Answer:
Bubbling and fizzing are likely to occur when a new substance is formed. The other examples are simply changing to a different form of the same substance.
What halogen can react with sodium chloride solution to produce chlorine?
Answer:
As electro-negativity decreases from Florine to downwards in the group and only Florine is above Chlorine, so Florine should react with sodium chloride solution to produce chlorine.
mark me brinilylist pls
Explain why some substances travel further than others.
Larger molecules take longer to move up the chromatography paper or TLC plate, whereas smaller molecules are more mobile. Likewise, the polarity of the molecules can affect how far the spots travel, depending on the type of solvent used.
[tex]\large\sf\red{♡♡}[/tex]
I need help!!!!!!!!!!!!!!!
Answer:
I think the answer is A.
Explanation:
hope this helps.
Of the following elements, which one has the smallest first ionization energy?
A. boron
B. carbon
C. aluminum
D. silicon
Answer:
C. Aluminum
Explanation:
Aluminum has 5.9858 ionization energy
Boron has 8.298 ionization energy
Silicon has 8.1517 ionization energy
Carbon has 11.2603 ionization energy
how many moles are in 8.32 × × times 10^24 molecules of co2?
Answer:
13.8 moles
Explanation:
You know that in a mole you have 6.022x10²³ something in this case of molecules. By knowing that by each mole you have 6.022x10²³ molecules, then you can establish the factor of conversion:
8.32x10²⁴molec of CO2 x 1 mol/6.022x10²³ molec of CO2
You divide 8.32x10²⁴/6.022x10²³ and you get 13.81 moles.
1. Which of the following statements about the properties of elements related to an
atomic emission spectrum are true? Select all that apply. (3 are correct)
The emission spectrum of an atom consists of limited lines that are unique to a given element.
According to the Bohr model of the atom, energy is absorbed or emitted when an atom moves from one energy level to another. Since energy is quantized, the spectrum of atoms often consists of single lines.
Hence, the true statement about atomic spectrum is that; "the light that an element emits is made up of a limited number of narrow lines that produce a unique pattern or atomic emissions spectrum for that element."
Learn more about atomic spectrum: https://brainly.com/question/2049494
What is the mass number (A) of an atom that has an atomic number (Z=26) with 29 neutrons and 26 electrons?
Atom information–
Atomic number (Z) = 26Protons (p⁺) = 26Neutrons (n⁰) = 29Electrons (e⁻) = 26The atomic number (Z) of an atom is the number of protons (p⁺) it hasThe mass number (A) of an atom is characterized by the sum of the amount of protons (p⁺) with its neutrons (n⁰)Substituting values –
[tex]\qquad[/tex] [tex]\twoheadrightarrow\bf A=p^{+}+n^{0}[/tex]
[tex]\qquad[/tex] [tex]\twoheadrightarrow\bf A=26+29[/tex]
[tex]\qquad[/tex] [tex]\twoheadrightarrow\bf A=55[/tex]
____________________________________________
Which of these substances are greenhouse gases? Check all that apply. Oxygen carbon dioxide helium methane nitrous oxide.
The greenhouse gases are carbon dioxide, methane, and nitrous oxide.
The greenhouse effect has been defined as the entrapment of the sun's energy by the gases that result in the earth becoming warmer and a better place to live.
The gases present in the atmosphere that has been able to entrap the heat energy has been termed the greenhouse gases.
The greenhouse gases have been carbon dioxide, methane, and nitrous oxide.
For more information about greenhouse gases, refer to the link:
https://brainly.com/question/11595872
Answer:
carbon dioxide, nitrous oxide, methane
Explanation:
What does the electron configuration for the noble gases tell us about the elements in the
group
Answer:That all noble gases will have 8 valence electrons which makes a atom stable
Explanation:
What are some examples of a chemical change? (list more than 2 examples)
Cooking any food.
Burning of wood.
Digestion of food.
Acid-base reaction.
Consider the reaction below. H2PO4â€"" H2O Right arrow. H3O HPO42â€"" Which of the following is a baseâ€""conjugate acid pair? H2O and H3O H2O and H2PO4â€"" H2PO4â€"" and HPO42â€"" H2PO4â€"" and H3O.
Taking into account the Brønsted-Lowry acid-base theory, a base/conjugate acid pair is H₂O/H₃O⁺.
