Answer:
Fatty Acids
A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.
Saturated Fatty Acids
In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.
Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.
Unsaturated Fatty Acids
In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.
Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.
Lipids and Diet
Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.
Fructose is a simple carbohydrate sugar, while triglycerides are the lipids or the fats of the body. Thus, option C is accurate.
What are triglycerides and fructose?Triglycerides are lipids of the body that are formed of fatty acids and glycerols. It makes the body fat of the animals and of the plants. They are stored in cells for future use and provide energy when needed.
Fructose is a monomer that is the simplest carbohydrate sugar and is generally found in sugarcane, honey, watermelon, grapes, apples, etc.
Therefore, option C. fructose is sugar and triglyceride is fat is correct.
Learn more about triglycerides and fats here:
https://brainly.com/question/17576593
#SPJ2
4. A photon has an energy of 2.93x10^-25 Jouls. What is the
frequency? What is the wavelength in nm?
Answer:
Hope this answer helps
Explanation:
magnesium carbonate and sulphuric acid react to form
Answer:
magnesium sulfate + water + carbon dioxide
Explanation:
a magnesium ion has 12 protons and a charge of 2 . how many electrons does it contain?
Answer:
It contains 12 electrons.
How can you tell the difference between two clear liquids
Answer:
To identify a pure liquid substance using the physical properties of solubility, density, and boiling point. The physical properties of a pure substance can be measured without changing the composition of the substance.
Explanation:
How many grams of copper would you need to produce 50.0g of silver? 1 Cu + 2 AgNO3 ----> 2 Ag + 1 Cu(NO3)2
!!!SOMEONE HELP !!!
PLEASE
Answer:
use other websites u might have luck and find ur anwer
Explanation:
(
−
5
2
)
−
1
(
−
5
+
1
)
=
24
−
4
=
−
6
(−5+1)
(−5
2
)−1
=
−4
24
=−6
Definition for starch in science ?
Answer:
Starch is a polysaccharide comprising glucose monomers joined in α 1,4 linkages. orStarch is a long-chain polymer of glucose molecules joined together. orA starch is a complex polysaccharide made up of a large number of glucose units joined together by glycosidic bonds.Explanation:
starch, a white, granular, organic chemical that is produced by all green plants. Starch is a soft, white, tasteless powder that is insoluble in cold water, alcohol, or other solvents.
Starch is amongst the most abundant plant products and is a mixture of two polymers, amylose and amylopectin. During food processing starch is transformed by hydrothermal treatments. ... The structure of starch is also influenced by specific and non-specific interactions with other food constituents and ingredients.
When water changes state from solid to liquid to gas, ALL BUT one thing happens. There is no
A) chemical change.
B) physical change.
C) addition of energy.
D) increase in temperature.
Which of the following giant covalent structures does not have a high melting and boiling
point?
a) Polythene
b) Graphite
c) Silicon dioxide
d) Diamond
Answer:
Polythene has the lowest melting/boiling point from all the other covalent structures mentioned in this question.
Answer:
Polythene (polyethene according the IUPAC nomenclature.)
Explanation:
Consider the structure of each option:
Polythene: long chains of atoms that are able to rotate along the bonding axis. Graphite: layers of (hexagonal) carbon sheets; each individual sheet is rigid (allows no rotation.) Silicon dioxide: three-dimensional (tetrahedral) network of carbon and oxygen atoms; the entire network very rigid (allows no rotation.)Diamond: three-dimensional (tetrahedral) network of carbon atoms; likewise, the entire tetrahedral network is very rigid.Melting each structure requires overcoming the forces that hold the structure rigid:
In polythene, van der Waal forces hold the chains together and prevents rotations.Deshaping graphite requires bending the layers; doing so would require overcoming the covalent bonds within the hexagonal sheets.In silicon dioxide and diamond, deshaping the tetrahedral network also requires overcoming covalent bonds.Van der Waal forces are much easier to break than covalent bonds.
Hence, the melting point of polythene would be the lowest among the options.
look at attachment please help with it, will mark brainliest <3 BUT ONLY IF CORRECT
Explain two ways to restore the Florida Panther population.
Answer:
Explanation: encourage your legislators to support land acquisition programs such as Florida Forever and the Rural and Family Lands Protection Program.
what happens when carbon dioxide gas is cooled to -78 degree Celsius
Answer:
It will be solid
Explanation:
-78 C° is the freezing point of carbon dioxide, so at the temperature of -78 Celsius, the particles of carbon dioxide will come closer together and have about a fixed position to vibrate. The carbon dioxide will turn into solid. The solid form of carbon dioxide is also called dry ice.
