work out length x in the triangle below
if your answer is a decimal, give it to 1 d.p.

Work Out Length X In The Triangle Belowif Your Answer Is A Decimal, Give It To 1 D.p.

Answers

Answer 1

The length x in the triangle below is 16 m.

What is length?

Length is the distance between two points.

To calculate the length of the triangle, we use the formula below

Formula:

A = absin∅/2...................... Equation 1

Where:

A = Area of the triangle∅ = Included angle of the triangle

From the question,

Given:

a = 15 mb = x∅ = 30°A = 60 m²

Substitute these values into equation 1 and solve for x

60 = (15×x)sin30°/2120 = 15x(1/2)15x = 240x = 240/15x = 16 m

Learn more about length here: https://brainly.com/question/28108430

#SPJ1


Related Questions

geometry need help please

Answers

First we need to simplify the side lengths
Squared root of 21 is 4.58
Squared root of 85 is 9.22

Now the next step is to find the angle of N
We have the opposite and hypotenuse of angle N so we can use Sin

The equation for Sin is : opposite/hypotenuse

Since we are finding an angle we need to use sin of -1

Sin^-1 ( opposite / hypotenuse)
Sin ^1 (4.58/9.22) = about 30 degrees

Because we need to find cos we need the adjacent side length.
We can use the formula a^2 + b^2 = c^2
4.58^2 + b^2 = 9.22^2
B = 8


Plug in 30 degrees for the cos (n)
Cos = adjacent/ hypotenuse
Cos (30) = 8/9.22 = 0.87

Answer is 0.87

The side of a square is measured to be 16 ft with a possible error of ±0.1 ft. Use linear approximation or differentials to estimate the error in the calculated area. Include units in your answer.

Answers

The estimated error in the calculated area is approximately 3.2ft²

How did we estimate the error?

To estimate the error in the calculated area of a square, use linear approximation or differentials.

The area of a square is given by the formula A = s², where s represents the length of a side.

Calculate the area of the square using the given side length of 16 ft:

A = (16 ft)²

A = 256 ft²

Now, let's consider the possible error in the side length, which is ±0.1 ft. Treat this error as a change in the side length (Δs) and use linear approximation or differentials to estimate the corresponding change in the area (ΔA).

Using linear approximation, express the change in the area as:

ΔA ≈ 2s Δs

Substituting the values:

ΔA ≈ 2(16 ft)(0.1 ft)

ΔA ≈ 3.2 ft²

Therefore, the estimated error in the calculated area is approximately 3.2ft².

learn more about area of a square: https://brainly.com/question/11444061

#SPJ1

The record low temperature in Fargo, ND is -35 degrees. The record high is 114 degrees. What is the difference in the record high and the record low temperatures?

Answers

The difference between the record high and low temperatures is 149 degrees.

What is the difference between the temperatures?

A negative number is a number that is less than zero. A negative number usually has a minus sign in front of it. An example of a negative number is -35. A positive number is a number that is greater than zero. An example of a positive number is 10.

In order to find the difference between two or more numbers, subtract the numbers from each other.

Difference between the temperature = record high temperature - record low temperature

114 - -35

114 + 35 = 149 degrees

To learn more about subtraction, please check: https://brainly.com/question/854115

#SPJ1

Please urgent help I can’t figure this out thank you guys for always helping

Answers

Answer:

Domain:  {-24, -12, -8, 9, 14, 50}

Range:  {23, 69, 83, 92, 97, 32}

Step-by-step explanation:

The domain of a function is the set of all possible input values (usually x) for which the function is defined. The range of a function is the set of all possible output values (usually y, which is synonymous with f(x)) that the function can produce.

For a function like f(x), each coordinate is in the form (x, f(x)) aka (x, y)

Since our x-coordinates are -24, -12, -8, 9, 14, and 50, the domain of f(x) is {-24, -12, -8, 9, 14, 50}

Since our f(x) or y-coordinates are 23, 69, 83, 92, 97, and 32, the range is {23, 69, 83, 92, 97, 32}

Please someone help me with this. Simplify. The expression in the picture no negative exponents should be added in the answer

Answers

A simplification of the given expression is 1/m¹⁶.

What is an exponent?

In Mathematics, an exponent is a mathematical operation that is commonly used in conjunction with an algebraic equation or expression, in order to raise a given quantity to the power of another.

