the equation y = (1/2)^x is also an exponential equation, because it involves the exponential function f(x) = (1/2)^x.

Learn more about function

brainly.com/question/25638609

#SPJ4

help is very much needed.

Answers

-3 (x-y) 4x -4 x2-1 3

Y= -3x (5-7)

Henry purchased a prepaid phone card $40.50 for . Calls cost 10 cents a minute using this card. The credit, C (in dollars), left on the card after it is used for 15 minutes of calls is given by the following. How much credit is left on the card after Henry uses it for minutes of calls?

Answers

By solving the given equation we know that $32.7 credit is left on the phone.

What are equations?

The definition of an equation in algebra is a logical statement that proves two formulas are equal.

Take the equation 3x + 5 = 14, wherein 3x + 5 and 14 are two expressions that are separated by the symbol "equal."

So, we have the equation:

C(x)-35.50-0.07x

As Henry use it for 40 minutes:

Now, calculate the amount left as follows:

C(x) = 35.50 - (0.07 x 40)

C(x) = 35.50 - 2.8

C(x) = $32.7 left

Therefore, by solving the given equation we know that $32.7 credit is left on the phone.

Know more about equations here:

https://brainly.com/question/28937794

#SPJ1

Complete question:

Henry purchased a prepaid phone card for $35.50. Calls cost 7 cents a minute using this card. The credit, C(in dollars), left on the card after it is used for x minutes of calls is given by the following function. C(x)-35.50-0.07x . How much credit is left on the card after Felipe uses it for 40 minutes of calls?

Find the sum of the first ten terms
using the formula:
a(1-rn)
1,3/2,9/4,27/8,81/16

Answers

Answer:

1

Step-by-step explanation:

T1(a) = 1

T2(ar) = 3/2

T3(ar²) = 9/4

T4(ar³) =27/8

T5(ar⁴) = 81/16

lets look for r

by using the formula

[tex] \frac{t \\ 2}{t1} = \frac{t3}{t2} = \frac{t4}{t3} = r[/tex]

let us use T2/T1

[tex] \frac{ \\ ar}{a} = \frac{3}{2} \div 1 = \frac{3}{2} \times \frac{1}{1} = \frac{3}{2} [/tex]

[tex]r = \frac{ \\ 3}{2} [/tex]

since r > 1 we will use this formula

[tex]s10 = \frac{a \\ ( r - 1)}{r - 1} [/tex]

by substituting

[tex]s10 = \frac{ \\ 1( \frac{3}{2} - 1)}{ \frac{3}{2} - 1 } [/tex]

[tex] = \frac{ \\ \frac{3}{2} - 1}{ \frac{3}{2} - 1 } [/tex]

[tex] = \frac{ \\ \frac{1}{2} }{ \frac{1}{2} } [/tex]

[tex] \frac{1}{2 \\ } \div \frac{1}{2} [/tex]

[tex] \frac{1}{2 \\ } \times \frac{2}{1} [/tex]

[tex] \frac{2}{2 \\ } = 1[/tex]

therefore the sum of first ten term of the sequence is 1

A grocery store sells sliced American cheese by weight. The relationship between the amount of American cheese in pounds, xx, and the total cost in dollars of the sliced American cheese, yy, is represented by a graph drawn in the xy-plane. If the point (4,164,16) lies on the graph, what does the ordered pair (4,164,16) indicate?

Answers

The ordered pair of (4 , 16) tells us that the 4 pounds of cheese have its cost as 16 dollars.

What is meant by ordered pair in mathematics?

An ordered pair is a mathematical concept used to represent a point in a coordinate system. It is a pair of values, usually represented in the form of (x, y), where x and y are real numbers. The first value, x, represents the point's position along the horizontal (x) axis, and the second value, y, represents the point's position along the vertical (y) axis.

In the graph, what we are told is that if one purchases 4 pounds of the cheese, the amount that they would pay for the cheese would be 16 dollars.

Read more on ordered pairs here: https://brainly.com/question/11139505

#SPJ1

What is the perimeter of a rectangle with a length of Eight and one-sixth feet and a width of Six and two-thirds feet?
- 14 3/9 ft
- 16 2/6 ft
- 29 4/6 ft
- 48 3/18 ft

Answers

The required perimeter of the given rectangle is (C) 29 4/6 ft.

What is a rectangle?

A rectangle is a quadrilateral with four right angles in the Euclidean plane.

It can alternatively be described as a parallelogram with a right angle or an equiangular quadrilateral, where equiangular denotes that all of its angles are equal.

A square is a rectangle with four equally long sides.