The Brønsted-Lowry acid-base theory (or the Brønsted-Lowry theory) identifies acids and bases based on whether the species accepts or donates protons or H⁺.
According to this theory, acids are proton donors while bases are proton acceptors. That is, an acid is a species that donates an H⁺ proton while a base is a chemical species that accepts an H⁺ proton from the acid.
So, reactions between acids and bases are H⁺ proton transfer reactions, causing the acid to form its conjugate base and the base to form its conjugated acid by exchanging a proton.
In other words, a conjugate base is an ion or molecule resulting from the acid that loses the proton, while a conjugate acid is an ion or molecule resulting from the base that gains the proton:
acid + base ⇄ conjugate base + conjugate acid
In this case, you know:
H₂PO₄ + H₂O → H₃O⁺ + HPO₄⁻
H₂PO₄ behaves like acid because donates an H⁺ proton while H₂O behaves like base because accepts an H⁺ proton from the acid.
So, H₃O⁺ is the conjugate acid of the H₂O and HPO₄⁻ is conjugate base of H₂PO₄.
In summary, a base/conjugate acid pair is H₂O/H₃O⁺.
Learn more about the Brønsted-Lowry acid-base theory:
https://brainly.com/question/12916250?referrer=searchResultshttps://brainly.com/question/1191429?referrer=searchResultshttps://brainly.com/question/4000152?referrer=searchResultshttps://brainly.com/question/12808135?referrer=searchResultsMichael was sitting at his desk one morning. He noticed a small spot of light on the wall
which moved with his arm. What could be causing this spot of light on the wall?
O a) light from the window being refracted
by his watch band
b) light from the window reflecting off the
face of his watch
O c) light from the window being absorbed
by the wall
d) light from his watch refracting on the
wall
Answer:
Light from the window reflecting off the face of his watch <33
5 grams of sodium bicarbonate, a white powdery solid, is placed in an empty red balloon. 100 grams of acetic acid, a clear aqueous solution, is placed in the plastic bottle. The balloon is carefully attached to the bottle so that no air can get in or out and the powder does not fall into the bottle. Once attached, the apparatus is placed on a balance and the contents are mixed. Bubbles form, the balloon inflated, and the white powder is no longer visible. Which of the these statements would match your observations? A) A chemical reaction has occurred and the mass will increase. B) A chemical reaction has occurred and the mass will decrease. C) A physical reaction has occurred and the mass will decrease. D) A chemical reaction has occurred and the mass will remain the same.
Answer: im pretty sure its D
Explanation:
What is meant by collision theory?
Answer:
The collision theory states that a chemical reaction can only occur between particles when they collide (hit each other).
hope it helps~
Which statement describes one feature of Rutherford model of the atom
[tex] \huge{ \color{magenta}{ \fcolorbox{magenta}{black}{ \huge{ \color{white}{ \fcolorbox{aqua}{black}{♡Answer♡ }}}}}}[/tex]
The Rutherford model shows that an atom is mostly empty space, with electrons orbiting a fixed, positively charged nucleus in set, predictable paths.
what are two possible ways to show the structure of ch4?
Answer: Two possible ways to show the structure of CH4 are its electron dot diagram or structural formula. CH4 or methane's molecular formula is given as CH4. The structural formula is a graphical representation of a chemical compound.
Answer:
using electron dot diagrams or structional formula
How long is a sunflower seed? Select the best estimate.
15 meters
15 kilometers
15 millilmeters
15 centimeters
Answer:
15 millimeters
Explanation:
the other answer choices are too large.
Answer:
15 millimeters
Explanation:
The other options are too long.
50 points for anyone who answeres properly. How does a structure of a triglyceride differ from the reaction of fructose?
Triglycerides and fructose are both monomers, but they differ in how they bond to other monomers.
Fructose forms large polymers by the process of hydrolysis, while a triglyceride forms monomers by the process of dehydration.
Fructose is a form of carbohydrate, while a triglyceride is a lipid.
A triglyceride is a polymer, while fructose is a monomer.
Answer:
Fatty Acids
A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.
Saturated Fatty Acids
In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.
Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.
Unsaturated Fatty Acids
In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.
Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.
Lipids and Diet
Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.
Fructose is a simple carbohydrate sugar, while triglycerides are the lipids or the fats of the body. Thus, option C is accurate.