Mathematically, an exponent can be represented or modeled by this mathematical expression;

bⁿ

Where:

the variables b and n are numbers (numerical values), letters, or an algebraic expression.n is known as a superscript or power.

By applying the division and multiplication law of exponents for powers of the same base to the given algebraic expression, we would have the following simplified expression:

[tex](m^{\frac{4}{5}} \cdot m^{\frac{4}{5}} )^{-10}\\\\(m^{\frac{4}{5} +\frac{4}{5} } } )^{-10}\\\\(m^{\frac{8}{5} } )^{-10}\\\\(m^{\frac{8 \times -10}{5} } )\\\\(m^{\frac{-80}{5} } )\\\\m^{-16}[/tex]

1/m¹⁶

Read more on exponent here: brainly.com/question/27858496

#SPJ1

What is the ratio for 3 rectangles and 4 ovals in its simplest form?

Answers

The ratios for the rectangles and the ovals is 4 : 3

Calculating the ratios for the rectangles and the ovals

From the question, we have the following parameters that can be used in our computation:

Rectangle = 4

Oval = 3

The ratio can be represented as

Ratio = Rectangle : Oval

When the given values are substituted in the above equation, we have the following equation

Rectangle : Oval = 4 : 3

The above ratio cannot be further simplified

This means that the ratio expression would remain as 4 : 3

Hence, the solution is 4 : 3

Read more about ratio at

https://brainly.com/question/12024093

#SPJ1

increase a gross by 10%​

Answers

The results of increasing a gross by 10% is 158.4.

What is percentage?

Percentage refers to the amount, number or rate of something, regarded as part of a total of 100.

In mathematics, gross is written in figures as 144

increase a gross by 10%

= 144 + (10% × 144)

= 144 + (0.1 × 144)

= 144 + 14.4

= 158.4

Hence, 158.4 is the 10% increase in gross.

Complete question:

Calculate the increase in a gross by 10%.

Read more on percentage:

https://brainly.com/question/843074

#SPJ1

how many cubes that are 1" x 1" x 1" could fit into a box that is 8" x 8" x 8"

Answers

Answer:

512

Step-by-step explanation:

To determine how many 1" x 1" x 1" cubes can fit into an 8" x 8" x 8" box, we need to calculate the volume of the box and then divide it by the volume of a single cube.

The volume of the box is calculated by multiplying its length, width, and height:

Volume of the box = 8" x 8" x 8" = 512 cubic inches.

The volume of a single cube is 1" x 1" x 1" = 1 cubic inch.

To find out how many cubes can fit, we divide the volume of the box by the volume of a single cube:

Number of cubes = Volume of the box / Volume of a single cube

Number of cubes = 512 cubic inches / 1 cubic inch

Number of cubes = 512

Therefore, 512 cubes that are 1" x 1" x 1" can fit into an 8" x 8" x 8" box.

512.

If you have a cube that is 1x1x1 and a box that is 8x8x8, then you would multiply the 8x8x8 and get 512 because the cube is only 1x1x1 and when you multiply 8x1 you still get 8.

Identify the part, percent and base.

$37.60 interest earned on a $460 investment at 8%.

Part:

Percent:

Base:

Answers

The given information is,$37.60 interest earned on a $460 investment at 8%.

Part:The amount of interest earned is called the part. Here, the amount of interest earned is $37.60. Hence the part is $37.60.

Percent:The rate per 100 units of the base is called the percent. Here, the percent rate is 8%.

Base:The original amount invested or borrowed is called the base. Here, the original investment amount is $460. Hence the base is $460.

Thus,

Part: $37.60

Percent: 8%

Base: $460.

Part: The part is the interest earned, which is $37.60.

Percent: The percent is 8%, which represents the annual interest rate.

Base: The base is the amount of the investment, which is $460.

make a table for each equation using the following numbers as : x -2,-1,0,1
y=3x-2

Answers

The equation y = 3x - 2. can be placed in table as shown below. For example, when x = -2, y = 3(-2) - 2 = -8. Similarly, when x = -1, y = 3(-1) - 2 = -5, and so on.

In this table, each row represents a pair of values (x, y) that satisfy the equation y = 3x - 2. For example, when x is -2, y is calculated as 3(-2) - 2 = -8. Similarly, for the other values of x, the corresponding values of y are calculated accordingly.