So, the perimeter formula is:

2(l+b)

Now, calculate the perimeter as follows:

2(l+b)

2(8 1/6+ 6 2/3)

2(49/6 + 20/3)

2(89/6)

178/6

29 4/6 ft


Therefore, the required perimeter of the given rectangle is (C) 29 4/6 ft.

Know more about rectangles here:

https://brainly.com/question/25292087

#SPJ1

Correct question:

What is the perimeter of a rectangle with a length of Eight and one-sixth feet and a width of Six and two-thirds feet?

A. 14 3/9 ft

B. 16 2/6 ft

C. 29 4/6 ft

D. 48 3/18 ft

An orange drink is made using one part juice to four parts water. What proportion of the drink is juice? Give your answer as a fraction, decimal or percentage. A woman spends 675 on fond nd cor​

Answers

The proportion of the drink that is juice is one part juice to four parts water. The proportion of the drink that is juice is 1:5. This can be written in fraction as 1/5 , in decimal as 0.25 and in percentage as 25%.

What is a ratio?

A ratio is a mathematical comparison of two or more values. It is typically written as a fraction, with the values being separated by a colon (e.g. 3:4). The values in a ratio can represent any type of quantity, such as length, weight, or time.

How is a proportion different from a ratio?

A proportion is a statement that two ratios are equal. For example, if the ratio of boys to girls in a class is 4:5, and the ratio of boys to the total number of students is 12:20, then the two ratios are in proportion. In contrast, a ratio is simply a comparison of two or more values without any equality statement.

An orange drink is made using one part juice to four parts water. The proportion of the drink that is juice is 1/5.The proportion of the drink that is juice is 1/5, which can be expressed as a decimal as 0.2 (1/5 = 0.2) or as a percentage as 20% (0.2 x 100 = 20).

To learn more about proportions visit:

https://brainly.com/question/7096655

#SPJ1

Is Y 3x² 2 a function?

Answers

Yes, the function y=3x2-2 exists.

The core of calculus in mathematics are functions. The unique varieties of relations are the functions. In mathematics, a function is represented as a rule that produces a distinct result for each input x.

A polynomial equation is an equation that is the sum of terms that are products of constants, a variable, and/or powers of that variable. All polynomial equations are functions.

Given that y=3x2-2 is the sum of 3x2 and -2, the equation y=3x2-2 matches this description.

both of which are derivatives of variables, constants, or powers of variables.

Consequently, since y=3x2-2 is a polynomial equation, it must be a function.

To know more about polynomial, visit,

https://brainly.com/question/2833285

#SPJ4

complete question - Is y=3x²-2 a function?

Solve the inequality 4/3|1/4x+3|<4

Ox>-13 and x < -11
Ox<-13 and x > -11
Ox>-24 and x < 0
Ox>-24 and x > 0

Answers

The inequality 4/3|1/4x+3|<4 are Ox>-13 and x < -11 or Ox<-24 and x > 0

How do we determine the absolute values?

We can begin by isolating the absolute value on one side of the inequality:

4/3|1/4x+3|<4

|1/4x+3|<3/2

We can then split this inequality into two cases, one for when 1/4x+3 is positive and one for when it is negative:

1/4x+3>0: 1/4x+3>3/2, so multiplying both sides by 4, we get x>-13 and x<-11

1/4x+3<0: 1/4x+3<-3/2, so multiplying both sides by -4, we get x<-24 and x>0

So, the solution is: Ox>-13 and x < -11 or Ox<-24 and x > 0

learn more about inequality: https://brainly.com/question/246993

#SPJ1

Select all the values that are equivalent to the given expression. Express your answer in scientific notation.

(9.6 × 103) × (6.7 × 102)

Answers

The correct answer is 6.432 × 10 raised to the power of 6

Give PQ=24 PS=19 PR=42 TQ=10 M-PQR=106 m-QSR=49 and m-PRS=35

Answers

Considering the quadrilateral, the dimensions are as follows

QR = 19SR = 24PT = 21 SQ = 20< QRS = 74< PQS = 49< RPS = 39< PSQ = 57

How to find the dimensions

The given figure is a parallelogram, and the properties will be used in finding the required dimensions

QR = PS = 19 opposite sides of a parallelogram are equal

SR = PQ = 24 opposite sides of a parallelogram are equal

PT = PR / 2 = 42 / 2 = 21 (diagonals of a parallelogram bisects each other)

SQ = 2 * TQ = 2 * 10 = 20 (diagonals of a parallelogram bisects each other)

< QRS = < QPS and < PQR = < PSR (opposite angles of a parallelogram)

< QRS + < QPS + < PQR + < PSR = 360 (sum of angles of a quadrilateral)

2 < QRS + 2< PQR = 360

2 < QRS + 2 * 106 = 360

divide through by 2

< QRS + 106 = 180

< QRS = 180 - 106

< QRS = 74

< PQS = <QSR = 49 alternate angles

< RPS + < PRS + < PSR = 180 (angles on a triangle)

< RPS + 35 + 106 = 180

< RPS + 141 = 180

< RPS = 180 - 141

< RPS = 39

<PSQ + < QSR = < PSR adjacent angles

< PSQ + 49 = 106

< PSQ = 106 - 49

< PSQ = 57

Learn more about  parallelogram at:

https://brainly.com/question/970600

#SPJ1

The random variable xx has mean 12 and standard deviation 3. The random variable ww is defined as w=7+2xw=7+2x. What are the mean and standard deviation of ww?.