What are triglycerides and fructose?Triglycerides are lipids of the body that are formed of fatty acids and glycerols. It makes the body fat of the animals and of the plants. They are stored in cells for future use and provide energy when needed.
Fructose is a monomer that is the simplest carbohydrate sugar and is generally found in sugarcane, honey, watermelon, grapes, apples, etc.
Therefore, option C. fructose is sugar and triglyceride is fat is correct.
Learn more about triglycerides and fats here:
https://brainly.com/question/17576593
#SPJ2
The main-group elements are the forty-four elements that occupy groups 1A-8A of the periodic table. Main-group elements are important because of their high natural abundance both in the Earth's crust and in the human body and are commercially valuable. Review the families containing main group elements. Identify all the characteristics that apply to the elements in family IA.
Answer:
The answer is a,b, and c. This is for the USA tesprep videos
Explanation:
The characteristics that apply to the elements in the family are they are highly reactive, they are shiny, soft metals and the element form +1 ions when forming compounds. Thus option a, b and c is correct.
What are main group elements?Main group elements are defined as any of the element belonging to the s and p blocks of the periodic table.
They are most abundant element in universe and on earth.
This elements and their compound are one of the most important economical elements.
They are very good conductor of heat and electricity.
Thus, the characteristics that apply to the elements in the family are they are highly reactive, they are shiny, soft metals and the element form +1 ions when forming compounds. Thus option a, b and c is correct.
To learn more about main group elements, refer to the link below:
https://brainly.com/question/5460947
#SPJ5
What happens to the atoms in a chemical reaction? Explain with an example
The work you do on a machine is called the_________________
Answer:
THE WORK YOU DO ON A MACHINE IS CALLED WORK INPUT
How many molecules are present in a sample that is 89 g of H2O?
[tex]\qquad[/tex][tex] \pink{\bf\longrightarrow { Molar \:mass \:of \:H₂O:-} }[/tex]
[tex]\qquad[/tex][tex] \sf \longrightarrow 1\times +16[/tex]
[tex]\qquad[/tex][tex] \sf \longrightarrow 18g[/tex]
[tex]\qquad[/tex]____________________
Let's calculate the number of moles present in 89g of H₂O.
[tex]\qquad[/tex][tex] \purple{\bf\longrightarrow { No \:of \:moles = \dfrac{Given \:mass}{Molar\: mass}}}[/tex]
[tex]\qquad[/tex][tex] \sf \longrightarrow \dfrac{89}{18}[/tex]
[tex]\qquad[/tex][tex] \sf \longrightarrow 4.94\: moles[/tex]
We know –
Avogadro number = 6.022×10²³Number of molecules:-
[tex]\qquad[/tex][tex] \purple{\bf \longrightarrow No \: of \: moles \times Avogadro \: number}[/tex]
[tex]\qquad[/tex][tex] \sf \longrightarrow 4.94×6.022×10²³[/tex]
[tex]\qquad[/tex][tex] \sf \longrightarrow 2.98 ×10²⁴[/tex]
[tex]\qquad[/tex][tex]\purple{ \bf \longrightarrow 2.98×10²⁴ molecules}[/tex]
Thus, 2.98×10²⁴ molecules are there in 89g of H₂O.[tex]\qquad[/tex]____________________
What is the percent, by mass, of water in MgSO4.2H20
Answer:51.1%
Explanation:
Mass percent : It is defined as the mass of the given component present in the total mass of the compound. Formula used : First we have to calculate the mass of and . Mass of = 18 g/mole Mass of = 7 × 18 g/mole = 126 g/mole Mass of = 246.47 g/mole Now put all the given values in the above formula, we get the mass percent of in . Therefore, the mass percent of in is, 51.1%
Which of these would describe a dish that contains bits of chocolate and nuts you can see?
homogeneous mixture
compound
heterogeneous mixture
none of the above
Answer:
mezcla homogénea
Answer:
heterogeneous mixture
Explanation:
you can split the mixture easily with you hands while homogeneous mixtures is dissolved
PLEASE HELP ASAP I'M SO STRESSED
Answer:
160.3g
Explanation:
We know the equation:
No of moles = mass ÷ Mass of element
We need to find the mass, so make mass the subject of the formula.