Here's a table showing the values of x and the corresponding values of y for the equation y = 3x - 2:

x y

-2 -8

-1 -5

0 -2

1 1

To fill in the table, substitute each value of x into the equation and calculate the corresponding value of y. For example, when x = -2, y = 3(-2) - 2 = -8. Similarly, when x = -1, y = 3(-1) - 2 = -5, and so on.

For more such questions on equation , Visit:

https://brainly.com/question/29174899

#SPJ11

On a standardized exam, the scores are normally distributed with a mean of 300 and
a standard deviation of 40. Find the z-score of a person who scored 280 on the exam.
Answer:
Submit Answer
Privacy Policy Terms of Service
attempt 1 out of 2

Answers

The z- score of a person who scored 280 on the exam can be found to be - 0. 5.

How to find the z - score ?

A z-score indicates how many standard deviations an element is from the mean.

The formula is:

Z = ( X - μ ) / σ

The details here are:

X = 280, μ = 300, and σ = 40

The z - score is therefore :

Z = (280 - 300) / 40

= -20 / 40

= -0.5

In conclusion, the z - score of a person who scored 280 on the exam is -0.5. This means that their score is half a standard deviation below the mean.

Find out more on z - score at https://brainly.com/question/31018061

#SPJ1

I just need the answer for letter b

Answers

If f(x) = 1/343, then x = -3. The point on the graph of f when f(x) = 1/343 is (-3, 1/343).

How to explain the value

A point is the basic relationship displayed on a graph. Each point is defined by a pair of numbers containing two coordinates. A coordinate is one of a set of numbers used to identify the location of a point on a graph. Each point is identified by both an x and a y coordinate.

If f(x) = 1/343, then x = -3. This is because 343 = 7³, therefore the inverses is 1/343. The point on the graph of f when f(x) = 1/343 is (-3, 1/343

Learn more about graph on

https://brainly.com/question/19040584

#SPJ1

100 Points! Geometry question. Photo attached. Please show as much work as possible. Thank you!

Answers

The proof of ΔRUV ≅ ΔSUT is shown below.

Given that:

RSTV is a rectangle and U is the midpoint of VT.

Here, We have to Prove:

⇒ ΔRUV ≅ ΔSUT

Now, We can prove as;

Statement                               Reason

1) RSTV is a rectangle               Given

2) Angle V and T are                Because every angle in a rectangle is 90

right triangle.

3) ∠V ≅ ∠T                               Because both are right angle.

4) U is the midpoint of VT.        Given

5) VU = UT                                By midpoint theorem.

6) VR ≅ TS                                Opposite sides of rectangle.

7) ΔRUV ≅ ΔSUT                       By SAS congruency theorem.

Learn more about the triangle visit;

brainly.com/question/1058720

#SPJ1

Given: KBWN is a parallelogram with diagonals KW and BN intersecting at point H.
Prove:

An incomplete flowchart proof is shown.

Answers

By ASA congruency triangle KBH is congruent to triangle NWH.

Given that, KBWN is a parallelogram with diagonals KW and BN intersecting at point H.

From the given figure,

Consider ΔKBH and ΔNWH,

∠KHB=∠NHW (Vertically opposite angles)

∠HKB=∠HWN (Interior alternate angles parallelogram)

KH=HW (Diagonals bisect each other)

By ASA congruency ΔKBH ≅ ΔNWH

Therefore, by ASA congruency triangle KBH is congruent to triangle NWH.

To learn more about the congruent theorem visit:

https://brainly.com/question/24033497.

#SPJ1

Find the quotient and express the answer in scientific notation. 302 ÷ (9.1 x 10^4 )

Answers

The  quotient of 302 ÷ (9.1 x [tex]10^4)[/tex] in scientific notation is approximately 3.31868131868 x [tex]10^1[/tex]

How to find the quotient

Dividing 302 by 9.1 gives:

302 ÷ 9.1 ≈ 33.1868131868

Now, to express this result in scientific notation, we need to move the decimal point to the appropriate position to create a number between 1 and 10. In this case, we move the decimal point two places to the left:

33.1868131868 ≈ 3.31868131868 x[tex]10^1[/tex]

Therefore, the quotient of 302 ÷ (9.1 x [tex]10^4[/tex]) in scientific notation is approximately 3.31868131868 x[tex]10^1[/tex]

Learn more about quotient at https://brainly.com/question/11995925

#SPJ1

please help me important question in image

Answers

Segment BF is 36 will be the accurate statement.