Answers

The mean of the variable w will be 31 and standard deviation will be 6

Here it is given that mean of x, μₓ = 12

                    standard deviation, σₓ = 3

     Also W= 7+2x

For a linear function, we know that

if y = a+bx , then E(y)= a+b× E(x), E denotes the mean.

E(w) = E (7+2x)

       = 7+2 × E(x)

     =  7+2×12  = 31

So mean of w will be 31.

As for standard deviation, σ =√Var

  Var (w) = Var( 2x+7)

               = Var(2x) + Var(7)

As variance of a constant term =0

    Var(w) = Var(2x)

As per the equation for variance Var(ax) = a²× Var(x)

So Var(w) = 2²× Var(x)   ( Standard deviation of x= √Var(x)

                  = 4× 9 = 36

Var(w) = 36, Standard deviation =√Var = √36 = 6

So the mean is 31 and standard deviation is 6.

For further information regarding the mean and standard deviation, kindly refer

https://brainly.com/question/30094073

#SPJ4

An apartment has 972 square feet of carpeting. How much is this in square meters? Use the following conversion: 1 square meter is 10.8 square feet.

(Giving Brainliest, thanks, 5 stars and 20 points for correct answer cause I do that)

(it also gave me that conversion)

Answers

It is 90.5 square meters Explanation; 972/10.8=90.5

Answer: 90 sqare meters

Step-by-step explanation: you have to take 972 and divide it by 10.8 then you get your answer

Given a polynomial function f(x) = 2x2 + 7x + 6 and an exponential function g(x) = 2x + 5, what key features do f(x) and g(x) have in common?

Both f(x) and g(x) increase over the interval of [–4 , ∞)
Both f(x) and g(x) have the same x-intercepts of (–2, 0) and (–1.5, 0).
Both f(x) and g(x) have the same y-intercept of (0, 6).
Both f(x) and g(x) have the same range of (–∞, 0].

Answers

The solution is Option C.

The functions f ( x ) and g ( x ) have the same y-intercept of ( 0 , 6 )

What is an Equation?

Equations are mathematical statements with two algebraic expressions flanking the equals (=) sign on either side.

It demonstrates the equality of the relationship between the expressions printed on the left and right sides.

Coefficients, variables, operators, constants, terms, expressions, and the equal to sign are some of the components of an equation. The "=" sign and terms on both sides must always be present when writing an equation.

Given data ,

Let the first function be represented as A

Let the second function be represented as B

Now , the value of A is

f ( x ) = 2x² + 7x + 6   be equation (1)

Now , the value of B is

g ( x ) = 2ˣ + 5   be equation (2)

Now , on simplifying the equation , we get

To find the y-intercepts of the function ,

Substitute the value of x = 0 in the equation , we get

f ( 0 ) = 2 ( 0 )² + 7 ( 0 ) + 6

On simplifying the equation , we get

y = 6

Now , g ( x ) = 2ˣ + 5

Substitute the value of x = 0 in the equation , we get

g ( 0 ) = 2⁰ + 5

g ( 0 ) = 1 + 5

g ( 0 ) = 6

Hence , the y intercepts of the functions f ( x ) and g ( x ) is ( 0, 6 )

To learn more about equations click :

https://brainly.com/question/19297665

#SPJ1

Rectangle ABCD and DEFG are congruent
AB=7cm
AD=17cm
Work out the length of CE

Answers

We have the length of CE as 18.4 cm.

Since the rectangles ABCD and DEFG are congruent, all sides of rectangle ABCD will be equal to the corresponding sides of rectangle DEFG. Since AB = 7 cm and AD = 17 cm in rectangle ABCD, we can conclude that DE = 7 cm and DF = 17 cm in rectangle DEFG.

Since CE is a diagonal of rectangle DEFG, it can be found using the Pythagorean theorem. In a rectangle, the diagonal is the hypotenuse of a right triangle formed by one side and one side's corresponding side.

Therefore, CE = √(DE² + DF²) = √(7² + 17²) = √(49 + 289) = √(338) = 18.4 cm

Therefore, the length of CE is 18.4 cm.