Rewrite 5.13467 X 10-6 in correct standard form
So if you take an egg and cook it, is it still a baby chicken?
When the egg first forms it's only one cell, and is fertilized as it moves down the oviduct to be laid
__________________________________________________________
this point it's technically an embryo : though it doesn't look like a baby chick
___________________________________________________________
o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0o0
Which of these is found in the energy levels of an atom?
Answer:
Electrons
Explanation:
Because the nucleas is In the middle and the Electrons surround it
What is the purpose of the chemical ammonia (NH3) in hair dyes?
Answer: Ammonia, an alkaline chemical, is used to raise the pH level (it's levels of acidity) of our hair during the colouring process. This then lifts the cuticles of the hair fibre and allows the colour to be deposited onto the cortex (the inner part of the hair protected by the cuticles). In hair coloring products, ammonium hydroxide is used to support the lightening action of hydrogen peroxide and to prepare hair to accept color pigments. Alkaline properties of ammonia raise the cuticle and allow peroxide and dye molecules to penetrate the hair shaft. (creds to the internet)
Explanation: Hope this helps! :D
How is a stable hydrogen atom different from every other atom?
Answer:
a hydrogen atom contains only one proton in it's nucleus, while atoms of all other elements contain more than one proton
Brainliest plzz
The equation shows cellular respiration. During cellular respiration, glucose combines with oxygen to form carbon dioxide, water, and ATP. Uppercase C 6 uppercase H 12 uppercase O 6 6 uppercase O 2 right-arrow 6 uppercase C uppercase 0 2 6 uppercase H 2 uppercase 0 A T P What happens to the energy in the bonds in glucose?.
The energy in the bonds in glucose will be broken down and transferred to ATP molecules.
CELLULAR RESPIRATION:Cellular respiration is the process by which living organisms obtain energy by breaking down food molecules in their cells.
The equation for cellular respiration is as follows:
C6H12O6 + 6O2 → 6CO2 + 6H2O + ATP
Based on the illustration using the above equation, the energy stored in the bonds of glucose molecule is broken down and used to synthesize ATP molecules.
Learn more about cellular respiration at: https://brainly.com/question/12671790
what is the mass of 3.0 x x times 10^23 atoms of neon?
Answer:
10.09 grams
Explanation:
First you need to know the number of moles you are dealing with.
If you know that each mole has 6.022x10²³ of something (in this case of atoms), you can divide 3x10²³ atoms of neons by 6.022x10²³ to obtain the number of moles.
You have 0.5 moles of Neon, so then by the periodic table, you see that the molar mass of neon is 20.18g/mol, so by each mole you have 20.18 grams of neon. Multiply 20.18 grams by 0.5 moles and you got 10.09 grams of Neon
a side reaction occurs when acid is added to the system. which species reacts with the acid?
A side reaction occurs when acid is added to the system, so the species reacts with the acid is base.
What are acids?Acids are those species which have a pH range in between 0 to 7, generally acids are present with hydrogen atom in their molecular formula.
If in any reaction after adding the acid, side reaction wiull occur then in this condition base will reacts with the acid as it has the opposite behavior as of acid and formation of salt & water molecules takes plavce.
Hence the needed species is base.
To know more about acid-base reaction, visit the below link:
https://brainly.com/question/24807171
How did President Wilson anger civil rights advocates?
Answer:
He put segregationists in charge of federal agencies...
Explanation:
...
Answer:
He placed segregationists in charge of federal agencies.
Explanation:
Pls help if you only know the correct answer! Thanks! :)
18. the blank should be "[tex]CO_{2}[/tex]"
19. the question seems to be answered.
20. [tex]CH_{3}[/tex]
2NaOH(aq) + Cl2(g) -> NaCl(aq) + NaClO(aq) + H20(l)
Answer:
Cl2(g) + 2 NaOH(aq) = NaCl(aq) + NaClO(aq) + H2O(l)
Explanation:
How do you convert particles to moles, and mass to moles?