Similarity theorem of triangle

A triangle known to be similar if the ratio of similar sides of the triangle is equal to a constant.

From the given triangle, the following expression is true:

EC/FC = AC/BF+FC

Substitute the given parameters into the formula to have:

20/30 = 24+20/BF+30

20/30 = 44/BF+30

2/3 = 44/BF + 30

2(BF+30) = 132

2BF + 60 = 132

2BF = 132 - 60

2BF = 72

BF = 36

Hence the correct statement will be that segment BF is 36

Learn more on similar triangle here:

#SPJ1

At LaGuardia Airport for a certain nightly flight, the probability that it will rain is 0.07 and the probability that the flight will be delayed is 0.18. The probability that it will not rain and the flight will leave on time is 0.8. What is the probability that it is raining if the flight has been delayed? Round your answer to the nearest thousandth.

Answers

The probability that it is raining if the flight has been delayed is 0.07, or 7%.

How to calculate the probability

We can use the following formula to calculate the probability that it is raining if the flight has been delayed:

P(Rain|Delayed) = P(Rain and Delayed) / P(Delayed)

We are given that P(Rain) = 0.07 and P(Delayed) = 0.18. We can also use the fact that P(Rain and Delayed) = P(Rain) * P(Delayed):

= 0.07 * 0.18

= 0.0126.

Substituting these values into the formula, we get:

P(Rain|Delayed) = 0.0126 / 0.18 = 0.07

Therefore, the probability that it is raining if the flight has been delayed is 0.07, or 7%.

Leans more about probability on

https://brainly.com/question/24756209

#SPJ1

Find the distance between (2, 5) and (-5, 8).
58
√58
2√43
2

Answers

Answer:

d = [tex]\sqrt{58}[/tex]

Step-by-step explanation:

calculate the distance d using the distance formula

d = [tex]\sqrt{x_{2}-x_{1})^2+(y_{2}-y_{1})^2 }[/tex]

with (x₁, y₁ ) = (2, 5 ) and (x₂, y₂ ) = (- 5, 8 )

d = [tex]\sqrt{(-5-2)^2+(8-5)^2}[/tex]

   = [tex]\sqrt{(-7)^2+3^2}[/tex]

   = [tex]\sqrt{49+9}[/tex]

   = [tex]\sqrt{58}[/tex]

HELP PLEASE ASAP PHOTO INCLUDED

Answers

The volume of water that the pool can hold is  150.72 cubic centimeters.

How to find the volume of the pool?

Remember that the volume of a cylinder of radius R and height H is:

V = pi*R²*H

Where pi = 3.14

For the pool we know that the height is H = 3ft, and the diameter is 8ft, then the radius is R = 8ft/2 = 4ft

Replacing that in the volume formula we will get:

V = 3.14*(4cm)²*3cm

V = 150.72 cubic centimeters.

Learn more about cylinders at:

https://brainly.com/question/9554871

#SPJ1

Does the data follow a normal distribution? Why or why not?

Answers

Yes. It follows the normal bell curve

Esther ran round the playground and 12 times. The playground is 240 m by 160 m. what distance did she cover?​

Answers

The total distance she cover after running is 9600 meters

How to calculate the total distance she cover?​

From the question, we have the following parameters that can be used in our computation:

Number of times = 12 times

Dimensions of the playground = 240 m by 160 m

The perimeter of the playground is calculated as

Perimeter = 2 * sum of dimensions

substitute the known values in the above equation, so, we have the following representation

Perimeter = 2 * (240 + 160)

The total distance she cover is calculated as

total distance = 12 * 2 * (240 + 160)

Evaluate

total distance = 9600 meters

Hence, the total distance she cover is 9600 meters

Read more about perimeter at

https://brainly.com/question/24571594

#SPJ1

Find the greatest common factor of 21x^4 and 49x^3

Answers

The greatest common factor of two terms given as 21x⁴ and 49x³ is equal to  7x³.

To find the greatest common factor (GCF) of two terms, we need to find the highest factor that is common to both terms. In this case, we have 21x⁴ and 49x³.