To learn more about the Pythagorean theorem,

Visit; brainly.com/question/14930619

#SPJ4

Other Questions
The woods co. and the mickelson co. have both announced ipos at $43 per share. one of these is undervalued by $20, and the over is overvalued by $14, but you have no way of knowing which is which. you plan on buying 1,000 shares of each issue. if an issue is underpriced, it will be rationed, and only half your order will be filled. what is the amount of the difference between your expected profit and the amount of profit you could earn if you could get 1,000 shares of woods and 1,000 shares of mickelson? In Problems 4754 find the eigenvalues and eigenvectors of the given matrix.|2 1||2 1| let p(a) = 0.6, p(b) = 0.3, and p(ab)c = 0.1. calculate p(ab). how and why does working capital affect the incremental cash flow estimation for a proposed large capital budgeting project In general, which type of marketing do you think is most effective for events: push or pull marketing?Discuss how an events ability to help us escape from everyday life and worries can be advantageous for marketers. What should a company or organization do to minimize any negative buzz surrounding its event?How effective do you think social media is about getting the word out and creating buzz for an event? Explain. Do you think encouraging people to engage on social media networks while at an event detracts from the event itself? Why or why not? I'll give brainliest to whoever gets the right answer!We wish to determine the moles of lead (II) iodide precipitated when 125ml of 0.20 M potassium iodide reacts with excess lead (II) nitrate. 2KI (aq) + Pb(NO3)2 (aq) = 2KNO3 (aq) + PbI2 (s) How many moles of ki are present in 125 ml of 0.20 m ki? which particles in the nuclei of atoms are used to arrange the elements An amplifier has an open-circuit voltage gain of 100. With a 10-KOhm load connected,the voltage gain is found to be only 80. Find the output resistance of the amplifier. A ball is thrown into the air with initial velocity v(0) = 3i + 8k. The acceleration is given by a(t) = 8j 16k. How far away is the ball from its initial position at t = 1? Tutorial Exercise Find and sketch the domain of the function. RX,Y)= 36 - X2 Step 1 When finding the domain of a function, we must rule out points where the denominator equals zero equals zero and where there are negative negative values in the square root. Step 2 For rx, y) - Vy - x? the denominator equals 0 when x2 = 36 36 36 - X2 Therefore, we must have x y Step 3 The numerator Vy - x? is defined only when y - x 2 0. Therefore, we must have y 3 Step 4 Combining the above, we determine that the domain of the given function is as follows. 1) what is an immersive technology, according to hill? 2) would gardner agree with hill's conclusion? do you agree with hill's conclusion? why or why not? Select the accessory organs that deposit secretions directly into the duodenum. (Select multiple)AppendixGallbladderJejunumStomachSalivary GlandsPancreas Eminem, who was controversial for making anti-gay statements and writing songs that seemed to endorse violence, was backed in production by former N. W. A. Member, Ice Cube. Each of the following managers works for a national chain of hotels and has been given certain decision-making authority. Classify each of the managers according to the type of responsibility center they manage. a. Manager of the Central Reservation Office b. Managers of various corporate-owned hotel locations c. Manager of the H1 Corporate Division d. Manager of the Housekeeping Department at one hotel e. Manager of the H2 Corporate Division f. Manager of the complimentary breakfast buffet at one hotel Cost center nvestment center Profit center Revenue center Which is the most common type of victimization? brazilians have hundreds of ways of categorizing people according to race. the particular system they use is a continuum of ________. What positions should the nurse encourage the client to assume to help promote comfort during back labor? Select all that apply. Incorrect1 Prone Correct2 Enterprising children often went into business for themselves. Kids peddled matches, shoelaces, and ribbons from boxes set up on street corners. Young bootblacks, carrying homemade shoeshine kits, waited for customers in railroad stations, parks, and busy intersections.Immigrant Kids,Russell FreedmanWhich sentence best paraphrases the passage?Children found many ways to earn money. They sold items and shined shoes.Children who were clever were able to sell matches. They also sold shoelaces.Children either sold items or shined shoes. There were no other jobs for them.Children shined shoes at busy intersections. They shined them in parks. Using the Lewis concept of acids and bases, identify the Lewis acid and base in each of the following reactions:Ni(NO3)3(s)+6H2O(l)Ni(H2O)63+(aq)+3NO3(aq)Can someone explain to me why Ni(NO3)3 is a lewis acid if it's accepting h2o and why h2o is a lewis base if it's giving itself instead of receiving an e-?CH3NH2(g)+HBr(g)CH3NH3Br(s)Can someone also explain to me why HBR is a lewis base it's donating a H+? And why CH3NH2 is a lewis acid for accepting a H+? during paper electrophoresis at ph 7.1 , toward which electrode does glycine migrate?