Mass = No. of moles × mass of element
Mass = 5 × 32.06
Mass = 160.3g
100 POINTS PLEASE HELP
1. What is the molar mass of NaOH?
2.How many atoms are in 3.35 moles of Aluminum?
3.How many moles of CO2 gas are in a 101.25 L container filled with CO2 gas?
4.What is the mass of 13.7 moles of N2 gas?
5.How many moles are in 78.5 molecules of CaCO3?
Answer:
1. 39.997 g/mol
2. 6.022⋅1023 atoms of aluminium
3. 0.026 moles
4. 14 grams is the molar mass of nitrogen meaning that one mole of nitrogen atoms is 14 grams. One mole of any substance has 6.02*10^23 atoms/molecules of that subtance therefore there are 6.02*10^23 atoms of nitrogen in 14g of nitrogen
5. 78.5
Explanation:
2 WHAT ARE THE THREE THINGS NECESSARY TO MAINTAIN A FIRE?
Answer:
Oxygen, heat, and fuel
Explanation:
Oxygen, heat, and fuel are frequently referred to as the "fire triangle." Add in the fourth element, the chemical reaction, and you actually have a fire "tetrahedron." The important thing to remember is: take any of these four things away, and you will not have a fire or the fire will be extinguished.
how does ionization energy increase on the periodic table
[tex]\huge \bf༆ Answer ༄[/tex]
The trends showing increase in ionization energy on the periodic table ~
Ionization energy increases as we move from left to right in a period.[ due to increase in effective nuclear charge ]
Ionization energy increases as we move from bottom to top in a group.[ Due to decrease in number of shells ]
Ionization energy increases across a period from left to right in the periodic table.
Ionization energyIonization energy is the energy needed for the complete removal of valence electrons in its ground state from an isolated atom in its gaseous phase at a specified temperature to form an ion.
Ionization energy shows periodicity in that it shows a regular variation across a period and down a group in the periodic table.
Ionization energy increases across a period from left to right in the periodic table.
Learn more about ionization energy at: https://brainly.com/question/1445179
Andrea is making a solution of sweet tea, with 20 grams of sugar dissolved in 180
grams of water. Determine the mass percentage of sugar in the sweet tea.
The mass percentage of sugar in the sweet tea is 10%
From the question,
We are to determine the mass percentage of sugar in the sweet tea
[tex]Mass\ percentage\ of\ sugar\ in\ the\ sweet\ tea = \frac{Mass\ of\ sugar\ in\ the\ solution}{Mass\ of\ the\ solution} \times 100\%[/tex]
Mass of sugar in the solution = 20 g
Mass of the solution = 20g + 180g = 200g
[tex]Mass\ percentage\ of\ sugar\ in\ the\ sweet\ tea = \frac{20}{200} \times 100\%[/tex]
[tex]Mass\ percentage\ of\ sugar\ in\ the\ sweet\ tea = \frac{20}{2} \%[/tex]
∴ Mass percentage of sugar in the sweet tea = 10%
Hence, the mass percentage of sugar in the sweet tea is 10%
Learn more here: https://brainly.com/question/13896694
If the velocity of a wave is 12 m/s and its frequency is 600 hertz, what would be its wavelength?
Answer:
The wavelength is 0.02 m.
Step-by-step explanation:
Given :
[tex]\green\star[/tex] Velocity = 12 m/s[tex]\green\star[/tex] Frequency = 600 HzTo Find :
[tex]\green\star[/tex] WavelengthUsing Formula :
Apply Wavelength formula :
[tex]\star{\small{\underline{\boxed{\sf{\purple{\lambda = \dfrac{v}{f}}}}}}}[/tex]
[tex]\pink\star[/tex] λ = Wavelength [tex]\pink\star[/tex] v = Velocity [tex]\pink\star[/tex] f = FrequencySolution :
Finding the wavelength by substituting the values in the formula :
[tex]{\longrightarrow{\sf{\lambda = \dfrac{v}{f}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = \dfrac{12}{600}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = \dfrac{\cancel{12}}{\cancel{600}}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = \dfrac{2}{100}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = \cancel{\dfrac{2}{100}}}}}[/tex]
[tex]{\longrightarrow{\sf{\lambda = 0.02}}}[/tex]
[tex]\star{\underline{\boxed{\tt{\red{\lambda = 0.02 \: m}}}}}[/tex]
Hence, the wavelength is 0.02 m.