To find the factors, we can break each term down into its prime factors:

21x⁴ = 3 * 7 * x * x * x * x

49x³ = 7 * 7 * x * x * x

The common factors are 7 and x³. To find the GCF, we multiply these common factors together:

GCF = 7  * x³

GCF = 7x³

To learn more about greatest common factor click on,

https://brainly.com/question/9767511

#SPJ1

Select the correct answer from the drop-down menu. The missing term in the denominator is

Answers

Answer: where is the answer choices

Step-by-step explanation:

You deposit $5000 in an account earning 3% interest compounded continuously. How much will you have in the
account in 15 years?

Answers

Answer:

$7841.56

----------------------

Use the compound interest formula:

[tex]A = Pe^{rt}[/tex]

Where:

A = final amount;P = initial deposit = $5000;r = annual interest rate = 3% = 0.03;t = time period in years = 15.

Plugging in the values, we get:

[tex]A = 5000*e^{0.03*15}[/tex][tex]A = 7841.56[/tex]

factorise fully

1) 3x² - 27y²

2) 2014² - 2013²


please help​

Answers

Answer: 3x² - 27y² = (3x²) - (27)(y²) = 3(x² - 9y²) = 3(x - 3y)(x + 3y), and 2014² - 2013² = (2014 + 2013)(2014 - 2013) = (3127)(1) = 3127

Im not 100% sure of this answer cause I'm not that good at stuff like this but I still think this is right fr fr

A school class went on a field trip to see a magician perform there were 17 females 20 males in the class the magicians randomly selected a volunteer from the audience in which had 52 females and 68 males given that the randomly selected audience member is a student from the class which equation can be used to find the probability p that the perdimos also a female?please help does anyone know the answer

2
SEE ANSWERS


ASK AN EXPERT

Answers

The probability p that the perdimos is also a female is 17/120

What is Conditional Probability?

Conditional Probability is the possibility or likelihood of an event or outcome happening, based on the existence of a previous event or outcome.

How to determine this

When there were 17 females in class

And 20 male in class

When randomly selected, the female are 52

And males are 68

To calculate the selected volunteer is a student of the class.

= 20 + 17/52 + 68

= 37/120

To calculate the probability that the selected student is female.

= 17/52 + 68

= 17/120

= 0.14

Read more about Probability

https://brainly.com/question/31695049

#SPJ1

A thermometer reading 10°C is brought into a room with a constant temperature of 36°C. if the thermometer reads 14°C after 2 minutes, what will it read after beint left in the room for 4 minutes? and for 9 minutes?​

Answers

Answer:

4 minutes: 17.4 °C9 minutes: 23.7 °C

Step-by-step explanation:

You want to know a thermometer's reading 4 minutes and 9 minutes after begin brought into a room with a temperature of 36 °C if its initial reading is 10 °C, and it rises to 14 °C after 2 minutes.

Newton's law of cooling

Newton's law of cooling tells you the temperature difference of 36 -10 = 26 °C will decline exponentially. If it declines to 36 -14 = 22 °C after 2 minutes, then the temperature reading can be modeled by ...

  T = 36 -26·(22/26)^(t/2)

At times of t=4 and t=9, the temperature readings will be ...

4 minutes: 36 -26(11/13)^(4/2) ≈ 17.4 °C9 minutes: 36 -26(11/13)^(9/2) ≈ 23.7 °C

__

Additional comment

The time constant of this thermometer is about 12 minutes, so it will take about 67 minutes to read within 0.1 °C of the room temperature.

<95141404393>

Extract the common factor from
(1) 2.x-2.y
(2) 5.x.x.x+5.3.x.y​

Answers

Answer:

(1) 2x - 2y = 2(x - y)

(2) 5x^3 + 15xy = 5x(x^2 - 3y)

Find your answer on above picture ihope it will help you thank you.

What’s the constant term of the polynomial 2x^3-5x^2+8*x+3

Answers

The constant term of the polynomial 2x³-5x²+8x+3 is 3.

A polynomial is a mathematical expression consisting of variables (also called indeterminates) and coefficients, which are combined using addition, subtraction, and multiplication, but not division by a variable.

The variables in a polynomial are typically denoted by x, y, or z, and the coefficients can be constants or other polynomials.

The constant term of a polynomial is the term that doesn't have any variable attached to it. In this case, the constant term is the one that only has a number, which is 3.

Therefore, the constant term of the polynomial 2x³-5x²+8x+3 is 3.