1) 77.56 g of CaCO3 to moles
2) 2.55 x 10^24 molecules of KCl to grams
3) 0.0931 mol of BaCl2 to grams
4) 1.55 x 10^22 molecules to moles
5) 0.664 moles of HF to molecules
6) 86 g of Fe(NO3)3 to moles
7) 7.88 x 10^23 molecules of CO2 to grams
8) 2.93 moles of MgF2 to grams
9) 7.56 g of MgCO3 to moles
10) 8.55 x 10^21 molecules of NaCl to grams
1. mol = 77.56/100 = 0.7756 mol
2. mol = 2.55 × 10^24/6.02 × 10^23 = 4.236 mol mass = 4.236 × 74.5 = 315.582 g
3. mass = 0.0931 × 208.3 = 19.393 g
4. mol = 1.55 × 10^22/6.02 × 10^23 = 0.0257 mol
5. molecules = 0.664 × 6.02 × 10^23 = 3.997 × 10^23 molecules
6. mol = 86/242 = 0.355 mol
7. mol = 7.88 × 10^23/6.02 × 10^23 = 1.309 mol mass = 1.309 × 44 = 57.596 g
8. mass = 7.56 × 62 = 468.72 g
9. mol = 7.56/84 = 0.09 mol
10. mol = 8.55 × 10^21/6.02 × 10^23 = 0.014 mol mass = 0.014 × 58.5 = 0.819 g
recheck to ensure all answers are correct
An atom which has 9 protons, 8 neutrons, and 9 electrons will have an atomic mass of how many amu?
a. 6
b. 8
C. 9
d. 17
Answer:
D
Explanation:
Protons and Neutrons both have a mass of about 1 amu so you add them but electrons have a mass of 0 amu so they are left out.
where is the atomic mass on the periodic table
Explanation:
At the upper left is the atomic number, or number of protons. In the middle is the letter symbol for the element (e.g., H). Below is the relative atomic mass, as calculated for the isotopes found naturally on Earth. At the very bottom is the name of the element (e.g., hydrogen).
Passing an electric current through a sample of water (H2O) can cause the water to decompose into hydrogen gas (H2) and oxygen gas (O2) according to the following equation. 2H2O Right arrow. 2H2 O2 The molar mass of H2O is 18. 01 g/mol. The molar mass of O2 is 32. 00 g/mol. What mass of H2O, in grams, must react to produce 50. 00 g of O2? 14. 07 23. 05 28. 14 56. 28.
The mass of water decomposed to produce 50 g oxygen has been 56.28 g. Thus, option D is correct.
The reaction for the decomposition of water has been:
[tex]\rm 2\;H_2O\;\rightarrow\;H_2\;+\;O_2[/tex]
From the balanced equation, 2 moles of water decomposes to form 1 moles of hydrogen and 1 mole of oxygen.
The mass of oxygen produced has been 50 g. The moles of oxygen has been given by:
[tex]\rm Moles=\dfrac{mass}{molar\;mass}[/tex]
The moles of oxygen has been:
[tex]\rm Moles_O_2=\dfrac{50}{32}\;mol\\Moles_O_2=1.5625\;mol[/tex]
The moles of oxygen produced has been 1.5625 mol.
The moles of hydrogen decomposed has been given from the balanced chemical equation as:
[tex]\rm 1 \;mole\;O_2=2\;mole\;H_2O\\1.5625\;mol\;O_2=1.5625\;\times\;2\;mol\;H_2O\\1.5625\;mol\;O_2=3.125\;mol\;H_2O[/tex]
The moles of hydrogen decomposes has been 3.125 mol.
The mass of hydrogen decomposed has been given by:
[tex]\rm Mass=moles\;times\;molar\;mass\\Mass_{H_2O}=3.125\;\times\;18.01\;g\\Mass_{H_2O}=56.28\;g[/tex]
The mass of water decomposed to produce 50 g oxygen has been 56.28 g. Thus, option D is correct.
For more information about moles produced, refer to the link:
https://brainly.com/question/10606802
Given the equation
N2(g) +3H2 (g)--> 2NH3 (g)
1 mole of N2 gas is needed to completely react with 3 moles of H2 gas.
How many molecules of H2 gas are needed?
Answer:
numbers of molecules = 3×6.023×10-23
why do solids maintain their shape whereas fluids do not
Most weak bases are:
a. Anions of weak acids
b. Anions of strong acids
C.Cations of weak acids
d. Both A and C
Answer:
The conjugate base of a very weak acid is stronger than the conjugate base of a strong acid.
Explanation:
The stronger the acid, the weaker its conjugate base and vice versa A very weak acid has a very strong conjugate base.