To know more about polynomials follow

https://brainly.com/question/29804635

#SPJ1

There were 104 females and 78 males present at the high school pep rally. Find the ratio of males to the total number of people present. Express as a simplified ratio.

Answers

Answer:

The ratio is 3:7

Step-by-step explanation:

You add 104+78

The un-simplified ratio is 78:182

hope this helps!!

rate this if it does!

Other Questions
In PQR, the measure of R=90, the measure of Q=7, and PQ = 9. 4 feet. Find the length of QR to the nearest tenth of a foot an ecosystem has an ecological efficiency of 10 percent. if the producer level contains 10,000 kilocalories of energy, how much energy does the tertiary consumer level contain? Using two INSERT statements, store in the database the fact that PC model 1100 is made by manufacturer C, has speed 3.2, RAM 1024, hard disk 180, and sells for $2499.b) Insert the facts that for every PC there is a laptop with the same manufacturer, speed, RAM, and hard disk, a 17-inch screen, a model number 1100 greater, and a price $500 more.c) Delete all PC's with less than 100 gigabytes of hard disk.d) Delete all laptops made by a manufacturer that doesn't make printers.e) Manufacturer A buys manufacturer B. Change all products made by B so they are now made by A. A 0. 500-kg glider, attached to the end of an ideal spring with force constant k = 450N/m, undergoes SHM with an amplitude of 0. 040 m. Compute (a) the maximum speedof the glider; (b) the speed of the glider when it is at x = -0. 015 m; (c) the magnitude ofthe maximum acceleration of the glider; (d) the acceleration of the glider at x = -0. 015m; (e) the total mechanical energy of the glider at any point in its motion If the MPC in an economy is 0.5, government could shift the aggregate demand curve rightward by $60 billion by Multiple Choice 1. decreasing taxes by $60 billion. 2. increasing government spending by $60 billion. 3. increasing government spending by $30 billion. 4. decreasing taxes by $120 billion. there was little immediate reaction to cade's report that lithium helped alleviate the symptoms of manic patients. this was because to help you easily identify sheets in a workbook, you can add _____ to the sheet tab. select one: alignment fonts color styles A random sample of 7 patients are selected from a group of 25 and their cholesterol levels were recorded as follows:128, 127, 153, 144, 132, 120, 115Find the sample mean. the integral c[(3x2y y2)dx (x3 2xy)dy] is independent of the path. evaluate the integral where c is the path given parametrically by r=ti (t2 t2)j for 0t2. A way for policymakers to avoid the problems that deflation can present and still meet their objective of price stability is toMultiple Choicea)set a higher inflation target.b)keep the monetary base fixed.c)set a target of zero inflation.d)target a nominal interest rate of zero. At different times in American history, especially directlyafter World War Two and despite their need for safety, theUnited States was_____accepting refugees.A)againstB)in favor ofC)undecided aboutD)interested in a nurse is planning care for a client and her husband recently diagnosed with multiple sclerosis and wanting to prevent pregnancy for now. what is the most appropriate nursing diagnosis for this couple? approximately how many teenagers develop drinking problems or permit alcohol to adversely affect their schooling or personal relationships? small changes in the orbits of planets caused by the gravitational pull of the other planets in the solar system are called: What is the free energy change in kJmol associated with the following reaction under standard conditions? CH3COOH(l)+2O2(g)2CO2(g)+2H2O(g) The standard free energy of formation data are as follows: Gf,CH3COOH(l)=-389.9kJmolGf,CO2(g)=-394.4kJmolGf,H2O(g)=-228.6kJmol TRUE/FALSE. each individual experiences pain differently. it has been found that depending on your culture Which of the following bodies of evidence support the African model for modern human origins?-genetic evidence-fossil evidence-written evidence-archaeological evidence a low level of _____ is the main reason for the uncontrollable shaking seen in patients with parkinson's disease and in patients who are taking conventional antipsychotics. Four equal strips A B C and D were cut from a potato whose cell sap concentration was 28.5%sugar. The strips were placed in sugar solutions of different concentrations as follows;A-10%,B-15%,C-25%,D-35%. 1.What changes would you expect in strips A and D? 2.Account for the changes in A and D. insulin: a. tends to lower blood concentrations of glucose, amino acids, and fatty acids. b. promotes metabolism of glucose by tissue cells. c. is produced by beta cells. d. all of the above are true.